Homework Answers
Add Answer to:
7. Draw the enantiomer and one of the diastereome respective order. one of the diastereomers of...
what do the following diastereomers/enabtiomers of these molecules look like? b) Draw ONE diastereomer of this...
what do the following diastereomers/enabtiomers of these
molecules look like?
b) Draw ONE diastereomer of this molecule: NH2 1111 ОН c) Draw the enantiomer of this molecule: OH CI
3. a. Consider molecule A below. Draw its enantiomer in box B and two unique diastereomers...
3. a. Consider molecule A below. Draw its enantiomer in box B and two unique diastereomers in boxes C and D. Assign each stereocenter Ror S, and each alkene E or Z. 3b. What is the relationship between B and C? А B, enantiomer of A 3b. What is the relationship between B and D? Br 3c. What is the relationship between C and D? 3d. The specific rotation of A is -7.38°, what are the specific rotations of B,...
003 2) draw the enantiomer and a diastereomer of ribose shown below (6 point) OH HO...
003 2) draw the enantiomer and a diastereomer of ribose shown below (6 point) OH HO HO OH Hou 3) Draw all the hydrogen bonds that one ethanol molecule can form with water molecules (6 ponit)
3. Identify the relationship between the pairs of molecules shown below as either: the same molecule,...
3. Identify the relationship between the pairs of molecules shown below as either: the same molecule, diastereomers, enantiomers, or epimers. (3 points each) CH2OH СНОн он но -н H-OH он OH он OH OH OH H2OH CH2OH 4. Draw the Line Angle formula for the products of the following reactions. (4 points each) Cu+2 -Cu2O(s) + + но -н CH2OH Ht, heat OH HO heat
please solve all as soon as possible 8. Draw the enantiomer of each chiral molecule. Rank...
please solve all as soon as possible
8. Draw the enantiomer of each chiral molecule. Rank the substituents attached to each chiral carbon in order of priority, highest priority first. Label the chiral centres of each molecule as "R" or "S". CH.CH CH H ΝΗ, OCH Кону Вт CH.CH H = Br H
LS 197 Homework Set 8: Name: 4) Draw the enantiomer of the following molecules: 5) Draw...
LS 197 Homework Set 8: Name: 4) Draw the enantiomer of the following molecules: 5) Draw the enantiomer and a diastereomer of the following molecule: OOH 오인 OH HOT оно L-tartaric acid 6) Predict the products of the following reactions and identify the type of reaction: OH HO HCI Catalyst ZI Sucrose CH OH O 0 CH,OH Sucrase enzyme catalyst в усн он OH Fructose Glucose OH Sucrase is an enzyme that breaks sucrose into glucose and fructose
Use the Fischer projection below to answer the following questions сн. Br- H H- Br CH,CH,...
Use the Fischer projection below to answer the following questions сн. Br- H H- Br CH,CH, (a) Write the IUPAC name for this molecule using the R/S notation (b) Draw the skeletal structure of the mirror Image, le the enantiomer, of the molecule whose Fischer projection is given above. (Show one wedge bond, one dashed bond, and two sticks attached to the chiral carbon. Show the hydrogen atom bonded to the chiral carbon atom as either a wedge or dash...
17. Draw Lewis structure for PO, 18. Draw Lewis structure for CHO(OH) (all groups are attached...
17. Draw Lewis structure for PO, 18. Draw Lewis structure for CHO(OH) (all groups are attached to aC) 19. Draw Lewis structure for CH,CO(NH) (all groups are attached to a C) 20. The partial Lewis structure below is for a common hydrocarbon. In the completlostructure, each Carbon fulfills the octet rule. C=C-CEC a) How many hydrogen atoms does the molecule contain? b) How many unshared electrons does the molecule contain? c) Rank the carbon-carbon bonds in order of increasing bond...
8. Indicate whether each of the following statements is true or false. If a statement is...
8. Indicate whether each of the following statements is true or false. If a statement is false, explain why a) Two structural isomers may be chiral. : True b) A compound must be chiral in order to have an enantiomer. True c) A chiral compound with an asymmetric carbon atom designated always has a positive optical rotation. False (R) as d) Mirror-image molecules are always enantiomers. False chiral. False e) All compounds with asymmetric carbon atoms are f)The relative configuration...
7. What is the relationship between these two compounds? CHO CH OH H HH HE A....
7. What is the relationship between these two compounds? CHO CH OH H HH HE A. The compounds are identical. B. The compounds are enantiomers. C. The compounds are diastereomers. D. The compounds are structural isomers. нонс OHC 8 What is the relationship between these two compounds? соон COOH H- ci CH A. The compounds are identical. B. The compounds are enantiomers. C. The compounds are diastereomers. D. The compounds are structural isomers. CH CH3 CH,OH CH, OH 9. What...
what do the following diastereomers/enabtiomers of these
molecules look like?
b) Draw ONE diastereomer of this molecule: NH2 1111 ОН c) Draw the enantiomer of this molecule: OH CI
3. a. Consider molecule A below. Draw its enantiomer in box B and two unique diastereomers in boxes C and D. Assign each stereocenter Ror S, and each alkene E or Z. 3b. What is the relationship between B and C? А B, enantiomer of A 3b. What is the relationship between B and D? Br 3c. What is the relationship between C and D? 3d. The specific rotation of A is -7.38°, what are the specific rotations of B,...
003 2) draw the enantiomer and a diastereomer of ribose shown below (6 point) OH HO HO OH Hou 3) Draw all the hydrogen bonds that one ethanol molecule can form with water molecules (6 ponit)
3. Identify the relationship between the pairs of molecules shown below as either: the same molecule, diastereomers, enantiomers, or epimers. (3 points each) CH2OH СНОн он но -н H-OH он OH он OH OH OH H2OH CH2OH 4. Draw the Line Angle formula for the products of the following reactions. (4 points each) Cu+2 -Cu2O(s) + + но -н CH2OH Ht, heat OH HO heat
please solve all as soon as possible
8. Draw the enantiomer of each chiral molecule. Rank the substituents attached to each chiral carbon in order of priority, highest priority first. Label the chiral centres of each molecule as "R" or "S". CH.CH CH H ΝΗ, OCH Кону Вт CH.CH H = Br H
LS 197 Homework Set 8: Name: 4) Draw the enantiomer of the following molecules: 5) Draw the enantiomer and a diastereomer of the following molecule: OOH 오인 OH HOT оно L-tartaric acid 6) Predict the products of the following reactions and identify the type of reaction: OH HO HCI Catalyst ZI Sucrose CH OH O 0 CH,OH Sucrase enzyme catalyst в усн он OH Fructose Glucose OH Sucrase is an enzyme that breaks sucrose into glucose and fructose
Use the Fischer projection below to answer the following questions сн. Br- H H- Br CH,CH, (a) Write the IUPAC name for this molecule using the R/S notation (b) Draw the skeletal structure of the mirror Image, le the enantiomer, of the molecule whose Fischer projection is given above. (Show one wedge bond, one dashed bond, and two sticks attached to the chiral carbon. Show the hydrogen atom bonded to the chiral carbon atom as either a wedge or dash...
17. Draw Lewis structure for PO, 18. Draw Lewis structure for CHO(OH) (all groups are attached to aC) 19. Draw Lewis structure for CH,CO(NH) (all groups are attached to a C) 20. The partial Lewis structure below is for a common hydrocarbon. In the completlostructure, each Carbon fulfills the octet rule. C=C-CEC a) How many hydrogen atoms does the molecule contain? b) How many unshared electrons does the molecule contain? c) Rank the carbon-carbon bonds in order of increasing bond...
8. Indicate whether each of the following statements is true or false. If a statement is false, explain why a) Two structural isomers may be chiral. : True b) A compound must be chiral in order to have an enantiomer. True c) A chiral compound with an asymmetric carbon atom designated always has a positive optical rotation. False (R) as d) Mirror-image molecules are always enantiomers. False chiral. False e) All compounds with asymmetric carbon atoms are f)The relative configuration...
7. What is the relationship between these two compounds? CHO CH OH H HH HE A. The compounds are identical. B. The compounds are enantiomers. C. The compounds are diastereomers. D. The compounds are structural isomers. нонс OHC 8 What is the relationship between these two compounds? соон COOH H- ci CH A. The compounds are identical. B. The compounds are enantiomers. C. The compounds are diastereomers. D. The compounds are structural isomers. CH CH3 CH,OH CH, OH 9. What...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago