? What are the systematic (IUPAC) names for the compounds shown? он. H3C systematic (IUPAC) name: B. H3C—CH2-CH-CH2 CH3 OH systematic (IUPAC) name:
Give the systematic (IUPAC) name for each molecule. CH3CCH3 systematic (IUPAC) name: CH-CH-CH-CCH
Identify a systematic (IUPAC) name for each of thr following compounds 1. Identify a systematic (IUPAC) name for each of the following Compounds A NO2
Give the systematic (IUPAC) name for this molecule.
What is the systematic name (IUPAC name) of CH3CH2CH2CH(CH2CH3)CH2CH3?
What is the systematic IUPAC name of the following compound?
Provide the correct IUPAC/systematic name for the following compound.
What is the IUPAC (systematic name) for the following skeletal structure:
Hint uestion 11 of 25> Give the systematic (IUPAC) names for these molecules. -ОССH-CHз IUPAC name: ҫн.сн.Со(снаьснь CI JUPAC name: contact he about uscareespgoiytems ef ese