Homework Answers
True
EXPLANATION: Equilibrium is attain when the rate of forward reaction is equal to the rate of backwrad reaction. Once equilibrium is reached, the forward and the backward reaction stops. As a result, the concentration of the reactants and the products no longer change.
Add Answer to:
QUESTION 3 In a chemical reaction, both the forward and the return reaction stop completely when...
Equilibrium is reached in chemical reactions when: Oa. All chemical reactions stop. Ob. The forward reaction...
Equilibrium is reached in chemical reactions when: Oa. All chemical reactions stop. Ob. The forward reaction stops. c. The rates of the forward and reverse reactions become equal. d. The concentrations of reactants and products become equal. Oe. The temperature shows a sharp rise. Equilibrium is reached in chemical reactions when: Oa. All chemical reactions stop. Ob. The forward reaction stops. c. The rates of the forward and reverse reactions become equal. d. The concentrations of reactants and products become...
1. Which of the following is true for a chemical reaction at equilibrium? only the forward...
1. Which of the following is true for a chemical reaction at equilibrium? only the forward reaction stops only the reverse reaction stops both the forward and reverse reactions stop the rate constants for the forward and reverse reactions are equal the rates of the forward and reverse reactions are equal 2. A chemical equilibrium may be established by starting a reaction with reactants only. d. any quantities of reactants and products. products only. e. all the above equal quantities...
Which of the following statements is true about chemical equilibrium? Select all that apply. At chemical...
Which of the following statements is true about chemical equilibrium? Select all that apply. At chemical equilibrium, the reactants have been completely consumed. At chemical equilibrium, both reactions stop completely. At chemical equilibrium, the concentrations of the species involved in the reaction stay constant (in the absence of an external perturbation). At chemical equilibrium the rate of the forward reaction is equal to the rate of the reverse reaction.
1)A limiting reactant is completely consumed in the course of a reaction and may be used...
1)A limiting reactant is completely consumed in the course of a reaction and may be used to determine how much product may be produced. True or False? 2)The reactant that is in excess in a chemical reaction is called the limiting reactant. True or False? 3)Complete combustion of gasoline will yield carbon dioxide and water as the major products. True or False?
help with both please thank you For a chemical reaction the rate of the forward reaction...
help with both please thank
you
For a chemical reaction the rate of the forward reaction is at a maximum when a state of equilibrium is reached the concentration of products is greater than the concentration of the reactants the reaction begins when the concentration of the reactants and products is the same The solubility of copper (II) sulfate (g/100 g water) at 0°C and 100 °C is 14.3g and 75.4 g, respectively. What would be the correct terms to...
BONUS QUESTIONS B1) When a system reaches equilibrium, the forward and reverse reactions stop. A) True...
BONUS QUESTIONS B1) When a system reaches equilibrium, the forward and reverse reactions stop. A) True B) False B2) If Q>K, more products need to be formed as the reaction proceeds to equilibrium. A) True B) False B3) A solution with pH = 7 must also have pOH = 7. A) True B) False B4) If a strong acid, like HCI, is diluted sufficiently with water the pH can be greater than 7. A) True B) False B5) For some...
2) in a catalyzed chemical reaction, one function of a catalyst is to A) increase the...
2) in a catalyzed chemical reaction, one function of a catalyst is to A) increase the number of successful reactant collisions. B) decrease the concentration of reactants. change the equilibrium concentrations of the products and react D) increase the energy given off during the reaction E) increase the temperature at which the reaction is carried out. 3) Refrigerating perishable foods affects biochemical reactions by A) increasing concentrations of antioxidants. B) removing bacteria. C) decreasing the rate of reactions affecting spoilage....
When a chemical reaction is at equilibrium, the forward and reverse reactions occur at the same...
When a chemical reaction is at equilibrium, the forward and reverse reactions occur at the same rate. The concentrations of the different compounds in the reactions will remain constant. The relationship between the concentrations of the reactants and products is expressed as the equilibrium constant, K.. Part A Balance this equation, and then enter the coefficients, in order, below. CCl,(g) + O2(g) = COCl (g) - Cl (8) Express your answer as integers separated by commas (e.g. 1, 2, 3,...
Worksheet (Ch 9) 10 points Name: 1. The limiting reactant in a chemical reaction is the...
Worksheet (Ch 9) 10 points Name: 1. The limiting reactant in a chemical reaction is the reactant that is completely consumed first. a] true b] false 2. In every chemical reaction, the number of moles of reactant must equal the number of moles of product. a] true The reactant present in the fewest number of moles is always the limiting reactant. [a] true Ib] false 3. Ib] false Show all the work for problems 4 to 15 to get full...
Which statements listed below can explain why a chemical reaction does not take place? concentration of...
Which statements listed below can explain why a chemical reaction does not take place? concentration of reactants is too low the temperature is too low not enough effective collisions are occurring some of these answers all of these answers For a chemical reaction the rate of the forward reaction is at a maximum when when the concentration of the reactants and products is the same a state of equilibrium is reached the reaction begins the concentration of products is greater...
Equilibrium is reached in chemical reactions when: Oa. All chemical reactions stop. Ob. The forward reaction stops. c. The rates of the forward and reverse reactions become equal. d. The concentrations of reactants and products become equal. Oe. The temperature shows a sharp rise. Equilibrium is reached in chemical reactions when: Oa. All chemical reactions stop. Ob. The forward reaction stops. c. The rates of the forward and reverse reactions become equal. d. The concentrations of reactants and products become...
1. Which of the following is true for a chemical reaction at equilibrium? only the forward reaction stops only the reverse reaction stops both the forward and reverse reactions stop the rate constants for the forward and reverse reactions are equal the rates of the forward and reverse reactions are equal 2. A chemical equilibrium may be established by starting a reaction with reactants only. d. any quantities of reactants and products. products only. e. all the above equal quantities...
help with both please thank
you
For a chemical reaction the rate of the forward reaction is at a maximum when a state of equilibrium is reached the concentration of products is greater than the concentration of the reactants the reaction begins when the concentration of the reactants and products is the same The solubility of copper (II) sulfate (g/100 g water) at 0°C and 100 °C is 14.3g and 75.4 g, respectively. What would be the correct terms to...
BONUS QUESTIONS B1) When a system reaches equilibrium, the forward and reverse reactions stop. A) True B) False B2) If Q>K, more products need to be formed as the reaction proceeds to equilibrium. A) True B) False B3) A solution with pH = 7 must also have pOH = 7. A) True B) False B4) If a strong acid, like HCI, is diluted sufficiently with water the pH can be greater than 7. A) True B) False B5) For some...
2) in a catalyzed chemical reaction, one function of a catalyst is to A) increase the number of successful reactant collisions. B) decrease the concentration of reactants. change the equilibrium concentrations of the products and react D) increase the energy given off during the reaction E) increase the temperature at which the reaction is carried out. 3) Refrigerating perishable foods affects biochemical reactions by A) increasing concentrations of antioxidants. B) removing bacteria. C) decreasing the rate of reactions affecting spoilage....
When a chemical reaction is at equilibrium, the forward and reverse reactions occur at the same rate. The concentrations of the different compounds in the reactions will remain constant. The relationship between the concentrations of the reactants and products is expressed as the equilibrium constant, K.. Part A Balance this equation, and then enter the coefficients, in order, below. CCl,(g) + O2(g) = COCl (g) - Cl (8) Express your answer as integers separated by commas (e.g. 1, 2, 3,...
Worksheet (Ch 9) 10 points Name: 1. The limiting reactant in a chemical reaction is the reactant that is completely consumed first. a] true b] false 2. In every chemical reaction, the number of moles of reactant must equal the number of moles of product. a] true The reactant present in the fewest number of moles is always the limiting reactant. [a] true Ib] false 3. Ib] false Show all the work for problems 4 to 15 to get full...
Which statements listed below can explain why a chemical reaction does not take place? concentration of reactants is too low the temperature is too low not enough effective collisions are occurring some of these answers all of these answers For a chemical reaction the rate of the forward reaction is at a maximum when when the concentration of the reactants and products is the same a state of equilibrium is reached the reaction begins the concentration of products is greater...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago