Which simple ion would each of the following elements be expected to form? What noble gas...
Which simple ion would each of the following elements be expected to form? What noble gas has an analogous electron configuration to each of the ions?
(a) calcium, Z=20
| ion | full electron configuration of ion | noble gas equivalent |
|
Answer |
Answer |
Answer |
(b) nitrogen, Z=7
| ion | full electron configuration of ion | noble gas equivalent |
|
Answer |
Answer |
Answer |
(c) selenium, Z=34
| ion | full electron configuration of ion | noble gas equivalent |
|
Answer |
Answer |
Answer |
Homework Answers
Add Answer to:
Which simple ion would each of the following elements be
expected to form? What noble gas...
8. Write the electron configuration for each of the following atoms and for the simple ion...
8. Write the electron configuration for each of the following atoms and for the simple ion that the element most commonly forms. In each case, indicate which noble gas has the same electron configuration as the ion. a. sodium, Z=11 b. iodine, Z= 53 c. calcium, Z=20 d. nitrogen, Z-7 e. fluorine, Z= 9
What is(are) the noble gas(es) that have the same electron configuration as each of the ions...
What is(are) the noble gas(es) that have the same electron configuration as each of the ions in the compound formed from Z=38 and Z=34?
A. If the following elements were to form an ionic compound, which noble-gas configuration would they...
A. If the following elements were to form an
ionic compound, which noble-gas configuration would they most
likely attain?
Drag the appropriate elements to their respective bins.
B. An unknown element, X, reacts with lithium
to form the compound Li2X. In other compounds this element also can
accommodate up to 12 electrons rather than the usual octet. What
element could Xbe?
If the following elements were to form an ionic compound, which noble-gas configuration would they most likely attain? Drag...
Using SPECTROSCOPIC notation write the complete electron configuration for the chromium(II) ion. Using NOBLE GAS...
Using SPECTROSCOPIC notation write the complete electron configuration for the chromium(II) ion. Using NOBLE GAS notation write the electron configuration for the cobalt(III) ion. Submit Answer Try Another Version 3 item attempts remaining Write ground-state electron configurations for the ions S, P3, Na and Crt. Which do you expect will be paramagnetic due to the presence of unpaired electrons? (Express your answer as a series of orbitals. For example, the electron configuration of Li would be entered in complete form...
Chapter 9 1. Na+ has the same electron configuration as which noble gas? A) Ne b)...
Chapter 9 1. Na+ has the same electron configuration as which noble gas? A) Ne b) Ar c) Xe d) Rn 2. Cl- has the same electron configuration as which noble gas? A) Ne b) Ar c) Xe d) Rn 3. Which of these steps requires the most energy in the formation of a solid ionic compound from its elements? A) removal of the electron from the metal to form the cation b) transfer of the removed electron to the...
24. Which noble gas is isoelectronic with each of the following nonmetal ions? (a) Br (a)...
24. Which noble gas is isoelectronic with each of the following nonmetal ions? (a) Br (a) Se (dN (b) 02- Wor (d) atom or ion 26. In each of the following pairs, which has the larger radius? (a) Al atom or Al ion (b) Pb atom or Pb ion (c) Se atom or Se ion (d) Natom or N ion (d) N4 34. Write the electron dot formula and draw the structural for- mula for each of the following molecules....
If the following elements were involved in redox reactions, which noble-gas configuration would...
If the following elements were involved in redox reactions, which noble-gas configuration would they most likely attain?Appropriate elements to their respective bins. ( He OR Ne OR Ar OR Kr ); for { Li, Al, O, P, K, Se, Sr }
What is the correct noble gas shorthand ground state electron configuration for Sr? Which of the...
What is the correct noble gas shorthand ground state electron configuration for Sr? Which of the following elements is expected to have the largest atomic radius? i. Which of the following elements is expected to have the greatest ionization energy? Which of the following elements is expected to have the smallest ionization energy? Which choice correctly ranks the elements Ga, Ca. C. Fr. and O in order of increasing ionization energy?
5.(12 pts) Identify the group of elements that correspond to each of the following generalized electron...
5.(12 pts) Identify the group of elements that correspond to each of the following generalized electron configurations. No partial credit. You should check your work using table 7.3 of text. (a) [Noble gas] ns?np (b) [Noble gas] ns?(n-1)d? (c) [Noble gas) ns-(n-1)dlºnp! (d) [Noble gas] ns (n-2015 6.(18ps) (a) 6pts. What is the ground state electron configuration and orbital diagram of Nb(41)? Is this paramagnetic or diamagnetic? (b) 4pts. The following is an excited state configuration of a neutral atom:...
For each of the following, write the electron configuration for each element on the reactants side....
For each of the following, write the electron configuration for each element on the reactants side. Then write the electron configuration for the ions that would be formed when making the ionic compound product. (You may use noble gas core configurations) Example: Sodium and chlorine Na+Cl→Na1++Cl1- →NaCl 1s22s22p63s1 + 1s22s22p63s23p5 → 1s22s22p6 + 1s22s22p63s23p6 → NaCl Calcium and fluorine Potassium and sulfur Magnesium and oxygen Zinc and nitrogen Lithium and bromine 6. Iron(III) and chlorine 7. Nickel(II) and nitrogen 8....
8. Write the electron configuration for each of the following atoms and for the simple ion that the element most commonly forms. In each case, indicate which noble gas has the same electron configuration as the ion. a. sodium, Z=11 b. iodine, Z= 53 c. calcium, Z=20 d. nitrogen, Z-7 e. fluorine, Z= 9
A. If the following elements were to form an
ionic compound, which noble-gas configuration would they most
likely attain?
Drag the appropriate elements to their respective bins.
B. An unknown element, X, reacts with lithium
to form the compound Li2X. In other compounds this element also can
accommodate up to 12 electrons rather than the usual octet. What
element could Xbe?
If the following elements were to form an ionic compound, which noble-gas configuration would they most likely attain? Drag...
Using SPECTROSCOPIC notation write the complete electron configuration for the chromium(II) ion. Using NOBLE GAS notation write the electron configuration for the cobalt(III) ion. Submit Answer Try Another Version 3 item attempts remaining Write ground-state electron configurations for the ions S, P3, Na and Crt. Which do you expect will be paramagnetic due to the presence of unpaired electrons? (Express your answer as a series of orbitals. For example, the electron configuration of Li would be entered in complete form...
Chapter 9 1. Na+ has the same electron configuration as which noble gas? A) Ne b) Ar c) Xe d) Rn 2. Cl- has the same electron configuration as which noble gas? A) Ne b) Ar c) Xe d) Rn 3. Which of these steps requires the most energy in the formation of a solid ionic compound from its elements? A) removal of the electron from the metal to form the cation b) transfer of the removed electron to the...
24. Which noble gas is isoelectronic with each of the following nonmetal ions? (a) Br (a) Se (dN (b) 02- Wor (d) atom or ion 26. In each of the following pairs, which has the larger radius? (a) Al atom or Al ion (b) Pb atom or Pb ion (c) Se atom or Se ion (d) Natom or N ion (d) N4 34. Write the electron dot formula and draw the structural for- mula for each of the following molecules....
What is the correct noble gas shorthand ground state electron configuration for Sr? Which of the following elements is expected to have the largest atomic radius? i. Which of the following elements is expected to have the greatest ionization energy? Which of the following elements is expected to have the smallest ionization energy? Which choice correctly ranks the elements Ga, Ca. C. Fr. and O in order of increasing ionization energy?
5.(12 pts) Identify the group of elements that correspond to each of the following generalized electron configurations. No partial credit. You should check your work using table 7.3 of text. (a) [Noble gas] ns?np (b) [Noble gas] ns?(n-1)d? (c) [Noble gas) ns-(n-1)dlºnp! (d) [Noble gas] ns (n-2015 6.(18ps) (a) 6pts. What is the ground state electron configuration and orbital diagram of Nb(41)? Is this paramagnetic or diamagnetic? (b) 4pts. The following is an excited state configuration of a neutral atom:...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago