Please explain which is they answer and why. A measurement of the maximum non-expansion work that...
Please explain which is they answer and why.
A measurement of the maximum non-expansion work that can be performed at a constant T and P is given by?
a.) delta H
b.) delta A
c.) delta G
d.) delta S
Homework Answers
Answer is c) Delta G.
Gibbs free energy is the maximum non-expansion work under constant temperature and pressure.
Please give feedback!
Add Answer to:
Please explain which is they answer and why.
A measurement of the maximum non-expansion work that...
A. Derive an equation from first principles that shows how the maximum non-expansion work in a re...
A. Derive an equation from first principles that shows how the maximum non-expansion work in a reversible isothermal-isobaric process depends on Gibbs free energy and hence chemical potential B. Using you derivation, show how the standard potential of an electrochemical reaction relates to the change in Gibbs free energy and the work done by the system 10P 2. A. Define both chemical potential and activity coefficient. B. Explain why it necessary to use activity coefficients when discussing ionic solutions? Within...
Can someone please explain WHY with the answer, also which would be the SHOREST AND WHY....
Can someone please explain WHY with the answer, also which
would be the SHOREST AND WHY.
1. Which of the following bonds is the longest bond? a. C-C b. C-N c. C-S d. C-H e. C-Cl
7. Calculate the maximum non-expansion work per mole that may be obtained from the combustion of...
7. Calculate the maximum non-expansion work per mole that may be obtained from the combustion of methanol at 298 K. (10 pts) 2CH,OH (g) + O2 (g) 2002 (g) + 4H20 (1) CH,OH (g) 0:(8) CO2(g) H20 (1) A, Gº (kJ mol) -161.96 0 -394.36 -273.13
Please explain why you chose the answer as I do not understand the question. When a...
Please explain why you chose the answer as I do not understand the question. When a mixture of glucose 6-phosphate and fructose 6-phosphate is incubated with the enzyme phosphohexose isomerase (which catalyzes the interconversion of these two compounds) until equilibrium is reached,the final mixture contains twice as much glucose 6-phosphate as fructose 6-phosphate. Which one of the following statements is best applied to this reaction outlined below? glucose 6-phosphate<-->fructose 6-phosphate a. delta G is incalculably large and negative b. delta...
an ideal gas undergoes irreversible isothermal expansion. which is correct? The answer is A. Please explain...
an ideal gas undergoes irreversible isothermal expansion.
which is correct? The answer is A. Please explain why.
An ideal gas undergoes irreversible isothermal expansion. Which is correct? 2.
Please explain why the answer to this is C. thank you! 9. Which of the following...
Please explain why the answer to this is C. thank you!
9. Which of the following sets of reactants would lead to the formation of the molecule given below: on vilo zawollo sto HO sodomondib Eos t elo Bob E sexdolor oroli-Al- sodbo il a. S-1-iodo-2-methylpentane with HOCHZ b. S-1-iodo-2-methylpentane with NaOH e. S-1-iodo-2-methylpentane with water d. all of the above e. only options b and c Ho
Please explain why you chose the answer as I do not understand the question. When a mixture of gl...
Please explain why you chose the answer as I do not understand the question. When a mixture of glucose 6-phosphate and fructose 6-phosphate is incubated with the enzyme phosphohexose isomerase (which catalyzes the interconversion of these two compounds) until equilibrium is reached,the final mixture contains twice as much glucose 6-phosphate as fructose 6-phosphate. Which one of the following statements is best applied to this reaction outlined below? glucose 6-phosphate<-->fructose 6-phosphate a. delta G is incalculably large and negative b. delta...
please answer all parts and show work please Problem 130 pts): a. Explain the primary purpose...
please answer all parts and show work please
Problem 130 pts): a. Explain the primary purpose of regeneration in a Rankine power plant. Sketch a T-s diagram using either open or closed feedwater heater to explain your response. b. Explain the advantages and disadvantages of open and closed feedwater heaters. c. Assume steady-flow, no heat transfer, no work, one entrance, and one exit and neglect elevation changes. Show that the stagnation enthalpy is constant throughout a nozzle. d. Recall that...
Part A: In which reaction is expansion work gained by the system? View Available Hint(s) In...
Part A: In which reaction is expansion work gained by the system? View Available Hint(s) In which reaction is expansion work gained by the system? A.)CaCO3(s) →CaO(s) + CO2(g) B.)C2H2(g) + 2H2(g) →C2H6(g) C.)NaCl(s) + AgNO3(s) →AgCl(s) + NaNO3(s) D.)H2(g) + Cl2(g) →2HCl(g) Part B: What is the value of the change in internal energy (in kilojoules) for the reaction 2O3(g) → 3O2(g) which has a ΔH° = −286.0 kJ, if the reaction is carried out at constant pressure of...
19. Which of the following bonds is the most non-polar? Can you explain the answer? 19....
19. Which of the following bonds is the
most non-polar? Can you explain the answer?
19. Which of the following bonds is the most non-polar? a. C-C b. C-H c. C-O d. C-N
A. Derive an equation from first principles that shows how the maximum non-expansion work in a reversible isothermal-isobaric process depends on Gibbs free energy and hence chemical potential B. Using you derivation, show how the standard potential of an electrochemical reaction relates to the change in Gibbs free energy and the work done by the system 10P 2. A. Define both chemical potential and activity coefficient. B. Explain why it necessary to use activity coefficients when discussing ionic solutions? Within...
Can someone please explain WHY with the answer, also which
would be the SHOREST AND WHY.
1. Which of the following bonds is the longest bond? a. C-C b. C-N c. C-S d. C-H e. C-Cl
7. Calculate the maximum non-expansion work per mole that may be obtained from the combustion of methanol at 298 K. (10 pts) 2CH,OH (g) + O2 (g) 2002 (g) + 4H20 (1) CH,OH (g) 0:(8) CO2(g) H20 (1) A, Gº (kJ mol) -161.96 0 -394.36 -273.13
an ideal gas undergoes irreversible isothermal expansion.
which is correct? The answer is A. Please explain why.
An ideal gas undergoes irreversible isothermal expansion. Which is correct? 2.
Please explain why the answer to this is C. thank you!
9. Which of the following sets of reactants would lead to the formation of the molecule given below: on vilo zawollo sto HO sodomondib Eos t elo Bob E sexdolor oroli-Al- sodbo il a. S-1-iodo-2-methylpentane with HOCHZ b. S-1-iodo-2-methylpentane with NaOH e. S-1-iodo-2-methylpentane with water d. all of the above e. only options b and c Ho
please answer all parts and show work please
Problem 130 pts): a. Explain the primary purpose of regeneration in a Rankine power plant. Sketch a T-s diagram using either open or closed feedwater heater to explain your response. b. Explain the advantages and disadvantages of open and closed feedwater heaters. c. Assume steady-flow, no heat transfer, no work, one entrance, and one exit and neglect elevation changes. Show that the stagnation enthalpy is constant throughout a nozzle. d. Recall that...
19. Which of the following bonds is the
most non-polar? Can you explain the answer?
19. Which of the following bonds is the most non-polar? a. C-C b. C-H c. C-O d. C-N
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 34 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago