Homework Answers
Add Answer to:
This is for Organic II. Thank you!
4) Devise a synthesis for the following compound V...
2) Devise a synthesis of the following compound using only ethanol. You may also use any...
2) Devise a synthesis of the following compound using only ethanol. You may also use any needed Inorganic or organic reagents but all of the carbons in the target molecule must come from ethanol. Hint: this synthesis will require you to use a Claisen reaction
28- The following molecules can be formed by either: Michael Reaction; Enamine Acylation; Acetoacetic Ester Synthesis;...
28- The following molecules can be formed by either: Michael Reaction; Enamine Acylation; Acetoacetic Ester Synthesis; Michael Addition; Malonic Ester Synthesis; Robinson Annulation; Aldol Condensation; Claisen Condensation; Intramolecular Aldol Condensation; Dieckmann Condensation or a Combination of two of the above listed reaction. In each case write the proper of the reaction on the line and dissect the product into appropriate starting material. In some cases there might only be one starting material. You may use any one of the above...
7. What two molecules could be used to make the following molecules using crossed aldol reaction....
7. What two molecules could be used to make the following molecules using crossed aldol reaction. ook OH 8a. There are 4 alpha-carbons in this molecule. Which alpha carbon(s) is/are the most reactive? What is the product if NaOH and heat are used? a 8b. What is the scientist name whom the above reaction is named after? 9. Why does the base (used to proton transfer) need match the initial reactant in the Claisen Condensation? 10. Malonic ester synthesis questions...
7. What two molecules could be used to make the following molecules using crossed aldol reaction....
7. What two molecules could be used to make the following molecules using crossed aldol reaction. OH 8a. There are 4 alpha-carbons in this molecule. Which alpha carbon(s) is/are the most reactive? What is the product if NaOH and heat are used? 8b. What is the scientist name whom the above reaction is named after? 9. Why does the base (used to proton transfer) need match the initial reactant in the Claisen Condensation? 10. Malonic ester synthesis questions - Show...
7. What two molecules could be used to make the following molecules using crossed aldol reaction....
7. What two molecules could be used to make the following molecules using crossed aldol reaction. O ook OH 8a. There are 4 alpha-carbons in this molecule. Which alpha carbon(s) is/are the most reactive? What is the product if NaOH and heat are used? 8b. What is the scientist name whom the above reaction is named after? 9. Why does the base (used to proton transfer) need match the initial reactant in the Claisen Condensation? 10. Malonic ester synthesis questions...
Using only 1-butanol as your source of carbom, provide a synthesis for the following compound. Using...
Using only 1-butanol as your source of carbom, provide a
synthesis for the following compound.
Using only 1-butanol as your source of carbon, provide a synthesis for the following compound. You may use multiple equivalents of 1-butanol (use it more than once in the synthesis) Please use reactions that give the desired product as the major product Do not use the acetoacetic ester or malonic ester synthesis Show the product for each reaction step
show how you would make this compound... 2. Show how you would make this compound by...
show how you would make this compound...
2. Show how you would make this compound by a malonic ester synthesis or an acetoacetic acid synthesis. 4-methylhexanoic acid
(14) V. Starting from benzene and any other reagents you need, propose an efficient synthesis of th following compound. (10) VI. Devise a synthesis that will accomplish the following transformati...
(14) V. Starting from benzene and any other reagents you need, propose an efficient synthesis of th following compound. (10) VI. Devise a synthesis that will accomplish the following transformation in good yield. Use the given compounds as the only organic source of carbon atoms. You may use any common organic solvents as well as any needed inorganic reagents
(14) V. Starting from benzene and any other reagents you need, propose an efficient synthesis of th following compound. (10) VI....
how to approach these reactions? 08. The following molecules can be formed by either: Michael Reaction;...
how
to approach these reactions?
08. The following molecules can be formed by either: Michael Reaction; Enamine Acylation; Acetoacetic Ester Synthesis; Michael Addition; Malonic Ester Synthesis; Robinson Annulation; Aldol Condensation; Claisen Condensation; Intramolecular Aldol Condensation; Dieckmann Condensation or a Combination of two of the above listed reaction. In each case write the proper of the reaction on the line and dissect the product into appropriate starting material. In some cases there might only be one starting material. You may use...
Need Help. Will Rate If Complete. Q 8- The following molecules can be formed by either:...
Need Help. Will Rate If Complete.
Q 8- The following molecules can be formed by either: Michael Reaction; Enamine Acylation; Acetoacetic Ester Synthesis; Michael Addition; Malonic Ester Synthesis; Robinson Annulation; Aldol Condensation; Claisen Condensation; Intramolecular Aldol Condensation; Dieckmann Condensation or a Combination of two of the above listed reaction. In each case write the proper of the reaction on the line and dissect the product into appropriate starting material. In some cases there might only be one starting material. You...
2) Devise a synthesis of the following compound using only ethanol. You may also use any needed Inorganic or organic reagents but all of the carbons in the target molecule must come from ethanol. Hint: this synthesis will require you to use a Claisen reaction
28- The following molecules can be formed by either: Michael Reaction; Enamine Acylation; Acetoacetic Ester Synthesis; Michael Addition; Malonic Ester Synthesis; Robinson Annulation; Aldol Condensation; Claisen Condensation; Intramolecular Aldol Condensation; Dieckmann Condensation or a Combination of two of the above listed reaction. In each case write the proper of the reaction on the line and dissect the product into appropriate starting material. In some cases there might only be one starting material. You may use any one of the above...
7. What two molecules could be used to make the following molecules using crossed aldol reaction. ook OH 8a. There are 4 alpha-carbons in this molecule. Which alpha carbon(s) is/are the most reactive? What is the product if NaOH and heat are used? a 8b. What is the scientist name whom the above reaction is named after? 9. Why does the base (used to proton transfer) need match the initial reactant in the Claisen Condensation? 10. Malonic ester synthesis questions...
7. What two molecules could be used to make the following molecules using crossed aldol reaction. OH 8a. There are 4 alpha-carbons in this molecule. Which alpha carbon(s) is/are the most reactive? What is the product if NaOH and heat are used? 8b. What is the scientist name whom the above reaction is named after? 9. Why does the base (used to proton transfer) need match the initial reactant in the Claisen Condensation? 10. Malonic ester synthesis questions - Show...
7. What two molecules could be used to make the following molecules using crossed aldol reaction. O ook OH 8a. There are 4 alpha-carbons in this molecule. Which alpha carbon(s) is/are the most reactive? What is the product if NaOH and heat are used? 8b. What is the scientist name whom the above reaction is named after? 9. Why does the base (used to proton transfer) need match the initial reactant in the Claisen Condensation? 10. Malonic ester synthesis questions...
Using only 1-butanol as your source of carbom, provide a
synthesis for the following compound.
Using only 1-butanol as your source of carbon, provide a synthesis for the following compound. You may use multiple equivalents of 1-butanol (use it more than once in the synthesis) Please use reactions that give the desired product as the major product Do not use the acetoacetic ester or malonic ester synthesis Show the product for each reaction step
show how you would make this compound...
2. Show how you would make this compound by a malonic ester synthesis or an acetoacetic acid synthesis. 4-methylhexanoic acid
(14) V. Starting from benzene and any other reagents you need, propose an efficient synthesis of th following compound. (10) VI. Devise a synthesis that will accomplish the following transformation in good yield. Use the given compounds as the only organic source of carbon atoms. You may use any common organic solvents as well as any needed inorganic reagents
(14) V. Starting from benzene and any other reagents you need, propose an efficient synthesis of th following compound. (10) VI....
how
to approach these reactions?
08. The following molecules can be formed by either: Michael Reaction; Enamine Acylation; Acetoacetic Ester Synthesis; Michael Addition; Malonic Ester Synthesis; Robinson Annulation; Aldol Condensation; Claisen Condensation; Intramolecular Aldol Condensation; Dieckmann Condensation or a Combination of two of the above listed reaction. In each case write the proper of the reaction on the line and dissect the product into appropriate starting material. In some cases there might only be one starting material. You may use...
Need Help. Will Rate If Complete.
Q 8- The following molecules can be formed by either: Michael Reaction; Enamine Acylation; Acetoacetic Ester Synthesis; Michael Addition; Malonic Ester Synthesis; Robinson Annulation; Aldol Condensation; Claisen Condensation; Intramolecular Aldol Condensation; Dieckmann Condensation or a Combination of two of the above listed reaction. In each case write the proper of the reaction on the line and dissect the product into appropriate starting material. In some cases there might only be one starting material. You...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago