Homework Answers
Add Answer to:
7. Three reactions are depicted below. Indicate which of the reactions is not a Williamson ether...
1. Which reagent could be used in a Williamson Synthesis of cyclohexyl methyl ether? H2SO4, NaCl,...
1. Which reagent could be used in a Williamson Synthesis of
cyclohexyl methyl ether?
H2SO4, NaCl, H2O, or NaH
-----------------------
2. Which carboxylic acid is the most acidic?
---------------------
3. A reaction that would give n-hexyllithium is:
CH3CH2CH2CH2CH2Br + 2Li
CH3CH2CH2CH2OH + Li
CH3CH2CH2CH3 + Li
CH3CH2CH2CH2Br + LiBr
CH3CH2CH2CH3 = CH3Li
----------------------
4. Starting with p-bromoanisole, what sequence of reactions will
produce p-methylanisole?
1. CH3l 2. Mg, ether
1. Mg, ether 2. CH3l
1. Br2, AlBr3 2. Mg, ether...
2. Predict the products for the following reactions, indicate major and minor products where applicable H...
2. Predict the products for the following reactions, indicate major and minor products where applicable H =CH1) NaNH, a) HC "*2) EtBr Lindlar's Cat. CH, O HBr 80°C H, CH, CH, CH, NaH HC HC - NaCN CH₂ сн, он CH3 K O-t-Bu in modo ) HEC- E100C Epoc=_cooke +ů C OOEt + -
Question 1: Draw the expected major product for the following reactions: НІ HC CH CH₂ HBO...
Question 1: Draw the expected major product for the following reactions: НІ HC CH CH₂ HBO ROOR Question 2: Draw a mechanism for the following transformations: a) H₃C CH3 HCI H₂C T CH3 HAC CH3 нс с Question 3: Draw the mechanism for the following transformations: нс сH3 CH3 о (H,SO4), он H₂C7 Question 4 HĄCE 1) Hg(OAC), H, 2) NaBH, HEC CH, Question : Predict the product(s) of the following reaction: 1) BHZ. THE Н4С SCH, 2) H2O, NaOH...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H) 1) CHELI 2) H30 CrOg, H2SO4 H20 (xs) 1) mCPBA J) (CH3),COK (CH3)3COH CH,CI2 K) H2SO4 180°C OH L NaH, DMSO Br...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H) 1) CHELI 2) H30 CrOg, H2SO4 H20 (xs) 1) mCPBA J) (CH3),COK (CH3)3COH CH,CI2 K) H2SO4 180°C OH L NaH, DMSO Br...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H ) 1) CH3Li CrO2, H2S04 1) H 2) H30+ H2O (xs) CI mCPBA (CH3)3COK J) (CH3)3COH CH2Cl2 K) H2SO4, 1800C OH NaH,...
Question 30 (2 points) What are the expected major products of the reaction sequence shown below?...
Question 30 (2 points) What are the expected major products of the reaction sequence shown below? 1. 03 2. H20 e OH O=C=0 OH II III IV V O a) I and IV Ob) II, III and IV Oc) I and II O d) 1, III and IV Question 31 (2 points) A compound with a molecular formula of C10H1202 has the following 'H NMR spectrum. Which of the following structures is consistent with this spectrum? 2 o OCH2CH2CH3 0...
6&7 please 6. For the following reactions tell whether they will react under Secondition condition (Nal/acetone)...
6&7 please
6. For the following reactions tell whether they will react under Secondition condition (Nal/acetone) or neither. Also indicate the product formed if any (10 points Mechanism Product (S.1 or 2) my НАС " H₂C CHO 7. Draw the major product expected in each reaction below. (10 pts) HAPO. HC CH3 heat OH CH3CH ONa нсін CH,CH OH 55°C B CH2CH3 KSH (1 mol equivalent) acetonitrile он acetonitrile
please indicate stereochemistry (20 marks) 1. Identify each of the following reactions as SN1, SN2, E1,...
please indicate stereochemistry
(20 marks) 1. Identify each of the following reactions as SN1, SN2, E1, or E2 and give the products formed in each case, and indicate the stereochemistry of the product if appropriate (mechanisms are not required). If no reaction would occur, indicate this with N.R. forno reaction" and give the reason for which you don't expect a product. a) E HEC-CH2-C...Br (CH3),C07 (CH3),COH CHE 70°C CH3 SN2 Morand SN2 H H₃C-CH2-c...Br. CN/DMSO in CH 25°C d) Br...
6. (8 pts) For each of the following pairs of reactions indicate which statement (A-D) best describes each pair of...
6. (8 pts) For each of the following pairs of reactions indicate which statement (A-D) best describes each pair of reactions. A. Only reaction A should give the product shown in good yield-reaction B will not B. Only reaction B should give the product shown in good yield-reaction A will not C. Both reaction A and reaction B should give the product shown in good yield. D. Neither reaction A nor reaction B should give the product shown in good...
1. Which reagent could be used in a Williamson Synthesis of
cyclohexyl methyl ether?
H2SO4, NaCl, H2O, or NaH
-----------------------
2. Which carboxylic acid is the most acidic?
---------------------
3. A reaction that would give n-hexyllithium is:
CH3CH2CH2CH2CH2Br + 2Li
CH3CH2CH2CH2OH + Li
CH3CH2CH2CH3 + Li
CH3CH2CH2CH2Br + LiBr
CH3CH2CH2CH3 = CH3Li
----------------------
4. Starting with p-bromoanisole, what sequence of reactions will
produce p-methylanisole?
1. CH3l 2. Mg, ether
1. Mg, ether 2. CH3l
1. Br2, AlBr3 2. Mg, ether...
2. Predict the products for the following reactions, indicate major and minor products where applicable H =CH1) NaNH, a) HC "*2) EtBr Lindlar's Cat. CH, O HBr 80°C H, CH, CH, CH, NaH HC HC - NaCN CH₂ сн, он CH3 K O-t-Bu in modo ) HEC- E100C Epoc=_cooke +ů C OOEt + -
Question 1: Draw the expected major product for the following reactions: НІ HC CH CH₂ HBO ROOR Question 2: Draw a mechanism for the following transformations: a) H₃C CH3 HCI H₂C T CH3 HAC CH3 нс с Question 3: Draw the mechanism for the following transformations: нс сH3 CH3 о (H,SO4), он H₂C7 Question 4 HĄCE 1) Hg(OAC), H, 2) NaBH, HEC CH, Question : Predict the product(s) of the following reaction: 1) BHZ. THE Н4С SCH, 2) H2O, NaOH...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H) 1) CHELI 2) H30 CrOg, H2SO4 H20 (xs) 1) mCPBA J) (CH3),COK (CH3)3COH CH,CI2 K) H2SO4 180°C OH L NaH, DMSO Br...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H) 1) CHELI 2) H30 CrOg, H2SO4 H20 (xs) 1) mCPBA J) (CH3),COK (CH3)3COH CH,CI2 K) H2SO4 180°C OH L NaH, DMSO Br...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H ) 1) CH3Li CrO2, H2S04 1) H 2) H30+ H2O (xs) CI mCPBA (CH3)3COK J) (CH3)3COH CH2Cl2 K) H2SO4, 1800C OH NaH,...
Question 30 (2 points) What are the expected major products of the reaction sequence shown below? 1. 03 2. H20 e OH O=C=0 OH II III IV V O a) I and IV Ob) II, III and IV Oc) I and II O d) 1, III and IV Question 31 (2 points) A compound with a molecular formula of C10H1202 has the following 'H NMR spectrum. Which of the following structures is consistent with this spectrum? 2 o OCH2CH2CH3 0...
6&7 please
6. For the following reactions tell whether they will react under Secondition condition (Nal/acetone) or neither. Also indicate the product formed if any (10 points Mechanism Product (S.1 or 2) my НАС " H₂C CHO 7. Draw the major product expected in each reaction below. (10 pts) HAPO. HC CH3 heat OH CH3CH ONa нсін CH,CH OH 55°C B CH2CH3 KSH (1 mol equivalent) acetonitrile он acetonitrile
please indicate stereochemistry
(20 marks) 1. Identify each of the following reactions as SN1, SN2, E1, or E2 and give the products formed in each case, and indicate the stereochemistry of the product if appropriate (mechanisms are not required). If no reaction would occur, indicate this with N.R. forno reaction" and give the reason for which you don't expect a product. a) E HEC-CH2-C...Br (CH3),C07 (CH3),COH CHE 70°C CH3 SN2 Morand SN2 H H₃C-CH2-c...Br. CN/DMSO in CH 25°C d) Br...
6. (8 pts) For each of the following pairs of reactions indicate which statement (A-D) best describes each pair of reactions. A. Only reaction A should give the product shown in good yield-reaction B will not B. Only reaction B should give the product shown in good yield-reaction A will not C. Both reaction A and reaction B should give the product shown in good yield. D. Neither reaction A nor reaction B should give the product shown in good...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago