Homework Answers
Add Answer to:
5. (4 pts) Metabisulfite (S203) dissolves in water to form bisulfite (HSO3). In the box below,...
3. (4 pts) Under slightly basic conditions, the manganate ion (MnO2) will disproportionate. In the box below, write...
3. (4 pts) Under slightly basic conditions, the manganate ion (MnO2) will disproportionate. In the box below, write a balanced net ionic equation to illustrate this process 4. (4 pts) In the box below, write a balanced net ionic equation to illustrate the reaction when hydrochloric acid is added to a bleach solution to produce chlorine. Copy this equation into your lab notebook, as you will need it for your report. 5. (4 pts) Metabisulfite (S0, dissolves in water to...
151-Experiment 6-10 (4 pts) Circle the correct answers to complete the sentences below: 2. Mr MnO/...
151-Experiment 6-10 (4 pts) Circle the correct answers to complete the sentences below: 2. Mr MnO/ 2.1) When MnO acts as an oxidizing agent in an acidic medium, it becomes MnO), which is ( colorless / green / purple) 2.2) When MnO acts as an oxidizing agent in a very basic (pH> 14) medium, it becomes (Mn/ MnO, / MnO) , which is ( colorless /green / purple) (4 pts) Under slightly basic conditions, the manganate ion (MnO) will disproportionate....
write a balanced net ionic equation to illustrate the oxidation half-reaction when bisulfite functions as a...
write a balanced net ionic equation to illustrate the oxidation half-reaction when bisulfite functions as a reducing agent in an acidic medium
1. Balance the reaction between Mg and NO3- to form Mg2+ and HNO2 in acidic solution....
1. Balance the reaction between Mg and
NO3- to form
Mg2+ and
HNO2 in acidic solution.
When you have balanced the equation using the smallest integers
possible, enter the coefficients of the species shown. Enter "1" if
the coefficient is "1."
Mg + NO3Mg2+
+ HNO2
Water appears in the balanced equation as a (reactant,
product, neither) with a coefficient of ______. (Enter 0 for
neither.)
How many electrons are transferred in this reaction? _______
.
.
2. Balance the following...
POST-LABORATORY QUESTIONS Procedure: Balance the redox reactions given below. Show your work on a separate sheet...
POST-LABORATORY QUESTIONS Procedure: Balance the redox reactions given below. Show your work on a separate sheet of paper. Write the balanced oxidation and reduction half reactions, also identify the oxidizing agent and the reducing agent. All reactions are to be balanced in acidic media, except when OH is shown. 1. __Cu + __NO3- + H → Cu2+ + NO + H2O Oxidation Half Reaction: Reduction Half Reaction: Oxidizing agent: Reducing agent
1. Balance the following reaction in the medium specified. (10 pts) a. Which element is being...
1. Balance the following reaction in the medium specified. (10 pts) a. Which element is being oxidized. b. Which element is being reduced. c. Identify the oxidizing and reducing agent. CIO3+ (aq) + l'(aq) --l(s) +Cl(aq) (acidic) 2. What is the oxidation number of the indicated element in the following compounds (6 pts) N in HNO, Cl in HCIO, Mn in KMnO4 3. Given the reaction (5 pts) 2C4H10(g) + 1302(g) → 8CO2(g) + 10H2O(g) How many moles of C&H1o...
5. Consider the following redox molecular reaction: Na(s) + H2O(l) ? NaOH(aq) + H2(g) If water...
5. Consider the following redox molecular reaction: Na(s) + H2O(l) ? NaOH(aq) + H2(g) If water is written as HOH(), then the equation is Na(s) + HOH(l) ? NaOH(aq) + H2(g) Write the following reactions: Oxidation reaction: Reduction reaction: Balanced net ionic reaction: Reducing agent: Oxidizing agent:
4) Consider the following balanced conventional equation. (21 pts) Zn(s) + H2SO, (aq) → Znso. (aq)...
4) Consider the following balanced conventional equation. (21 pts) Zn(s) + H2SO, (aq) → Znso. (aq) + H2 (9) Individual oxidation numbers: a. Assign oxidation numbers to each element as indicated by the boxes in H SO, Zn in ZnSOS in Znso. O in ZnSO, and H in H2) (6 pts) b. Write the total ionic equation for the reaction above. (9 pts) ndicated by the boxes above. (i.e. Zn in Zn(s), H c. Write the net ionic equation for...
4. Consider the following unbalanced net redox equation: HCI + KMnO, (aq) + H,02 (aq) -. MnC12 (a...
PLEASE ANSWER EACH QUESTION OR DO NOT ANSWER AT ALL. THANK
YOU!
4. Consider the following unbalanced net redox equation: HCI + KMnO, (aq) + H,02 (aq) -. MnC12 (aq) + O2 (g) + KCI in an acid solution a. Determine the oxidation state of each atom or ion in the above reaction: b. Which atom is being oxidized? Which atom is being reduced? C. Which species is the reducing agent? Which is the oxidizing agent? d. Write the net...
please help with all of the question. The following skeletal oxidation-reduction reaction occurs under acidic conditions....
please help with all of the question.
The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the balanced REDUCTION half reaction. NO3 + Mn2 MnO4 +HNO2 Reactants Products Retry Entire Group 9 more group attempts remaining Submit Answer Mastered The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced REDUCTION half reaction. Sio2 + Ag Ag2O+Si- Products Reactants (1) Identify each of the following half-reactions as either an oxidation half-reaction or a reduction half-reaction half-reaction identification AP...
3. (4 pts) Under slightly basic conditions, the manganate ion (MnO2) will disproportionate. In the box below, write a balanced net ionic equation to illustrate this process 4. (4 pts) In the box below, write a balanced net ionic equation to illustrate the reaction when hydrochloric acid is added to a bleach solution to produce chlorine. Copy this equation into your lab notebook, as you will need it for your report. 5. (4 pts) Metabisulfite (S0, dissolves in water to...
151-Experiment 6-10 (4 pts) Circle the correct answers to complete the sentences below: 2. Mr MnO/ 2.1) When MnO acts as an oxidizing agent in an acidic medium, it becomes MnO), which is ( colorless / green / purple) 2.2) When MnO acts as an oxidizing agent in a very basic (pH> 14) medium, it becomes (Mn/ MnO, / MnO) , which is ( colorless /green / purple) (4 pts) Under slightly basic conditions, the manganate ion (MnO) will disproportionate....
1. Balance the reaction between Mg and
NO3- to form
Mg2+ and
HNO2 in acidic solution.
When you have balanced the equation using the smallest integers
possible, enter the coefficients of the species shown. Enter "1" if
the coefficient is "1."
Mg + NO3Mg2+
+ HNO2
Water appears in the balanced equation as a (reactant,
product, neither) with a coefficient of ______. (Enter 0 for
neither.)
How many electrons are transferred in this reaction? _______
.
.
2. Balance the following...
POST-LABORATORY QUESTIONS Procedure: Balance the redox reactions given below. Show your work on a separate sheet of paper. Write the balanced oxidation and reduction half reactions, also identify the oxidizing agent and the reducing agent. All reactions are to be balanced in acidic media, except when OH is shown. 1. __Cu + __NO3- + H → Cu2+ + NO + H2O Oxidation Half Reaction: Reduction Half Reaction: Oxidizing agent: Reducing agent
1. Balance the following reaction in the medium specified. (10 pts) a. Which element is being oxidized. b. Which element is being reduced. c. Identify the oxidizing and reducing agent. CIO3+ (aq) + l'(aq) --l(s) +Cl(aq) (acidic) 2. What is the oxidation number of the indicated element in the following compounds (6 pts) N in HNO, Cl in HCIO, Mn in KMnO4 3. Given the reaction (5 pts) 2C4H10(g) + 1302(g) → 8CO2(g) + 10H2O(g) How many moles of C&H1o...
5. Consider the following redox molecular reaction: Na(s) + H2O(l) ? NaOH(aq) + H2(g) If water is written as HOH(), then the equation is Na(s) + HOH(l) ? NaOH(aq) + H2(g) Write the following reactions: Oxidation reaction: Reduction reaction: Balanced net ionic reaction: Reducing agent: Oxidizing agent:
4) Consider the following balanced conventional equation. (21 pts) Zn(s) + H2SO, (aq) → Znso. (aq) + H2 (9) Individual oxidation numbers: a. Assign oxidation numbers to each element as indicated by the boxes in H SO, Zn in ZnSOS in Znso. O in ZnSO, and H in H2) (6 pts) b. Write the total ionic equation for the reaction above. (9 pts) ndicated by the boxes above. (i.e. Zn in Zn(s), H c. Write the net ionic equation for...
PLEASE ANSWER EACH QUESTION OR DO NOT ANSWER AT ALL. THANK
YOU!
4. Consider the following unbalanced net redox equation: HCI + KMnO, (aq) + H,02 (aq) -. MnC12 (aq) + O2 (g) + KCI in an acid solution a. Determine the oxidation state of each atom or ion in the above reaction: b. Which atom is being oxidized? Which atom is being reduced? C. Which species is the reducing agent? Which is the oxidizing agent? d. Write the net...
please help with all of the question.
The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the balanced REDUCTION half reaction. NO3 + Mn2 MnO4 +HNO2 Reactants Products Retry Entire Group 9 more group attempts remaining Submit Answer Mastered The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced REDUCTION half reaction. Sio2 + Ag Ag2O+Si- Products Reactants (1) Identify each of the following half-reactions as either an oxidation half-reaction or a reduction half-reaction half-reaction identification AP...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 57 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago