Homework Answers
![The expression of equilibolum Comstoul- *= AJ [B] Sence k= 1 it means [ct should be equal to CA [B] therefore Equilibelum Con](http://img.homeworklib.com/questions/0331d020-70a4-11ea-9640-750ded962b51.png?x-oss-process=image/resize,w_560)
Add Answer to:
10. The equilibrium constant for a reaction A+B= 2C is 1.0. If a 1L solution containing...
2. For the reaction: A(g) +B(g) = 2C(g) K = 1.0 x 10-5 at 25°C When...
2. For the reaction: A(g) +B(g) = 2C(g) K = 1.0 x 10-5 at 25°C When equilibrium was reached at 25°C, the equilibrium concentrations of the reactant gases were: [A] = 2.5 x10-2M [B] = 2.0 x 10- M Calculate the equilibrium concentration of the product gas C? 3. At a certain temperature the reaction has an equilibrium constant of 0.400. CO(g) + H2O(g) = CO2(g) + H2(g) When 1.50 mol of carbon dioxide gas and 1.50 mol of hydrogen...
B. The reaction A(g) + 2B(g) 2C(g) was allowed to come to equilibrium. The initial After...
B. The reaction A(g) + 2B(g) 2C(g) was allowed to come to equilibrium. The initial After the reaction reached equilibrium, the amount of B remaining in the 2.0 L vessel was 1.0 amounts of reactants placed into a 2.00 L vessel were 2,0 mol A and 2.0 mol B and 1,0 mol C. mol of B. Calculate (show formulas and appropriate steps in each case): a) (10 points) Ke for this reaction: Ec = LA)632 (2)(2) = to equilibrium for...
The equilibrium constant for the reaction A (aq) - B (aq) is 0.2. A reaction mixture...
The equilibrium constant for the reaction A (aq) - B (aq) is 0.2. A reaction mixture initially contains 0.30 mol A and 0 mol B in a 1L container. Which of the following statements best represents the mixture at equilibrium? A. The reaction mixture contains 0.25 mol A and 0.05 mol B B. The reaction mixture contains equal amounts of A and B C. Not enough information is provided to answer the question D. The reaction mixture contains 0.05 mol...
Equilibrium Concentrations -- A + B = 2C At a particular temperature, K = 1.00×102 for...
Equilibrium Concentrations -- A + B = 2C
At a particular temperature, K = 1.00×102
for the reaction:
H2(g) + F2(g)
2HF(g)
In an experiment, at this temperature, 1.00×10-1 mol
of H2 and 1.00×10-1 mol of F2 are
introduced into a 1.09-L flask and allowed to react. At
equilibrium, all species remain in the gas phase.
What is the equilibrium concentration (in mol/L) of
H2?
mol/L
1 pts
What is the equilibrium concentration (in mol/L) of HF?
mol/L
1 pts...
Help please! Show work cs 6. The equilibrium constant for the reaction in question 2c is...
Help please! Show work
cs 6. The equilibrium constant for the reaction in question 2c is K. = 721 M . (a) Assuming this reaction is at equilibrium, calculate [I] when [12] = [1:1 = 0.0010 M. (b) Assuming this reaction is at equilibrium, find [I:-) when [12] = 0.0025 M and [1] = 0.010 M. (c) Assuming this reaction is at equilibrium, find [12] when [13"] = 0.00030 M and [1'] = 0.10 M. (d) Before the reaction reaches...
The equilibrium constant for the following reaction is 78: A + B <----> 2 C
The equilibrium constant for the following reaction is 78: A + B <----> 2 C If 0.80 mol of A and 0.80 mol of B in a 1.000 L reaction vessel is allowed to reach equilibrium, what is the concentration of C?
Solution is made that is 1.0 M in A and 1.0 M in B. A and...
Solution is made that is 1.0 M in A and 1.0 M in B. A and B then react: A(aq) B(aq) Right harpoon over left harpoon C(aq) D(aq) What would the equilibrium concentration of C be with each of the following equilibrium constants? Note that ~O means that the concentrate very small.
Question 25 1) Consider the following reaction, equilibrium concentrations, and equilibrium constant at a particular temperature....
Question 25 1) Consider the following reaction, equilibrium concentrations, and equilibrium constant at a particular temperature. Determine the equilibrium concentration of H2O(g) (3 marks) CH4(g) + H2O(g) = C,H,OH(g) ke -9.0 * 10 M [CH]eq=0.015 mol CH2OHjeq = 1.69 moll A) 9.9 x 10 mol L' B) 80. mol L' C) 1.0 mol L. D) 1.68 mol L' E) 0.013 mol L'
100 mL of air is in contact with 1L of pure water in a closed vessel...
100 mL of air is in contact with 1L of pure water in a closed vessel at 10°c. If the water is initially oxygen free, once equilibrium has been reached, what is the concentration of oxygen in the water and the partial pressure of oxygen in the air once equilibrium has been reached? Assume no volatility due to water. The Henry's constant for oxygen is 588 atm.L/mol at 10°C. What other assumptions do you make in performing this calculation? Note...
The equilibrium constant Kc for the reaction: A(g) + B(g) ⇔ 2C(g) is 0.76 at 150...
The equilibrium constant Kc for the reaction: A(g) + B(g) ⇔ 2C(g) is 0.76 at 150 °C. If 0.500 M of A is added to 0.500 M of B in a 1.00 L container, calculate the [EQ] for A, B and C
2. For the reaction: A(g) +B(g) = 2C(g) K = 1.0 x 10-5 at 25°C When equilibrium was reached at 25°C, the equilibrium concentrations of the reactant gases were: [A] = 2.5 x10-2M [B] = 2.0 x 10- M Calculate the equilibrium concentration of the product gas C? 3. At a certain temperature the reaction has an equilibrium constant of 0.400. CO(g) + H2O(g) = CO2(g) + H2(g) When 1.50 mol of carbon dioxide gas and 1.50 mol of hydrogen...
B. The reaction A(g) + 2B(g) 2C(g) was allowed to come to equilibrium. The initial After the reaction reached equilibrium, the amount of B remaining in the 2.0 L vessel was 1.0 amounts of reactants placed into a 2.00 L vessel were 2,0 mol A and 2.0 mol B and 1,0 mol C. mol of B. Calculate (show formulas and appropriate steps in each case): a) (10 points) Ke for this reaction: Ec = LA)632 (2)(2) = to equilibrium for...
The equilibrium constant for the reaction A (aq) - B (aq) is 0.2. A reaction mixture initially contains 0.30 mol A and 0 mol B in a 1L container. Which of the following statements best represents the mixture at equilibrium? A. The reaction mixture contains 0.25 mol A and 0.05 mol B B. The reaction mixture contains equal amounts of A and B C. Not enough information is provided to answer the question D. The reaction mixture contains 0.05 mol...
Equilibrium Concentrations -- A + B = 2C
At a particular temperature, K = 1.00×102
for the reaction:
H2(g) + F2(g)
2HF(g)
In an experiment, at this temperature, 1.00×10-1 mol
of H2 and 1.00×10-1 mol of F2 are
introduced into a 1.09-L flask and allowed to react. At
equilibrium, all species remain in the gas phase.
What is the equilibrium concentration (in mol/L) of
H2?
mol/L
1 pts
What is the equilibrium concentration (in mol/L) of HF?
mol/L
1 pts...
Help please! Show work
cs 6. The equilibrium constant for the reaction in question 2c is K. = 721 M . (a) Assuming this reaction is at equilibrium, calculate [I] when [12] = [1:1 = 0.0010 M. (b) Assuming this reaction is at equilibrium, find [I:-) when [12] = 0.0025 M and [1] = 0.010 M. (c) Assuming this reaction is at equilibrium, find [12] when [13"] = 0.00030 M and [1'] = 0.10 M. (d) Before the reaction reaches...
Solution is made that is 1.0 M in A and 1.0 M in B. A and B then react: A(aq) B(aq) Right harpoon over left harpoon C(aq) D(aq) What would the equilibrium concentration of C be with each of the following equilibrium constants? Note that ~O means that the concentrate very small.
Question 25 1) Consider the following reaction, equilibrium concentrations, and equilibrium constant at a particular temperature. Determine the equilibrium concentration of H2O(g) (3 marks) CH4(g) + H2O(g) = C,H,OH(g) ke -9.0 * 10 M [CH]eq=0.015 mol CH2OHjeq = 1.69 moll A) 9.9 x 10 mol L' B) 80. mol L' C) 1.0 mol L. D) 1.68 mol L' E) 0.013 mol L'
100 mL of air is in contact with 1L of pure water in a closed vessel at 10°c. If the water is initially oxygen free, once equilibrium has been reached, what is the concentration of oxygen in the water and the partial pressure of oxygen in the air once equilibrium has been reached? Assume no volatility due to water. The Henry's constant for oxygen is 588 atm.L/mol at 10°C. What other assumptions do you make in performing this calculation? Note...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 53 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago