Homework Answers
In peptide bond formation the amine group in the amino acid
attacks the carboxylic part of another amino acid, thus a
nucleophilic addition type reaction occurs which followed by
dehydration. Hence Option 2 is the right answer.
Add Answer to:
3. Which of the following best describes the general reaction type exemplified by peptide bond formation?...
Question 6 What is the mechanism of the following reaction? o NH H30+ O Electrophilic addition...
Question 6 What is the mechanism of the following reaction? o NH H30+ O Electrophilic addition Nucleophilic acyl substitution Electrophilic aromatic substitution Nucleophilic addition
which of the following describes acetal formation RM-039 Which of the following describes acetal formation? Select...
which of the following describes acetal formation
RM-039 Which of the following describes acetal formation? Select an answer and submit. For keyboard navigation, use the up/down arrow keys to select an answer. a electrophilic addition - elimination - nucleophilic addition b nucleophilic addition - elimination с nucleophilic addition - elimination - nucleophilic addition d elimination - nucleophilic addition nucleophilic addition - elimination - electrophilic addition Unanswered a Save
N(CH3)3 OH 1. heat 95% 5% (E & Z) он 2. H2N a - Proton transfer dSN2 Nucleophilic substitution b- Lewis acid/base e-Electrophilic aromatic substitution c=E2 elimination f= g Nucleophilic subs at...
N(CH3)3 OH 1. heat 95% 5% (E & Z) он 2. H2N a - Proton transfer dSN2 Nucleophilic substitution b- Lewis acid/base e-Electrophilic aromatic substitution c=E2 elimination f= g Nucleophilic subs at carbonyl(acyl Xfer) h-Conjugate (nucleophilic) addn r-carbonyl nucleophilic addn Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed. Use the letters a i for your answers. 1. 2.
N(CH3)3 OH 1. heat 95% 5% (E & Z) он 2. H2N a -...
Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed....
Identify the mechanism by which each of the reactions above
proceeds from among the mechanisms listed. Use the letters
a - i for your answers.
HCI NH2 NH sobe. The ZI a= Proton transfer d=Sn2 Nucleophilic substitution e= Electrophilic aromatic substitution f= Carbonyl nucleophilic addn g= Nucleophilic subs at carbonyl(acyl Xfer) h = Conjugate (nucleophilic) addn b = Lewis acid/base c=E2 elimination Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed. Use the...
This reaction, which is typical of carboxylic acids and their derivatives, is called wo- OH OH...
This reaction, which is typical of carboxylic acids and their derivatives, is called wo- OH OH O A Nucleophilic acyl addition. O B Nucleophilic non-acyl substitution. O C Electrophilic acyl addition. O D Nucleophilic acyl substitution. O E Electrophilic acyl substitution.
please only box one answer for each of these questions. HOH • SOCI + SO, HC...
please only box one answer for each of these questions.
HOH • SOCI + SO, HC a = Proton transfer b = Lewis acid base c = Radical chain substitution d = Radical chain addition e = Electrophilic addition f= E1 Elimination g = E2 Elimination h = Syl Nucleophilic substitution = Sy2 Nucleophilic substitution = Electrophilic aromatic substitution Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed. Use the letters - for...
1. Li 2. aq. NaOH reflux Cl NaCI+H20 a Proton transfer b Lewis acid/base c E2...
1. Li 2. aq. NaOH reflux Cl NaCI+H20 a Proton transfer b Lewis acid/base c E2 elimination d SN2 Nucleophilic substitution e-Electrophilic aromatic substitution f Carbonyl nucleophilic addn g Nucleophilic subs at carbonyl(acyl Xfer) h = Conjugate (nucleophilic) addn Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed. Use the letters a - i for your answers. 1. 2. 1.8% Hyc's、CH, + H CH3 2. N(CHs CI a Proton transfer b-Lewis acid/base E2...
Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed....
Identify the mechanism by which each of the reactions above
proceeds from among the mechanisms listed. Use the letters
a - i for your answers.
ΝΗ Η H... U S penicillanase HMS X + H2O 06 T 02C HN N. CO, K. což k This is the way penicillin-resistant bacteria destroy penicillins. NH2 sob. I - NH; CI a Objetos Nis ci a = Proton transfer b = Lewis acid/base c=E2 elimination d=Sn2 Nucleophilic substitution e= Electrophilic aromatic substitution f=...
Which of the following reaction sequences best describes the formation of the nucleic acid in the...
Which of the following reaction sequences best describes the formation of the nucleic acid in the biosynthesis of DNA? A) nucleophilic attack of a 5'-OH group of one nucleotide on the B-phosphorus of another B) nucleophilic attack of a 5'-OH group of one nucleotide on the a-phosphorus of another C) nucleophilic attack of a 3'-OH group of a nucleotide on the y-phosphorus of another D) nucleophilic attack of a 3'-OH group of one nucleotide on the B-phosphorus of another E)...
+ - 1. ~ ai + AICI: CI-AICI: 2. N - вBr3 O-CH3 O-CH3 °-CH3 +...
+ - 1. ~ ai + AICI: CI-AICI: 2. N - вBr3 O-CH3 O-CH3 °-CH3 + 3 + + BBrz BBr- a = Proton transfer b = Lewis acid/base c= Radical chain substitution d = Radical chain addition e = Electrophilic addition f=E1 Elimination g=E2 Elimination h=Sn1 Nucleophilic substitution i = Sy2 Nucleophilic substitution j= Electrophilic aromatic substitution Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed. Use the letters a - j...
Question 6 What is the mechanism of the following reaction? o NH H30+ O Electrophilic addition Nucleophilic acyl substitution Electrophilic aromatic substitution Nucleophilic addition
which of the following describes acetal formation
RM-039 Which of the following describes acetal formation? Select an answer and submit. For keyboard navigation, use the up/down arrow keys to select an answer. a electrophilic addition - elimination - nucleophilic addition b nucleophilic addition - elimination с nucleophilic addition - elimination - nucleophilic addition d elimination - nucleophilic addition nucleophilic addition - elimination - electrophilic addition Unanswered a Save
N(CH3)3 OH 1. heat 95% 5% (E & Z) он 2. H2N a - Proton transfer dSN2 Nucleophilic substitution b- Lewis acid/base e-Electrophilic aromatic substitution c=E2 elimination f= g Nucleophilic subs at carbonyl(acyl Xfer) h-Conjugate (nucleophilic) addn r-carbonyl nucleophilic addn Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed. Use the letters a i for your answers. 1. 2.
N(CH3)3 OH 1. heat 95% 5% (E & Z) он 2. H2N a -...
Identify the mechanism by which each of the reactions above
proceeds from among the mechanisms listed. Use the letters
a - i for your answers.
HCI NH2 NH sobe. The ZI a= Proton transfer d=Sn2 Nucleophilic substitution e= Electrophilic aromatic substitution f= Carbonyl nucleophilic addn g= Nucleophilic subs at carbonyl(acyl Xfer) h = Conjugate (nucleophilic) addn b = Lewis acid/base c=E2 elimination Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed. Use the...
This reaction, which is typical of carboxylic acids and their derivatives, is called wo- OH OH O A Nucleophilic acyl addition. O B Nucleophilic non-acyl substitution. O C Electrophilic acyl addition. O D Nucleophilic acyl substitution. O E Electrophilic acyl substitution.
please only box one answer for each of these questions.
HOH • SOCI + SO, HC a = Proton transfer b = Lewis acid base c = Radical chain substitution d = Radical chain addition e = Electrophilic addition f= E1 Elimination g = E2 Elimination h = Syl Nucleophilic substitution = Sy2 Nucleophilic substitution = Electrophilic aromatic substitution Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed. Use the letters - for...
1. Li 2. aq. NaOH reflux Cl NaCI+H20 a Proton transfer b Lewis acid/base c E2 elimination d SN2 Nucleophilic substitution e-Electrophilic aromatic substitution f Carbonyl nucleophilic addn g Nucleophilic subs at carbonyl(acyl Xfer) h = Conjugate (nucleophilic) addn Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed. Use the letters a - i for your answers. 1. 2. 1.8% Hyc's、CH, + H CH3 2. N(CHs CI a Proton transfer b-Lewis acid/base E2...
Identify the mechanism by which each of the reactions above
proceeds from among the mechanisms listed. Use the letters
a - i for your answers.
ΝΗ Η H... U S penicillanase HMS X + H2O 06 T 02C HN N. CO, K. což k This is the way penicillin-resistant bacteria destroy penicillins. NH2 sob. I - NH; CI a Objetos Nis ci a = Proton transfer b = Lewis acid/base c=E2 elimination d=Sn2 Nucleophilic substitution e= Electrophilic aromatic substitution f=...
Which of the following reaction sequences best describes the formation of the nucleic acid in the biosynthesis of DNA? A) nucleophilic attack of a 5'-OH group of one nucleotide on the B-phosphorus of another B) nucleophilic attack of a 5'-OH group of one nucleotide on the a-phosphorus of another C) nucleophilic attack of a 3'-OH group of a nucleotide on the y-phosphorus of another D) nucleophilic attack of a 3'-OH group of one nucleotide on the B-phosphorus of another E)...
+ - 1. ~ ai + AICI: CI-AICI: 2. N - вBr3 O-CH3 O-CH3 °-CH3 + 3 + + BBrz BBr- a = Proton transfer b = Lewis acid/base c= Radical chain substitution d = Radical chain addition e = Electrophilic addition f=E1 Elimination g=E2 Elimination h=Sn1 Nucleophilic substitution i = Sy2 Nucleophilic substitution j= Electrophilic aromatic substitution Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed. Use the letters a - j...
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 27 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 1 hour ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago