Homework Answers
Add Answer to:
1. Which of the following ions will react with water in a hydrolysis reaction:? Nat, Ca2+,...
Regarding the following salts: NaCN, KNO3, NH4Cl, NaHCO3, Na3PO4, please review the hydrolysis net ionic equations...
Regarding the following salts: NaCN, KNO3, NH4Cl, NaHCO3, Na3PO4, please review the hydrolysis net ionic equations below and provide specific information in sentences regarding why the following salts were classified as acids/bases/neutral -why the salt was classified the way it was (acidic/basic/neutral) -which ions are reacting in each salt/equation and are the ions behaving as an acid or a base -why is the ion behaving that way -and why other ions may not be reactive pls answer all qs for...
Question 8 3 pts Which of the following is not a conjugate acid/base pair? O HC2H302/C2H302"...
Question 8 3 pts Which of the following is not a conjugate acid/base pair? O HC2H302/C2H302" O NH4+/NH3 CO2/C03 OH3PO4/H2PO4 Question 9 3 pts A 1.0 M solution of NaC2H3O2 in water is expected to be: Acidic because sodium acetate undergoes hydrolysis Neutral because sodium acetate is a salt Basic because acetate ion is the conjugate base of acetic acid Acidic because it forms acetic acid Question 10 3 pts Examples of ionizing radiation would include: infrared (IR) visible light...
1. Determine if hydrolysis occurs for each of the following ions. If it does, write the...
1. Determine if hydrolysis occurs for each of the following ions. If it does, write the reaction for it and determine the value of the hydrolysis constant for each ion. a. NO3-1 b. OCl-1 c. NH2NH3+1 d. H2PO4-1 c. CH3NH3+1 d. HSO4-1 2. For each of the following ionic salts, indicate weather their aqueous solutions will be acidic, basic or neutral. a. Ba(NO2)2 b. Na2CO3 c. NH4ClO4 d. CH3NH3Cl e. KBr 3. Determine the pH of a 0.15 M solution...
please help >< Polyprotic acids have more than one proton to donate to water, therefore have...
please help ><
Polyprotic acids have more than one proton to donate to water, therefore have more than one equilibrium constant for proton donation. For phosphoric acid, there is a three-step equilibrium: H, PO +H,0 5 H2PO4 + H30* H,PO," +H,0 5 HPO - +H30* HPO 2- +,0 5 PO.- +,0* Kai = 7.11 x 10-3 Ka2 = 6.32 x 10-8 Ka; = 4.5 x 10-13 For all conjugate acid base pairs: K, XKK where K is for the reaction...
For the following salts: NaCN, KNO3, NH4Cl, NaHCO3, Na3PO4, please classify whether acidic ,basic ,or neutral...
For the following salts: NaCN, KNO3, NH4Cl, NaHCO3, Na3PO4, please classify whether acidic ,basic ,or neutral and their respective hydrolysis net ionic equation of the ion that determines the salt's classification. And, please explain why you classified the salt in an acidic/basic/neutral manner - really need thoroughness such as which of the ions are reacting and if it behaves as an acid or base AND why, AND why a specific ion would not be reactive. Thank you!!
4. (1 point) Write balanced equations for the complete combustion of each of the following substances....
4. (1 point) Write balanced equations for the complete combustion of each of the following substances. a. C3H28 (1) + b. C2H,2011 (s) + 5. (2 points) Identify each of the following unbalanced reactions as belonging to one or more of the following categories: precipitation, acid-base, or oxidation-reduction. Type Reaction K2SO4 + Ba(NO3)2 → BaSO4 + KNO3 HCI + Zn → ZnCl2 + H2 HCl + AgNO3 → AgCl + HNO3 HC1+KOH →KCI+H2O Zn + CuSO4 → ZnSO4 + Cu...
C. Acid-base properties of salts 1. Fill in the following table: Acidic/Basic/Neutral Neutralization Reaction that...
C. Acid-base properties of salts 1. Fill in the following table: Acidic/Basic/Neutral Neutralization Reaction that Produced the Salt Cation Salt Anion NH4 Cl NaH2PO4 I K* CsHsNHBr
22. Which of the following substances, when added to water, will produce a solution with a pH abo...
22. Which of the following substances, when added to water, will produce a solution with a pH above 7.0? A. NHaCİ B. CHsNHCl C. NH4NO3 D. HOCİ E. NaoCi 23. The following acids are listed in order of decreasing acid strength in water.HI> HNO2> CH,COOH> HOCI HCN. According to Bronsted-Lowry theory, which of the following ions is the weakest base? A. I B. NO. C. CHCOo D. ocT E. CN 24. The following reaction is described as: H2S + H2S...
1.Acidic materials can be identified by which of the following test outcomes: a. They react...
1.Acidic materials can be identified by which of the following test outcomes: a. They react with metals. b. They feel slippery. c. They may taste bitter. d. They turn litmus paper red. e. All of the above. 2. Which of the following would you expect to turn litmus paper blue: a. chalk b. baking soda c. oven cleaner d. all of the above e. none of the above 3. Which of the following statements about acidic water...
CHE 172 Acid-Base Equilibrium Worksheet 1. Identify the conjugate pairs in the following reaction: HC2H302(aq) +...
CHE 172 Acid-Base Equilibrium Worksheet 1. Identify the conjugate pairs in the following reaction: HC2H302(aq) + H2O + H20*24) + CH3O2 (aq) 2. Based on the Kb of the following weak bases, which is the strongest base? C6H5NH2 HONH2 H2NNH2 C2H5NH2 Kb = 4.3x10-10 Ko = 1.1x10-8 Kb = 1.3x106 Kb = 6.4x104 Which has the strongest conjugate acid? 3. Calculate the pH of the following solutions: a. 0.25M HBO b. 0.25M Ba(OH)2 C. 0.25M HCN (K. = 5.00x10-10) d....
Question 8 3 pts Which of the following is not a conjugate acid/base pair? O HC2H302/C2H302" O NH4+/NH3 CO2/C03 OH3PO4/H2PO4 Question 9 3 pts A 1.0 M solution of NaC2H3O2 in water is expected to be: Acidic because sodium acetate undergoes hydrolysis Neutral because sodium acetate is a salt Basic because acetate ion is the conjugate base of acetic acid Acidic because it forms acetic acid Question 10 3 pts Examples of ionizing radiation would include: infrared (IR) visible light...
please help ><
Polyprotic acids have more than one proton to donate to water, therefore have more than one equilibrium constant for proton donation. For phosphoric acid, there is a three-step equilibrium: H, PO +H,0 5 H2PO4 + H30* H,PO," +H,0 5 HPO - +H30* HPO 2- +,0 5 PO.- +,0* Kai = 7.11 x 10-3 Ka2 = 6.32 x 10-8 Ka; = 4.5 x 10-13 For all conjugate acid base pairs: K, XKK where K is for the reaction...
4. (1 point) Write balanced equations for the complete combustion of each of the following substances. a. C3H28 (1) + b. C2H,2011 (s) + 5. (2 points) Identify each of the following unbalanced reactions as belonging to one or more of the following categories: precipitation, acid-base, or oxidation-reduction. Type Reaction K2SO4 + Ba(NO3)2 → BaSO4 + KNO3 HCI + Zn → ZnCl2 + H2 HCl + AgNO3 → AgCl + HNO3 HC1+KOH →KCI+H2O Zn + CuSO4 → ZnSO4 + Cu...
C. Acid-base properties of salts 1. Fill in the following table: Acidic/Basic/Neutral Neutralization Reaction that Produced the Salt Cation Salt Anion NH4 Cl NaH2PO4 I K* CsHsNHBr
22. Which of the following substances, when added to water, will produce a solution with a pH above 7.0? A. NHaCİ B. CHsNHCl C. NH4NO3 D. HOCİ E. NaoCi 23. The following acids are listed in order of decreasing acid strength in water.HI> HNO2> CH,COOH> HOCI HCN. According to Bronsted-Lowry theory, which of the following ions is the weakest base? A. I B. NO. C. CHCOo D. ocT E. CN 24. The following reaction is described as: H2S + H2S...
CHE 172 Acid-Base Equilibrium Worksheet 1. Identify the conjugate pairs in the following reaction: HC2H302(aq) + H2O + H20*24) + CH3O2 (aq) 2. Based on the Kb of the following weak bases, which is the strongest base? C6H5NH2 HONH2 H2NNH2 C2H5NH2 Kb = 4.3x10-10 Ko = 1.1x10-8 Kb = 1.3x106 Kb = 6.4x104 Which has the strongest conjugate acid? 3. Calculate the pH of the following solutions: a. 0.25M HBO b. 0.25M Ba(OH)2 C. 0.25M HCN (K. = 5.00x10-10) d....
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 29 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago