All the top answers are correct!
2) In this 1 compound which is CaCo3 is split into 2 parts, which means it is decomposed. Thus the reaction decomposition.
4) In this 2 compounds are involved and are paired in some way after reaction both cations exchanged their anions. Thus called double displacement reaction.
6) When any compound is burnt in oxygen or set to react with only oxygen then it is called combustion or oxidation reaction.
8) Same explanation as 4.
Are the top answers correct? if so, what do I write for the bottom part? Fall...
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...
6. Calculate each of the following: a. the number of atoms in 0.5 mol ofc b the number of So, molecules in 1.28 mol of SO c. the moles of Fe in a sample containing 5.22 x10 - atoms of Fe 7. Calculate the molar mass for each of the following use the periodic table for the atomic mass): H2SO4 Fe2O3 Al(SO.) Mg(OH)2 (NH4)2CO3 8. How many moles of Cl2 are there in 25 g of Ciz? 9. How many...
I hope the answer is clear and correct thanks Question 1 (1 point) What is the change in enthalpy (in kJ mol'?) for the following reaction F2(g) + Cabr,(s) CaF() + Brz(1) O 1) -112 kJmo12 O2) 504 kJmo11 03) -504 kJmol 1 04) 537 kJmo11 O 5) -537 kJmol'i Question 2 (1 point) What is true about the following reaction at 25°C? F,(g) + 2HCl(g) 2 2017(g) + H (9) Ahrº=76 kJ mol'i Asr°=-10.13 J mol'i Ki Agrº=79 kJ...