Homework Answers
ANSWER- E.Tetramethylsilane
Explanation- Because of its high volatility it is easily evaporated and samples to be analysed can be recovered.
Add Answer to:
3. List the most common NMR reference. A. Water B. Methylene chloride C. Dimethyl sulfoxide D....
A. В. С. D. 2. Which of the circled protons in the molecules below would absorb...
A. В. С. D. 2. Which of the circled protons in the molecules below would absorb furthest downfield in the NMR? 2 A. В. с. CH,CосHIсн,, CH,сCH, сн, CH,СCH сH) D. E. CH,ссH,) CH Cосн) B-directly attached to the electronegative atom O, but also more crowded than E 3. List the most common NMR reference. 2 pts A. Water B. Methylene chloride C. Dimethyl sulfoxide D. Carbon tetrachloride E. Tetramethylsilane
1. List the most common nuclei that are used in NMR. 2. How many nuclear spin...
1. List the most common nuclei that are used in NMR. 2. How many nuclear spin states are possible for the 1H nucleus? A. 1 B. 2 C. 4 D. 5 E. none of these 3. Which of the following electromagnetic radiation is used in NMR spectroscopy? A. UV B. IR C. visible D. γ-rays E. radio wave 4. _______ protons experience a net magnetic field strength that is smaller than the applied magnetic field. A. Deshielded B. Shielded C. ...
Find the compound methylene chloride on the internet. a) Why do you think the name starts...
Find the compound methylene chloride on the internet. a) Why do you think the name starts with the prefix “meth”? How does it relate to the structure of the compound? b) List any other names you found for methylene chloride c) What are the similarities between the names? d) Methylene chloride does not dissolve well in water, but dissolves oily materials like tars and asphalt fairly well. Given what you know about intermolecular forces why might this be the case?...
a) carbon tetrachloride b) ethyl alcohol cbromine d) oil 2) The solubility of ammonium chloride at...
a) carbon tetrachloride b) ethyl alcohol cbromine d) oil 2) The solubility of ammonium chloride at 70. °C is 60. g of solute per 100. g of water. Which solution would be saturated at 70. C? (2 points, show your calculation) a) 90. g of solute in 180. g of water b) 90.g of solute in 200. g of water c) 30. g of solute in 50. g of water d) 35 g of solute in 50. g of water...
Which solution will conduct electricity? A. Carbon tetrachloride B. Pure water C. None of the above...
Which solution will conduct electricity? A. Carbon tetrachloride B. Pure water C. None of the above D. Aqueous Sodium chloride E. Aqueous glucose
ngt propionate and ethyl acetate Draw approximate PMR spectra expected for the following a. methyl acetoacetate b. 1,4-dimethoxybenzene c. 3-deuteropropanal d. CH3COCH.2CH2COCH3 5.) Select the so...
ngt propionate and ethyl acetate Draw approximate PMR spectra expected for the following a. methyl acetoacetate b. 1,4-dimethoxybenzene c. 3-deuteropropanal d. CH3COCH.2CH2COCH3 5.) Select the solvents that can be used in PMR spectroscopy which do not interfere with the spectrum: a. carbon tetrachloride b. chloroform c. benzene-dg d. hexachloroacetone e. acetonitrile f. acetone g. methylene chloride h. DMF (dimethylformamide) 6.) The PMR spectrum of dimethylformamide (DMF) shows thre used as a catalyst in the pinacol rearrang thre i. D,O 6.)...
2. •OH PBrs Malether i H₂ CLOU 2. H307) a) 6,7-dimethyl-3-honano b) 6,7-dimethyl-3- nonabon C) 6,7-dimethyl-3-hohanal...
2. •OH PBrs Malether i H₂ CLOU 2. H307) a) 6,7-dimethyl-3-honano b) 6,7-dimethyl-3- nonabon C) 6,7-dimethyl-3-hohanal d) 3,4-dimethyl-7-hohanol e) 3,4-dimethyl-7-honanone is
Macros III. Physical Properties 10 pts 10. Place the compounds below in order of increasing melting...
Macros III. Physical Properties 10 pts 10. Place the compounds below in order of increasing melting point. Briefly explain your reasoning VELHO d) e) f) f) 11. Place the same compounds in order of increasing polarity. Briefly explain your reasoning 12. Dichloromethane (methylene chloride CH2C12) is which of the following: i. Water immiscible and more dense than water il Water miscible and more dense than water ili. Water miscible and less dense than water iv. Water immiscible and less dense...
hohanol 3. 3,4-dimethyl-7-honanone is 10₂ 2) H₂O 3) NaOH 2 4) acetyl chloride a) OH b),...
hohanol 3. 3,4-dimethyl-7-honanone is 10₂ 2) H₂O 3) NaOH 2 4) acetyl chloride a) OH b), H مٹہ (4 d) Y
14). Hyponatremia is caused by a deficiency of a). water, b), potassium, c). sodium, d). chloride,...
14). Hyponatremia is caused by a deficiency of a). water, b), potassium, c). sodium, d). chloride, e). protein 15). The ideal weight for a newborn is a). 3-4 pounds, b), 5-6 pounds, c). 6.5-9 pounds, d). 9.5-10.5 pounds, e), over 10.5 pounds 16). Sulforaphanes are found in large concentrations in a) purple grapes, b). lemons, c). beans, d), broccoli, e). green tea 17). Digestive changes in the elderly include increased a) constipation, b), nutrient malabsorption, c). secretory activity, d), sense...
A. В. С. D. 2. Which of the circled protons in the molecules below would absorb furthest downfield in the NMR? 2 A. В. с. CH,CосHIсн,, CH,сCH, сн, CH,СCH сH) D. E. CH,ссH,) CH Cосн) B-directly attached to the electronegative atom O, but also more crowded than E 3. List the most common NMR reference. 2 pts A. Water B. Methylene chloride C. Dimethyl sulfoxide D. Carbon tetrachloride E. Tetramethylsilane
a) carbon tetrachloride b) ethyl alcohol cbromine d) oil 2) The solubility of ammonium chloride at 70. °C is 60. g of solute per 100. g of water. Which solution would be saturated at 70. C? (2 points, show your calculation) a) 90. g of solute in 180. g of water b) 90.g of solute in 200. g of water c) 30. g of solute in 50. g of water d) 35 g of solute in 50. g of water...
ngt propionate and ethyl acetate Draw approximate PMR spectra expected for the following a. methyl acetoacetate b. 1,4-dimethoxybenzene c. 3-deuteropropanal d. CH3COCH.2CH2COCH3 5.) Select the solvents that can be used in PMR spectroscopy which do not interfere with the spectrum: a. carbon tetrachloride b. chloroform c. benzene-dg d. hexachloroacetone e. acetonitrile f. acetone g. methylene chloride h. DMF (dimethylformamide) 6.) The PMR spectrum of dimethylformamide (DMF) shows thre used as a catalyst in the pinacol rearrang thre i. D,O 6.)...
2. •OH PBrs Malether i H₂ CLOU 2. H307) a) 6,7-dimethyl-3-honano b) 6,7-dimethyl-3- nonabon C) 6,7-dimethyl-3-hohanal d) 3,4-dimethyl-7-hohanol e) 3,4-dimethyl-7-honanone is
Macros III. Physical Properties 10 pts 10. Place the compounds below in order of increasing melting point. Briefly explain your reasoning VELHO d) e) f) f) 11. Place the same compounds in order of increasing polarity. Briefly explain your reasoning 12. Dichloromethane (methylene chloride CH2C12) is which of the following: i. Water immiscible and more dense than water il Water miscible and more dense than water ili. Water miscible and less dense than water iv. Water immiscible and less dense...
hohanol 3. 3,4-dimethyl-7-honanone is 10₂ 2) H₂O 3) NaOH 2 4) acetyl chloride a) OH b), H مٹہ (4 d) Y
14). Hyponatremia is caused by a deficiency of a). water, b), potassium, c). sodium, d). chloride, e). protein 15). The ideal weight for a newborn is a). 3-4 pounds, b), 5-6 pounds, c). 6.5-9 pounds, d). 9.5-10.5 pounds, e), over 10.5 pounds 16). Sulforaphanes are found in large concentrations in a) purple grapes, b). lemons, c). beans, d), broccoli, e). green tea 17). Digestive changes in the elderly include increased a) constipation, b), nutrient malabsorption, c). secretory activity, d), sense...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 7 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 56 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago