Consider the following reaction: 2NO(g)+O2(g)⇌2NO2(g) The data in the table show the equilibrium constant for this reac...
Consider the following reaction: 2NO(g)+O2(g)⇌2NO2(g) The data in the table show the equilibrium constant for this reaction measured at several different temperatures.
Temperatures: Kp:
170K 3.8*10^-3
180K 0.34
190K 18.4
200K 681
Part A Use the data to find ΔH∘rxn and ΔS∘rxn for the reaction.
i found ΔH∘rxn = 114 kJ but i dont know how to get ΔS∘rxn. please help and show work
Homework Answers
Plot a graph between 
on x-axis and 
on y-axis. A straight line is obtained. Get the equation for the straight line obtained. Find the slope and intercept of the straight line.
Compare the straight line obtained with the equation 
. Slope of the straight line is equal to 
and intercept is equal to 
.
Relation between equilibrium constant and standard Gibbs free energy is 
. Relation between standard Gibbs free energy change, standard enthalpy change, and standard entropy change is 
. From the two relations: 
. Here, 
is gas constant and 
is temperature in Kelvin scale.
From the given values of temperature (
) and equilibrium constant (
), a table is prepared with 
and 
values, as follows:
The graph between on x-axis and on y-axis is as follows:
Slope of the straight line is 
and intercept of the straight line is 
.
The value of 
is 
and the value of 
is 
.
Add Answer to:
Consider the following reaction: 2NO(g)+O2(g)⇌2NO2(g) The data in the table show the equilibrium constant for this reac...
Consider the following reaction: 2NO(g)+O2(g)⇌2NO2(g)2NO(g)+O2(g)⇌2NO2(g) The data in the table show the equilibrium constant for this...
Consider the following reaction: 2NO(g)+O2(g)⇌2NO2(g)2NO(g)+O2(g)⇌2NO2(g) The data in the table show the equilibrium constant for this reaction measured at several different temperatures. Temperature K 400 1.9x10^7 425 2.5x10^6 465 1.6x10^5 515 8.8x10^3 600 2.0x10^2 Use the data to find ΔrS∘ΔrS∘ for the reaction. (answer in J K-1 mol-1) The answer is NOT 158
Consider the following reaction: 2NO(g)+O2(g)→2NO2(g)2NO(g)+O2(g)→2NO2(g) Estimate ΔG∘for this reaction at each of the following temperatures and...
Consider the following reaction: 2NO(g)+O2(g)→2NO2(g)2NO(g)+O2(g)→2NO2(g) Estimate ΔG∘for this reaction at each of the following temperatures and predict whether or not the reaction will be spontaneous. (Assume that ΔH∘ΔH∘ and ΔS∘ΔS∘ do not change too much within the give temperature range.) 1) 713 2) 852
Consider the following reaction: 2NO(g)+O2(g)→2NO2(g) Estimate ΔG∘ for this reaction at each of the following temperatures...
Consider the following reaction: 2NO(g)+O2(g)→2NO2(g) Estimate ΔG∘ for this reaction at each of the following temperatures and predict whether or not the reaction will be spontaneous. (Assume that ΔH∘ and ΔS∘ do not change too much within the give temperature range.) ANSWER MUST BE IN kJ!! a) 722 K b) 860 K
Consider the reaction: 2NO(g) + O2(g)2NO2(g) Using standard thermodynamic data at 298K, calculate the free energy...
Consider the reaction: 2NO(g) + O2(g)2NO2(g) Using standard thermodynamic data at 298K, calculate the free energy change when 1.710 moles of NO(g) react at standard conditions. G°rxn = kJ
Calculate ΔS∘rxn for the reaction 2NO(g)+O2(g)→2NO2(g) Substance S∘ (J/mol⋅K) NO2 240.0 O2 205.2...
Calculate ΔS∘rxn for the reaction 2NO(g)+O2(g)→2NO2(g) Substance S∘ (J/mol⋅K) NO2 240.0 O2 205.2 NO 210.8
Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) Given the following reactions and enthalpies of formation: N2(g)...
Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) Given the following reactions and enthalpies of formation: N2(g) + 2O2(g)→ 2NO2(g), ΔH∘ = 66.4kJ N2(g)+ O2(g)→ 2 NO(g), ΔH∘=180.4 kJ Please explain the steps as well!
For the reaction 2NO(g) + O2(g) ® 2NO2(g), DH° = -113.1 kJ/mol and DS° = -145.3...
For the reaction 2NO(g) + O2(g) ® 2NO2(g), DH° = -113.1 kJ/mol and DS° = -145.3 J/K·mol. Under which temperature conditions would the reaction be spontaneous? _________. a. For all temperatures b. Only at high temperatures c. Only at low temperatures
Part A Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) given the following reactions and enthalpies of fo...
Part A Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) given the following reactions and enthalpies of formation: 12N2(g)+O2(g)→NO2(g), ΔH∘A=33.2 kJ 12N2(g)+12O2(g)→NO(g), ΔH∘B=90.2 kJ Express your answer with the appropriate units. Part B Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)→3O2(g)+B2H6(g), ΔH∘A=+2035 kJ 2B(s)+3H2(g)→B2H6(g), ΔH∘B=+36 kJ H2(g)+12O2(g)→H2O(l), ΔH∘C=−285 kJ H2O(l)→H2O(g), ΔH∘D=+44 kJ Express your answer with the appropriate units.
The equilibrium constant KcKc for the reaction 2NO(g)+O2(g)⇌2NO2(g)2NO(g)+O2(g)⇌2NO2(g) is 6.9×1056.9×105 at 500 KK. A 5.0 LL...
The equilibrium constant KcKc for the reaction 2NO(g)+O2(g)⇌2NO2(g)2NO(g)+O2(g)⇌2NO2(g) is 6.9×1056.9×105 at 500 KK. A 5.0 LL reaction vessel at 500 KK was filled with 0.052 molmol of NONO, 1.1 molmol of O2O2, and 0.90 molmol of NO2NO2. Part A What is the value of QcQc? Express your answer to two significant figures.
3. Consider the chemical equilibrium for the following chemical reaction AH -+114 kJ 2NO2(g) 2NO(g) +...
3. Consider the chemical equilibrium for the following chemical reaction AH -+114 kJ 2NO2(g) 2NO(g) + 02(s) Assume that the chemical reaction is at equilibrium. How will each of the follow- Kp)? Fill in the blanks by PNO ing changes affect the indicated quantities (PNo2 Po answering: increase, decrease, or no change. Poa PO К, PNO2 Pos PNO2 PM No hange (a) temperature is lowered (b) remove NO gas from the reaction flask (a) double the volume of the reaction...
3. Consider the chemical equilibrium for the following chemical reaction AH -+114 kJ 2NO2(g) 2NO(g) + 02(s) Assume that the chemical reaction is at equilibrium. How will each of the follow- Kp)? Fill in the blanks by PNO ing changes affect the indicated quantities (PNo2 Po answering: increase, decrease, or no change. Poa PO К, PNO2 Pos PNO2 PM No hange (a) temperature is lowered (b) remove NO gas from the reaction flask (a) double the volume of the reaction...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 36 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago