1. what is the percent yield if 16.75g of product is obtained when the theoretical yield...
1. what is the percent yield if 16.75g of product is obtained when the theoretical yield is 22.74g?
2. Which property that is used to determine if a
chemical reaction has occurred can also the result of physical
changes.
-formation of a solid
-formation of a gas
-presence of a flame
- change of color
-change in temperature
3. The evaporation of water is endothermic as shown in
the equation
H2O (l) > H2O (g) H= +44.01 kJ
What mass in grams of water has to evaporate to absorb 175kJ of
heat?
Homework Answers
1)
Given:
Theoretical yield = 22.74 g
Actual yield = 16.75 g
Use:
% yield = actual yield * 100 / theoretical yield
= 16.75 * 100 / 22.74
= 73.66 %
Answer: 73.66 %
Only 1 question at a time please
Add Answer to:
1. what is the percent yield if 16.75g of product is
obtained when the theoretical yield...
The evaporation of water is endothermic: H.O(1) H0(9) AH.. = +44.01 kJ Part A What minimum mass of water in has to...
The evaporation of water is endothermic: H.O(1) H0(9) AH.. = +44.01 kJ Part A What minimum mass of water in has to evaporate to absorb 163 kJ of hear AEO ? Submit Resuest Answer < Return to Assignment Provide Feedback
15. When water evaporates it is an endothermic process. The balanced equation is written as follows:...
15. When water evaporates it is an endothermic process. The balanced equation is written as follows: H200) H2O(g) AHrxn = 44.10 kJ What is the minimum mass of water (in grams) which has to evaporate to absorb 175 kJ of heat?
1) Determine the theoretical yield of H2O for the reaction. 2)Determine the percent yield of H2O...
1) Determine the theoretical yield of H2O for the reaction. 2)Determine the percent yield of H2O for the reaction. The combustion of liquid ethanol (C2H5OH) produces carbon dioxide and water. After 4.61 mL of ethanol (density=0.789g/ml) was allowed to burn in the presence of 15.70 g of oxygen gas, 3.74 mL of water (density=1.00g/ml) was collected.
monog . What is the theoretical yield (grams) of Cr when 40.0 g of Cr2O3 reacts...
monog . What is the theoretical yield (grams) of Cr when 40.0 g of Cr2O3 reacts with 8.0 x1 atoms of Al? Al2O3 is the other product. Molar mass Cr2O3 = 151.9904 g/mol 18.0 x 1023 a. (2 points) Write the BALANCED chemical reaction - balance the formulas too points) What is the theoretical vield (grams)of Cr when 40.0 g of Cr2O3 reacts with 8.0 x 1023 atoms of All Alo, is the other product. b. (2 Points) If you...
What is the theoretical yield (in grams) and percent yield of your triphenylmethanol product in this...
What is the theoretical yield (in grams) and percent yield of your triphenylmethanol product in this experiment? Assume you have collected 0.15 g of triphenylmethanol. Br 2 Mg Ether MgBr 1) PhCO2CH3 2) HCI 2 2 Ph3COH + CH3OH Figure 10.1. The stoichiometry of a Grignard reaction. Br MgBr 2 1) 2 Mg Ether 2 2) PhCO2CH3 i MgBr OCH3 Ph Ph Ph CH30 + Benzophenone, III II Ph - MgBr OH MgBr 3) HCI Ph Ph Ph Ph Ph...
Suppose the theoretical yield in a reaction is 11.8 g and the percent yield is 58.2...
Suppose the theoretical yield in a reaction is 11.8 g and the percent yield is 58.2 %. What is the 36. actual yield of product obtained? A) 687 g B) 6.87 g C) 20.3 g D) 0.203 g Consider the oxidation of sodium metal to sodium oxide described by the balanced equation: 37. 4 Na+ O2 2 Na:O. What is the theoretical vield of Na:O in grams from 9.0 mol of O? 210 g of Na;O 18 g of Na...
What is the theoretical yield (in grams) and percent yield of your triphenylmethanol product in this...
What is the theoretical yield (in grams) and percent yield of
your triphenylmethanol product in this experiment?
Assume that you have collected 0.15g of Triphenylmethanol for
the question.
Reaction Set Up ---- ALL glassware NEEDS to be DRY!!! Anhydrous CaCl2 -Drying tube 53 mg Mg turnings Claisen adapter + 2 mL anhydrous ether + 260 ul bromobenzene Air condenser Stir until reaction amber. Heat slowly to reflux for 10 min. Cool the reaction in ice bath for 5 min. Use...
quellion) 1. Balance the following equations: - KBr + Fe(OH)3 + KOH + - FeBrz b)...
quellion) 1. Balance the following equations: - KBr + Fe(OH)3 + KOH + - FeBrz b) - KOH + - Co3(PO4)2 → K3PO4 + CO(OH)2 2. Write the balanced chemical equation for the production of bromine pentafluoride from liquid bromine and fluorine gas. Be sure to include physical states. 3. Write the balance chemical equation to show the formation of aqueous aluminum chloride and hydrogen gas upon reacting powdered aluminum with a solution of hydrochloric acid. Be sure to include...
Calculate the theoretical yield and percent yield for experiments 7, 8, and 9. For experiment 9,...
Calculate the theoretical yield and percent yield for
experiments 7, 8, and 9. For experiment 9, determine the
theoretical yield based on starting with 0.50g of 3-nitrobenzoic
acid. Show work
Acid I (experiment 7): Weight of methyl 3-nitrobenzoate = 1.9
g
Acid II (experiment 8): Weight of 3-nitrobenzoic acid = 1.75
g
Acid III (experiment 9): Weight of 3-nitrobenzamide = 0.30 g
Experiment 7:
-2.5 mL concentrated H2SO4
-1.75 mL concentrated HNO3 (16M)
-2.1 mL concentrated Methyl Benzoate
Experiment 8:...
1 atm pressure A mixture of gaseous reactants is put into a cylinder, where a chemical...
1 atm pressure A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them into gaseous products. The cylinder has a piston that moves in or out, as necessary, to keep a constant pressure on the mixture of 1 atm. The cylinder is also submerged in a large insulated water bath. (See sketch at right.) piston cylinder From previous experiments, this chemical reaction is known to absorb 236. kJ of energy. water bath gases The...
The evaporation of water is endothermic: H.O(1) H0(9) AH.. = +44.01 kJ Part A What minimum mass of water in has to evaporate to absorb 163 kJ of hear AEO ? Submit Resuest Answer < Return to Assignment Provide Feedback
15. When water evaporates it is an endothermic process. The balanced equation is written as follows: H200) H2O(g) AHrxn = 44.10 kJ What is the minimum mass of water (in grams) which has to evaporate to absorb 175 kJ of heat?
monog . What is the theoretical yield (grams) of Cr when 40.0 g of Cr2O3 reacts with 8.0 x1 atoms of Al? Al2O3 is the other product. Molar mass Cr2O3 = 151.9904 g/mol 18.0 x 1023 a. (2 points) Write the BALANCED chemical reaction - balance the formulas too points) What is the theoretical vield (grams)of Cr when 40.0 g of Cr2O3 reacts with 8.0 x 1023 atoms of All Alo, is the other product. b. (2 Points) If you...
What is the theoretical yield (in grams) and percent yield of your triphenylmethanol product in this experiment? Assume you have collected 0.15 g of triphenylmethanol. Br 2 Mg Ether MgBr 1) PhCO2CH3 2) HCI 2 2 Ph3COH + CH3OH Figure 10.1. The stoichiometry of a Grignard reaction. Br MgBr 2 1) 2 Mg Ether 2 2) PhCO2CH3 i MgBr OCH3 Ph Ph Ph CH30 + Benzophenone, III II Ph - MgBr OH MgBr 3) HCI Ph Ph Ph Ph Ph...
Suppose the theoretical yield in a reaction is 11.8 g and the percent yield is 58.2 %. What is the 36. actual yield of product obtained? A) 687 g B) 6.87 g C) 20.3 g D) 0.203 g Consider the oxidation of sodium metal to sodium oxide described by the balanced equation: 37. 4 Na+ O2 2 Na:O. What is the theoretical vield of Na:O in grams from 9.0 mol of O? 210 g of Na;O 18 g of Na...
What is the theoretical yield (in grams) and percent yield of
your triphenylmethanol product in this experiment?
Assume that you have collected 0.15g of Triphenylmethanol for
the question.
Reaction Set Up ---- ALL glassware NEEDS to be DRY!!! Anhydrous CaCl2 -Drying tube 53 mg Mg turnings Claisen adapter + 2 mL anhydrous ether + 260 ul bromobenzene Air condenser Stir until reaction amber. Heat slowly to reflux for 10 min. Cool the reaction in ice bath for 5 min. Use...
quellion) 1. Balance the following equations: - KBr + Fe(OH)3 + KOH + - FeBrz b) - KOH + - Co3(PO4)2 → K3PO4 + CO(OH)2 2. Write the balanced chemical equation for the production of bromine pentafluoride from liquid bromine and fluorine gas. Be sure to include physical states. 3. Write the balance chemical equation to show the formation of aqueous aluminum chloride and hydrogen gas upon reacting powdered aluminum with a solution of hydrochloric acid. Be sure to include...
Calculate the theoretical yield and percent yield for
experiments 7, 8, and 9. For experiment 9, determine the
theoretical yield based on starting with 0.50g of 3-nitrobenzoic
acid. Show work
Acid I (experiment 7): Weight of methyl 3-nitrobenzoate = 1.9
g
Acid II (experiment 8): Weight of 3-nitrobenzoic acid = 1.75
g
Acid III (experiment 9): Weight of 3-nitrobenzamide = 0.30 g
Experiment 7:
-2.5 mL concentrated H2SO4
-1.75 mL concentrated HNO3 (16M)
-2.1 mL concentrated Methyl Benzoate
Experiment 8:...
1 atm pressure A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them into gaseous products. The cylinder has a piston that moves in or out, as necessary, to keep a constant pressure on the mixture of 1 atm. The cylinder is also submerged in a large insulated water bath. (See sketch at right.) piston cylinder From previous experiments, this chemical reaction is known to absorb 236. kJ of energy. water bath gases The...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago