![Question 01 (15 pts) [will be checked for completion] How much acetic acid is needed (express in mg/L as C) to convert 50 mg/](http://img.homeworklib.com/questions/889aee60-6ea3-11ea-a698-dffdff50aa4e.png?x-oss-process=image/resize,w_560)
Homework Answers
Add Answer to:
Question 01 (15 pts) [will be checked for completion] How much acetic acid is needed (express...
In the production of vinegar, the fermentation of ethanol to produce acetic acid using acetic acid...
In the production of vinegar, the fermentation of ethanol to produce acetic acid using acetic acid bacteria can be simplified by the following reaction Ethanol (A) + bacteria cells à more bacteria cells (C) + acetic acid (R) The data below shows the concentration of ethanol from a 2 l MFR reactor at 50 0C. (cco = 0 mg/l and fractional yield R/A = 0.25) Table 3: Experimental data ν (l/hr) Cethanol (mg/l) 0.2 5 0.55 20 0.86 60...
Question 2 3 pts The heat of fusion for glycerol (C3H803) is 18.48 kJ/mol. How much...
Question 2 3 pts The heat of fusion for glycerol (C3H803) is 18.48 kJ/mol. How much heat would be absorbed when 227.57 g of glycerol undergo fusion? Express your answer in units of kilojoules (kJ) using at least three significant figures. Question 3 3 pts The Arxn for the combustion of acetone (C3HO) is -895 kJ, as shown below. How many grams of Oz would need to be consumed by this reaction in order to release 571.9 kJ of heat?...
Question#1: Aspirin is prepared by reaction of salicylic acid (C7H6O3)(C7H6O3) with acetic anhydride (C4H6O3)(C4H6O3) according to...
Question#1: Aspirin is prepared by reaction of salicylic acid (C7H6O3)(C7H6O3) with acetic anhydride (C4H6O3)(C4H6O3) according to the following equation: C7H6O3Salicylicacid+C4H6O3Aceticanhydride→C7H6O3Salicylicacid+C4H6O3Aceticanhydride→ C9H8O4Aspirin+CH3COOHAceticacid A) How many grams of acetic anhydride are needed to react with 7.50 gg of salicylic acid? B)How many grams of aspirin will result? C) How many grams of acetic acid are formed as a by-product? Question #2: Aluminum reacts with chlorine gas to form aluminum chloride via the following reaction: 2Al(s)+3Cl2(g)→2AlCl3(s)2Al(s)+3Cl2(g)→2AlCl3(s) You are given 26.0 gg of aluminum...
6. Vinegar is 5.00% (m/v) acetic acid (CH3COOH). How many milliliters of vinegar would you need...
6. Vinegar is 5.00% (m/v) acetic acid (CH3COOH). How many milliliters of vinegar would you need to react with an excess of baking soda (NaHCO3) in order to generate 10.0 L of carbon dioxide gas at 1.05 atm and a temperature of 25.0°C? 7. Shown below is the aqueous reaction of KNOX, HCl, and SnCl2. 2 KNO2 (aq) + 6 HCl(aq) + 2 SnCl2 (aq) → 2 SnCla (aq) + N20 (g) + 3 H20 (1) + 2 KCl (aq)...
D Question 2 2 pts Which reagents would be best used to perform the following transformation?...
D Question 2 2 pts Which reagents would be best used to perform the following transformation? Time Runn 43 Minute OOH 1) 1. H+ ЛОН HO 2. Mgº 3. CO2 4. H30 2) 1. MeMgBr 2. H307 3. H2SO4 3) 1. NaHCO, 2. H30* 4) 1.HHO OH | 5) 1. HCN 2. CrOz/H20 2. CrOy/H20 3. H307 03 5 Predict the major product of the following reaction. & Hochs H" (eat) H3C 3) H3C -CH; 5) HyC-CH3 4) CH3 H3C-N-CH3...
How would you convert an unsaturated fatty acid into a saturated fatty acid A. KMnO4, "OH,...
How would you convert an unsaturated fatty acid into a saturated fatty acid A. KMnO4, "OH, heat B. "OH,H,O, heat; then H,0 C. Hz, Ni, pressure D. H,0,H,O, heat 26. What structure has the following proton NMR spectrum? 'H NMR: doublet, 6.6 ppm, 2H doublet, 7.8 ppm, 2H broad singlet, 4.2 ppm, 2H singlet, 2.1 ppm, 3H HUN 27. Which of the following is the correct synthesis of the compound shown? CH, Br o Na Na o CH,Br B. T...
Titration: Acids and Bases 2. How can you determine which acid is diprotic? 3. using the...
Titration: Acids and Bases
2. How can you determine which acid is diprotic?
3. using the answers to questions one and two, which acid is
diprotic?
4. Which base has more hydroxide ions per molecule?
Acid Volume Base Base Initial Volume (mL) Base Final Volume (mL) Volume of Base Used (mL) Acid: Base Ratio Acid 1 20 mL Base 1 50 mL 34.5 15.5 4:3 Acid 2 20 mL Base 1 Acid 1 20 mL Base 2 Acid 2 20...
What is the general class of each test reaction in the introduction? Precipitation? Acid-Base? Oxidation eduction?...
What is the general class of each test reaction in the introduction? Precipitation? Acid-Base? Oxidation eduction? anoina to aizy ona svidstils Reaction Class 1 2 iliw 15 TO15192do art sshommua bns nosgol rond dass 101 12575 gbubnium oY noi de lo enor Som 10 910 w II woy Xd on abian aningstid on naloga uzib 3 OOH 4 5 DHET 6 7 SET adus 00 9 Complex ion formation 10 11 No reaction 12 13 14 Combination 15 16 17...
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of w...
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of whole numbers? __Cas(PO4h + H2SO4 - Caso + HPO. A) 3 B) 8 C) 10 D) 11 2) What is the coefficient of H20 when the following equation is properly balanced with smallest set of whole numbers? ALC + H2O - AM(OH), + CHE A) 3 B) 4 C) 6 D) 12 E) 24 3) of the reactions below, which one is...
(6 pts.) 1. The air pressure in the inner tube of a tire on a typical...
(6 pts.) 1. The air pressure in the inner tube of a tire on a typical racing bike is held at a pressure of 115 psi (pounds! per square inch). Convert this pressure to atm and mm Hg. (3 pts. each) The atmospheric pressure is 0.978 atm. Determine the pressure of the enclosed gas in each of the cases depicted below. Gas Gas (6 pts.) 3. A 5.90 L bottle contains 1070 g of oxygen at 25.0°C. Calculate the pressure...
Question 2 3 pts The heat of fusion for glycerol (C3H803) is 18.48 kJ/mol. How much heat would be absorbed when 227.57 g of glycerol undergo fusion? Express your answer in units of kilojoules (kJ) using at least three significant figures. Question 3 3 pts The Arxn for the combustion of acetone (C3HO) is -895 kJ, as shown below. How many grams of Oz would need to be consumed by this reaction in order to release 571.9 kJ of heat?...
6. Vinegar is 5.00% (m/v) acetic acid (CH3COOH). How many milliliters of vinegar would you need to react with an excess of baking soda (NaHCO3) in order to generate 10.0 L of carbon dioxide gas at 1.05 atm and a temperature of 25.0°C? 7. Shown below is the aqueous reaction of KNOX, HCl, and SnCl2. 2 KNO2 (aq) + 6 HCl(aq) + 2 SnCl2 (aq) → 2 SnCla (aq) + N20 (g) + 3 H20 (1) + 2 KCl (aq)...
D Question 2 2 pts Which reagents would be best used to perform the following transformation? Time Runn 43 Minute OOH 1) 1. H+ ЛОН HO 2. Mgº 3. CO2 4. H30 2) 1. MeMgBr 2. H307 3. H2SO4 3) 1. NaHCO, 2. H30* 4) 1.HHO OH | 5) 1. HCN 2. CrOz/H20 2. CrOy/H20 3. H307 03 5 Predict the major product of the following reaction. & Hochs H" (eat) H3C 3) H3C -CH; 5) HyC-CH3 4) CH3 H3C-N-CH3...
How would you convert an unsaturated fatty acid into a saturated fatty acid A. KMnO4, "OH, heat B. "OH,H,O, heat; then H,0 C. Hz, Ni, pressure D. H,0,H,O, heat 26. What structure has the following proton NMR spectrum? 'H NMR: doublet, 6.6 ppm, 2H doublet, 7.8 ppm, 2H broad singlet, 4.2 ppm, 2H singlet, 2.1 ppm, 3H HUN 27. Which of the following is the correct synthesis of the compound shown? CH, Br o Na Na o CH,Br B. T...
Titration: Acids and Bases
2. How can you determine which acid is diprotic?
3. using the answers to questions one and two, which acid is
diprotic?
4. Which base has more hydroxide ions per molecule?
Acid Volume Base Base Initial Volume (mL) Base Final Volume (mL) Volume of Base Used (mL) Acid: Base Ratio Acid 1 20 mL Base 1 50 mL 34.5 15.5 4:3 Acid 2 20 mL Base 1 Acid 1 20 mL Base 2 Acid 2 20...
What is the general class of each test reaction in the introduction? Precipitation? Acid-Base? Oxidation eduction? anoina to aizy ona svidstils Reaction Class 1 2 iliw 15 TO15192do art sshommua bns nosgol rond dass 101 12575 gbubnium oY noi de lo enor Som 10 910 w II woy Xd on abian aningstid on naloga uzib 3 OOH 4 5 DHET 6 7 SET adus 00 9 Complex ion formation 10 11 No reaction 12 13 14 Combination 15 16 17...
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of whole numbers? __Cas(PO4h + H2SO4 - Caso + HPO. A) 3 B) 8 C) 10 D) 11 2) What is the coefficient of H20 when the following equation is properly balanced with smallest set of whole numbers? ALC + H2O - AM(OH), + CHE A) 3 B) 4 C) 6 D) 12 E) 24 3) of the reactions below, which one is...
(6 pts.) 1. The air pressure in the inner tube of a tire on a typical racing bike is held at a pressure of 115 psi (pounds! per square inch). Convert this pressure to atm and mm Hg. (3 pts. each) The atmospheric pressure is 0.978 atm. Determine the pressure of the enclosed gas in each of the cases depicted below. Gas Gas (6 pts.) 3. A 5.90 L bottle contains 1070 g of oxygen at 25.0°C. Calculate the pressure...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago