Homework Answers
Electrolyte :
1. Sodium Hydroxide
2. a soluble ionic compound
For being a electrolyte the ions in the compound should have dissociated completely which will carry charges
In this case more the ionic character of compound more the chance of being it an electrolyte so in this case above two falls into the category of electrolyte
Non electrolyte :
1. Methanol
2. Most molecular solutes
3. Table sugar
Methanol will not disintegrate in the aqueous solution so it will be a non electrolyte. Table sugar be molecular form will be a non electrolyte.
For the given reaction the Ag2SO4 will be a
sparingly soluble salt which slightly soluble in water.
Add Answer to:
Electrolyte Nonelectrolyte Answer Bank table sugar a soluble ionic compound most molecular solutes methanol, CH,OH sodium...
Classify each of the following substances and descriptions as an electrolyte or a nonelectrolyte. Note: If any part of...
Classify each of the following substances and descriptions as an electrolyte or a nonelectrolyte. Note: If any part of this question is answered incorrectly, a single red X will appear indicating that one or more substances have been placed incorrectly. -most molecular solutes -sodium chloride, NaCl -potassium iodine, KI -table sugar -methanol, CH3OH -sodium hydroxide, NaOH -a substance that forms an aqueous solution that does not conduct electricity -a soluble ionic compound
Classify each compound as a strong electrolyte, weak electrolyte, or nonelectrolyte. Strong electrolytes Weak electrolytes Nonelectrolytes...
Classify each compound as a strong electrolyte, weak electrolyte, or nonelectrolyte. Strong electrolytes Weak electrolytes Nonelectrolytes Answer Bank AgNO, Agno, NaOH NaOH OH,O, HBE CH, NH, CH,COOH CH, OH CH,COOH CH, OH Fre y terms of use Contact us help
Silver nitrate and sodium sulfate RESULTS Observation. No Pppt Molecular Equation: Net lonic Equation: 2. Silver...
Silver nitrate and sodium sulfate RESULTS Observation. No Pppt Molecular Equation: Net lonic Equation: 2. Silver nitrate and sodium chloride Observation: Molecular Equations Net Ionic Equation: Silver nitrate and sodium carbonate Observation_ ppt Molecular Equation: Net lonic Equation: 4. Silver nitrate and potassium chromate Observation: Molecular Equation Net Ionic Equation: Silver nitrate and sodium hydroxide tot Observation Molecular Equation: Net lonic Equation: Silver nitrate and sodium acetate Observation: Molecular Equation: Net Ionic Equation: Solubility - 7 Lead (1) acetate and...
Explain why some electrolyte solutions are strongly conducting, whereas others are weakly conducting. 4.2. Def fin...
Explain why some electrolyte solutions are strongly conducting, whereas others are weakly conducting. 4.2. Def fine the terms strong electrolyte and weak electrolyte. Give an example of each 4.3. Ex plain the terms soluble and insoluble. Use the solubility rules to write the formula of an insoluble ionic compound. 4.4. What are the advantages and disadvantages of using a molecular equation to represent an i reaction? 4.5. What is a spectator ion? IlIlustrate with a complete ionic reaction 4.6. What...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
all 4 questions. plz mark the answer clearly. For the Following Questions: Consider the reaction of...
all 4 questions. plz mark the answer clearly.
For the Following Questions: Consider the reaction of Fe(NO3)2 (aq) and KOH(aq). Follow each part to find the correct Molecular, Complete lonic, and Net lonic Equation for this reaction. Solubility rules are very useful when determining the physical states of the products. Solubility Rules for Ionic Compounds Substance Na, K, NHA, NO; SO4 CI, Br",r Ag ОН Rules Ionic compounds which contain these ions are soluble. Most ionic compounds containing sulfate are...
3 A compound of sodium and sulfur is analyzed to contain following mass of each elements...
3 A compound of sodium and sulfur is analyzed to contain following mass of each elements Calculate is the empirical formula. Show all calculation steps by using conversion factor. give calculator value (c.v.) and Final value (f.v) to get full credit. Show steps (1.23) (Na-5.891 g and S-4.109 g) (6 pt. Step 1: Step 2: Step 3: Empirical Formula is: In the following chemical reaction. Balance the molecular equation by adding coefficient. Write the net ionic equation by adding phases....
#3 action of a double-replacement reaction 2. Using the solubility rules, predict the solubility of each...
#3
action of a double-replacement reaction 2. Using the solubility rules, predict the solubility of each of the following compounds in wan solution), s = insoluble solid) the following compounds in water (aq-soluble (aqueous a) CaCO3 b ) Al(OH), S c ) Cu(NO3)290_ d) HgCl2 99 - double displacement reaction takes place between two ionic compounds that are dissolved in an aqueous solution and form two new compounds. For example, sodium phosphate and silver nitrate combine to yield sodium nitrate...
can you please answer these two questions 3 A compound of sodium and sulfur is analyzed...
can you please answer these two questions
3 A compound of sodium and sulfur is analyzed to contain following mass of each elements. Calculate is the empirical formula. Show all calculation steps by using conversion factor, give calculator value (c.v.) and Final value (f.v) to get full credit. Show steps (1.2,3) (Na=5.891 g and S = 4.109 g) (6 pt Step 1: Step 2: Step 3: Empirical Formula is: 4 In the following chemical reaction. Balance the molecular equation by...
2. For the reactions that were to be completed in Part A of the experiment, prepare a table with ...
Part A:
Part B:
Need help ASAP!!
2. For the reactions that were to be completed in Part A of the experiment, prepare a table with the formulas from Group A as headings of the columns and the formulas of Group B as headings of the ows. Within the table, fill in the formula and systematic name of the predicted precipitates that will form. If no precipitate is expected from the reaction, write 'No Reaction'. For each predicted precipitate, look...
Classify each compound as a strong electrolyte, weak electrolyte, or nonelectrolyte. Strong electrolytes Weak electrolytes Nonelectrolytes Answer Bank AgNO, Agno, NaOH NaOH OH,O, HBE CH, NH, CH,COOH CH, OH CH,COOH CH, OH Fre y terms of use Contact us help
Silver nitrate and sodium sulfate RESULTS Observation. No Pppt Molecular Equation: Net lonic Equation: 2. Silver nitrate and sodium chloride Observation: Molecular Equations Net Ionic Equation: Silver nitrate and sodium carbonate Observation_ ppt Molecular Equation: Net lonic Equation: 4. Silver nitrate and potassium chromate Observation: Molecular Equation Net Ionic Equation: Silver nitrate and sodium hydroxide tot Observation Molecular Equation: Net lonic Equation: Silver nitrate and sodium acetate Observation: Molecular Equation: Net Ionic Equation: Solubility - 7 Lead (1) acetate and...
Explain why some electrolyte solutions are strongly conducting, whereas others are weakly conducting. 4.2. Def fine the terms strong electrolyte and weak electrolyte. Give an example of each 4.3. Ex plain the terms soluble and insoluble. Use the solubility rules to write the formula of an insoluble ionic compound. 4.4. What are the advantages and disadvantages of using a molecular equation to represent an i reaction? 4.5. What is a spectator ion? IlIlustrate with a complete ionic reaction 4.6. What...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
all 4 questions. plz mark the answer clearly.
For the Following Questions: Consider the reaction of Fe(NO3)2 (aq) and KOH(aq). Follow each part to find the correct Molecular, Complete lonic, and Net lonic Equation for this reaction. Solubility rules are very useful when determining the physical states of the products. Solubility Rules for Ionic Compounds Substance Na, K, NHA, NO; SO4 CI, Br",r Ag ОН Rules Ionic compounds which contain these ions are soluble. Most ionic compounds containing sulfate are...
3 A compound of sodium and sulfur is analyzed to contain following mass of each elements Calculate is the empirical formula. Show all calculation steps by using conversion factor. give calculator value (c.v.) and Final value (f.v) to get full credit. Show steps (1.23) (Na-5.891 g and S-4.109 g) (6 pt. Step 1: Step 2: Step 3: Empirical Formula is: In the following chemical reaction. Balance the molecular equation by adding coefficient. Write the net ionic equation by adding phases....
#3
action of a double-replacement reaction 2. Using the solubility rules, predict the solubility of each of the following compounds in wan solution), s = insoluble solid) the following compounds in water (aq-soluble (aqueous a) CaCO3 b ) Al(OH), S c ) Cu(NO3)290_ d) HgCl2 99 - double displacement reaction takes place between two ionic compounds that are dissolved in an aqueous solution and form two new compounds. For example, sodium phosphate and silver nitrate combine to yield sodium nitrate...
can you please answer these two questions
3 A compound of sodium and sulfur is analyzed to contain following mass of each elements. Calculate is the empirical formula. Show all calculation steps by using conversion factor, give calculator value (c.v.) and Final value (f.v) to get full credit. Show steps (1.2,3) (Na=5.891 g and S = 4.109 g) (6 pt Step 1: Step 2: Step 3: Empirical Formula is: 4 In the following chemical reaction. Balance the molecular equation by...
Part A:
Part B:
Need help ASAP!!
2. For the reactions that were to be completed in Part A of the experiment, prepare a table with the formulas from Group A as headings of the columns and the formulas of Group B as headings of the ows. Within the table, fill in the formula and systematic name of the predicted precipitates that will form. If no precipitate is expected from the reaction, write 'No Reaction'. For each predicted precipitate, look...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 57 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago