i need the answer for all of it because its all connected
pleaseHomework Answers
Add Answer to:
i need the answer for all of it because its all connected
please
1. Determine the...
i need help with these redox reactions H NO; + Re s or + H₂O Fes:...
i need help with these redox reactions
H NO; + Re s or + H₂O Fes: NO, pyrite) Oxidation Hall Reaction: Reduction Half Reaction: Oxidizing agent Reducing agent Mn? + HO; + OH MnO + H2O Oxidation Half Reaction: Reduction Hall Reaction: Oxidizing agent: Reducing agent _MnO + NO + H2O → MnO: + NO + OH- Oxidation Half Reaction: Reduction Half Reaction: Oxidizing agent: Reducing agent 0 Clz + OH - CH + CIO + H:0 Oxidation Half Reaction:...
not sure if i did either of these right and i need help solving the rest...
not sure if i did either of these right and i need help
solving the rest of it. thanks
error in your experiment. POST-LABORATORY QUESTIONS Procedure: Balance the redox reactions given below. Show your work on a separate sheet of paper. Write the balanced oxidation and reduction half reactions; also identify the oxidizing agent and the reducing agent. All reactions are to be balanced in acidie media, except when OH is shown. (0) Cu + 2 NO, + 4 H...
i just need help with the problem that has been worked on. i dont think i...
i just need help with the problem that has been worked on. i
dont think i did it right
3. MnO2 + H + HNO, Mn + -H Oxidation Half Reaction: Reduction Hall Reaction: Oxidizing agent: Reducing agent 4. PbO2 + Mn + S0- + H2O Dr H H MnO4 + → ___PbSO PbSO+ Oxidation Half Reaction: Reduction Half Reaction: Oxidizing agent: Reducing agent 6 3 HNO2 + CrO2- +5H → 2Cr + 3 NO: + 4 H:0 Oxidation Half...
Chem 2A: Oxidation Numbers, Oxidation/Reduction rium 1. Determine the oxidation number of chlorine in the f...
Chem 2A: Oxidation Numbers, Oxidation/Reduction rium 1. Determine the oxidation number of chlorine in the following: a) Cl b) C c) CIO d) MgCl e) ClO ) KCIO g) HCI h) NaCIO 2. Write a balanced, chemical equation for the reaction that occurs between aluminum and hydrochloric acid. Write the total and net ionic equation. b) Using the net ionic equation, determine the oxidation number on each reactant and product. Write them underneath the formulas. Determine who is oxidized/reduced. c)...
please read carefully no one has gotten it right yet Choose all of the statements from...
please read carefully no one has gotten it right yet
Choose all of the statements from below which are true about oxidation and reduction. Oxidation and reduction are opposite processes with respect to bookkeeping electrons. Oxidation is what happens when an element in a substance increases its oxidation number. Electrons appear on the left side of an oxidation half reaction. An oxidant is an oxidizing agent, which becomes oxidized during the course of a redox reaction. Reduction is what happens...
Choose all of the statements from below which are true about oxidation and reduction. Oxidation and reduction are oppos...
Choose all of the statements from below which are true about oxidation and reduction. Oxidation and reduction are opposite processes with respect to bookkeeping electrons. Oxidation is what happens when an element in a substance gains electrons. Electrons appear on the right side of an oxidation half reaction. An oxidant is an oxidizing agent, which becomes oxidized during the course of a redox reaction. Reduction is what happens when an element in a substance decreases its oxidation number. Electrons appear...
Balance the redox reaction given 7. H → NO2+ Fe + SO4 + H2O FeS2 +...
Balance the redox reaction given
7. H → NO2+ Fe + SO4 + H2O FeS2 + NO3 + (pyrite) Oxidation Half Reaction: Reduction Half Reaction: Oxidizing agent: Reducing agent
Choose all of the statements from below which are true about oxidation and reduction Oxidation and...
Choose all of the statements from below which are true about oxidation and reduction Oxidation and reduction are opposite processes with respect to bookkeeping electrons. Oxidation is what happens when an element in a substance increases its oxidation number. Electrons appear on the right side of an oxidation half reaction. An oxidant is an oxidizing agent, which becomes reduced during the course of a redox reaction Reduction is what happens when an element in a substance decreases its oxidation number....
Question 1: Consider the following oxidation-reduction reaction: I−(aq)+Cu+(aq)→IO4−(aq)+Cu(s) A: What are the initial a...
Question 1: Consider the following oxidation-reduction reaction: I−(aq)+Cu+(aq)→IO4−(aq)+Cu(s) A: What are the initial and final oxidation states of iodine? B: What are the initial and final oxidation states of copper? C: What element is reduced? D:What is the reducing agent? E: What element is oxidized? F: What is the oxidizing agent? G: Give the atom- and electron-balanced oxidation half-reaction occurring in acidic solution. Express your answer as a chemical equation. Include all phases. H: Give the atom- and electron-balanced reduction...
1. 3NiO2 + 2NO+ 4H+ ------------------------3Ni2+ + 2NO3-+ 2H2O In the above redox reaction, use oxidation...
1. 3NiO2 + 2NO+ 4H+ ------------------------3Ni2+ + 2NO3-+ 2H2O In the above redox reaction, use oxidation numbers to identify the element oxidized, the element reduced, the oxidizing agent and the reducing agent. name of the element oxidized: name of the element reduced: formula of the oxidizing agent: formula of the reducing agent: 2. 2NO2 + Cu2++ 2H2O--------------------------Cu + 2NO3-+ 4H+ In the above redox reaction, use oxidation numbers to identify the element oxidized, the element reduced, the oxidizing agent and...
i need help with these redox reactions
H NO; + Re s or + H₂O Fes: NO, pyrite) Oxidation Hall Reaction: Reduction Half Reaction: Oxidizing agent Reducing agent Mn? + HO; + OH MnO + H2O Oxidation Half Reaction: Reduction Hall Reaction: Oxidizing agent: Reducing agent _MnO + NO + H2O → MnO: + NO + OH- Oxidation Half Reaction: Reduction Half Reaction: Oxidizing agent: Reducing agent 0 Clz + OH - CH + CIO + H:0 Oxidation Half Reaction:...
not sure if i did either of these right and i need help
solving the rest of it. thanks
error in your experiment. POST-LABORATORY QUESTIONS Procedure: Balance the redox reactions given below. Show your work on a separate sheet of paper. Write the balanced oxidation and reduction half reactions; also identify the oxidizing agent and the reducing agent. All reactions are to be balanced in acidie media, except when OH is shown. (0) Cu + 2 NO, + 4 H...
i just need help with the problem that has been worked on. i
dont think i did it right
3. MnO2 + H + HNO, Mn + -H Oxidation Half Reaction: Reduction Hall Reaction: Oxidizing agent: Reducing agent 4. PbO2 + Mn + S0- + H2O Dr H H MnO4 + → ___PbSO PbSO+ Oxidation Half Reaction: Reduction Half Reaction: Oxidizing agent: Reducing agent 6 3 HNO2 + CrO2- +5H → 2Cr + 3 NO: + 4 H:0 Oxidation Half...
Chem 2A: Oxidation Numbers, Oxidation/Reduction rium 1. Determine the oxidation number of chlorine in the following: a) Cl b) C c) CIO d) MgCl e) ClO ) KCIO g) HCI h) NaCIO 2. Write a balanced, chemical equation for the reaction that occurs between aluminum and hydrochloric acid. Write the total and net ionic equation. b) Using the net ionic equation, determine the oxidation number on each reactant and product. Write them underneath the formulas. Determine who is oxidized/reduced. c)...
please read carefully no one has gotten it right yet
Choose all of the statements from below which are true about oxidation and reduction. Oxidation and reduction are opposite processes with respect to bookkeeping electrons. Oxidation is what happens when an element in a substance increases its oxidation number. Electrons appear on the left side of an oxidation half reaction. An oxidant is an oxidizing agent, which becomes oxidized during the course of a redox reaction. Reduction is what happens...
Balance the redox reaction given
7. H → NO2+ Fe + SO4 + H2O FeS2 + NO3 + (pyrite) Oxidation Half Reaction: Reduction Half Reaction: Oxidizing agent: Reducing agent
Choose all of the statements from below which are true about oxidation and reduction Oxidation and reduction are opposite processes with respect to bookkeeping electrons. Oxidation is what happens when an element in a substance increases its oxidation number. Electrons appear on the right side of an oxidation half reaction. An oxidant is an oxidizing agent, which becomes reduced during the course of a redox reaction Reduction is what happens when an element in a substance decreases its oxidation number....
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 9 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago