Homework Answers
Third
option is correct E=+0.402V
Add Answer to:
Question 12 Calculate Eº for an electrochemical cell based on the following overall reaction: 2H*(aq) +...
1.) Given the following notation for an electrochemical cell Pt(s) | H2(g) | H+(aq) || Ag+(aq)...
1.) Given the following notation for an electrochemical cell Pt(s) | H2(g) | H+(aq) || Ag+(aq) | Ag(s), what is the balanced overall (net) cell reaction? A. H2(g) + 2Ag(s) ® H+(aq) + 2Ag+(aq B. H2(g) + 2Ag+(aq) ® 2H+(aq) + 2Ag(s) C. H2(g) + Ag+(aq) ® H+(aq) + Ag(s D. 2H+(aq) + 2Ag(s) ® H2(g) + 2Ag+(aq) E. 2H+(aq) + 2Ag+(aq) ® H2(g) + 2Ag(s) 2.) Calculate E°cell for the following (nonspontaneous) reaction: Cd(s) + 2Fe3+(aq) ® 2Fe2+(aq) + Cd2+(aq) → A. -0.37...
Question 1 1 pts For the cell: Zn(s) + 2H+ (aq) + Zn2+(aq) + H2 (g)...
Question 1 1 pts For the cell: Zn(s) + 2H+ (aq) + Zn2+(aq) + H2 (g) If [Zn2+) = 1 M, PH2 = 1 atm, and E = 0.549 V what is pH? Question 2 1 pts Calculate the voltage for the following cell at 25° ZnZn+2 ( 2.832 M) || Cd2+ (0.027 M)| Cd
8. Consider the following electrochemical cell: Cd Cd? (0.20 M) // H (0.05 M), H2 (1...
8. Consider the following electrochemical cell: Cd Cd? (0.20 M) // H (0.05 M), H2 (1 atm) /Pt Given the following standard reduction potentials: Reaction 2 H+ (aq) + 2 Cd + (aq) + 2e H2 (aq) Cd (s) Eº (volts) 0.00 -0.40 (a) Write the equation for the overall cell reaction. (b) Calculate E' for the overall reaction. (c) Calculate the equilibrium constant for the overall reaction. (d) Calculate the actual value of E for the cell at the...
17. Write the overall cell reaction for the following voltaic cell. Cd(s)|Cd2+(aq)||Ni2+ (aq)|Ni(s) 18. Calculate the...
17. Write the overall cell reaction for the following voltaic cell. Cd(s)|Cd2+(aq)||Ni2+ (aq)|Ni(s) 18. Calculate the standard cell potential of the following cell at 25°C. Cd(s) Cd2+ (aq)||Ni2+ (aq) Ni(s)
Calculate ∆G° (kJ/mol) for the following electrochemical cell: Cd(s) | Cd2+(aq) || Ni2+(aq)| Ni(s)
Calculate ∆G° (kJ/mol) for the following electrochemical cell: Cd(s) | Cd2+(aq) || Ni2+(aq)| Ni(s)
A galvanic cell is based on the following half-reactions: Fe2+ + 2e-→ Fe(s) Eº = -0.440...
A galvanic cell is based on the following half-reactions: Fe2+ + 2e-→ Fe(s) Eº = -0.440 V 2H+ + 2e-→ H2(g) Eº = 0.000 V where the iron compartment contains an iron electrode and [Fe2+] = 1.00 × 10-3 M and the hydrogen compartment contains a platinum electrode, PH2 = 1.00 atm , and a weak acid, HA, at an initial concentration of 1.00 M. If the observed cell potential is 0.320 V at 25ºC, calculate the Ka value for...
Consider an electrochemical cell, starting with standard state conditions, based on the following reaction. 2 H*(aq)+...
Consider an electrochemical cell, starting with standard state conditions, based on the following reaction. 2 H*(aq)+ Cd(s) Cd2+(aq) H2g) Ecell 0.40v Which of the following actions would increase the measured cell potential? Reducing the [H'] in the hydrogen cell O Increasing the mass of the solid Cd electrode Reducing the Cdion concentration O Increasing the pressure of hydrogen gas in the hydrogen cell O None of these
consider the electrochemical cell 2H^+ (aq)+ Cd(s) = Cd^2+ (aq) + H2(g) Ecell°=0.40 V what would...
consider the electrochemical cell 2H^+ (aq)+ Cd(s) = Cd^2+ (aq) + H2(g) Ecell°=0.40 V what would increase measured cell potential reducing H+ in hydrogen cell increasing the mass of the solid CD electrode reducing cd^2+ ion concentration increasing pressure of hydrogen gas in hydrogen cell none when 1.00kj(1000 j) of heat is added to 50.0 g of water how should the temp of the water change?
Is the following reaction spontaneous? Cd(s) + 2H+(aq) → H2(g) + Cd2+(aq) If so/if not, please...
Is the following reaction spontaneous? Cd(s) + 2H+(aq) → H2(g) + Cd2+(aq) If so/if not, please explain :)
The electrochemical cell described by the balanced chemical reaction has a standard cell potential of -0.2...
The electrochemical cell described by the balanced chemical reaction has a standard cell potential of -0.2 V. Calculate the equilibrium constant (Kc) for the reaction at 298 K. Round your answer to 3 significant figures. H2SO3(aq) + H2O(l) → H2(g) + SO42-(aq) + 2H+(aq) The electrochemical cell described by the cell notation has a standard cell potential of -0.10 V. Calculate the value (kJ) for the ΔG˚ of the cell. Round your answer to 3 significant figures. Pt(s) l Cr3+(aq),...
Question 1 1 pts For the cell: Zn(s) + 2H+ (aq) + Zn2+(aq) + H2 (g) If [Zn2+) = 1 M, PH2 = 1 atm, and E = 0.549 V what is pH? Question 2 1 pts Calculate the voltage for the following cell at 25° ZnZn+2 ( 2.832 M) || Cd2+ (0.027 M)| Cd
8. Consider the following electrochemical cell: Cd Cd? (0.20 M) // H (0.05 M), H2 (1 atm) /Pt Given the following standard reduction potentials: Reaction 2 H+ (aq) + 2 Cd + (aq) + 2e H2 (aq) Cd (s) Eº (volts) 0.00 -0.40 (a) Write the equation for the overall cell reaction. (b) Calculate E' for the overall reaction. (c) Calculate the equilibrium constant for the overall reaction. (d) Calculate the actual value of E for the cell at the...
17. Write the overall cell reaction for the following voltaic cell. Cd(s)|Cd2+(aq)||Ni2+ (aq)|Ni(s) 18. Calculate the standard cell potential of the following cell at 25°C. Cd(s) Cd2+ (aq)||Ni2+ (aq) Ni(s)
Consider an electrochemical cell, starting with standard state conditions, based on the following reaction. 2 H*(aq)+ Cd(s) Cd2+(aq) H2g) Ecell 0.40v Which of the following actions would increase the measured cell potential? Reducing the [H'] in the hydrogen cell O Increasing the mass of the solid Cd electrode Reducing the Cdion concentration O Increasing the pressure of hydrogen gas in the hydrogen cell O None of these
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 21 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago