5. Name the following hydrocarbons using IUPAC nomenclature CH3 CH3 b. CH3 CH3 CH3CH=CHCHCH=CHCHCH3 CH3 -CH3...
PROBLEM 7.4 Give IUPAC names for the following compounds: (a) H3C CHз ачи. CH3 H2C=CHCHCCH3 3-Methyl hex-3-ene CH₃ pent-l-ene (c) CH3 CH3 CH2CH=CHCHCH=CHCHCH3 4,7 Dimethyl- octa-2,5-diene (d) CH3CHCH2CH3 CH3CH2CH2CH=CHCHCH2CH3 6-Ethyl-7-methyl non-y-ene
CH3 но SH 1. Name the following thiol using IUPAC nomenclature (5 pts). 2. Name the following organometallic compound according to IUPAC nomenclature (5 pts) CH CH:CHa) CuLi 3. Write the product of the following reaction while carefully considering the underlying mechanism (5 pts) 1. LiAID4, Et20 2. H20 4. Complete the following retrosynthetic scheme and while applying an organometallic reaction (5 pts). CH3 CH H3
please help ? name the following compounds using IUPAC nomenclature system CH3 2) CH-CH-CH-CH2– CH, CHZ CH3 3) CH,CHCH, 4) CH3-O-CH3 5) CH3CHO earch Blank #1 O Ateg DALL
1. Name using IUPAC nomenclature following compounds. NO2 CH3 c) CI b) a) ÓCH3 Br CH3 Cl соон Cl CHO
Name the following molecule using IUPAC nomenclature. Name the following molecule using IUPAC nomenclature. Name the following molecule using IUPAC nomenclature. H
IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .
please provide nomenclature for a through j. thanks! Nomenclature Provide the IUPAC name for the following a. CHỊCH-CH(CH3)CH2CH(CHO)CH, C. (CH3)3CCH2C(CH3)3 d. C(CH3)4 f. CH3C(CI)2CH(CH3)2 h. (CH2CH2)2CHCH(CH3)CH2CH3 j. CH2CH(CH3)CCCH2CH3
Using IUPAC nomenclature, provide the best name for this structure. QUESTION 6 Using IUPAC nomenclature, provide the best name for this structure. Н Arial T- TT TT Paragi % DOO 5 (18p T TO fx Mashups T CC HTML Path:p QUESTION 7 Using IUPAC nomenclature, provide the best name for this structure. CH3
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH For the list above I currently put the following as the IUPAC names. If any are wrong can you please correct them! Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 IUPAC Name: 3,3,4-trimethylhexane IUPAC Name: 3-methyl-4-ol-heptane CH3C(CH3)CH2 IUPAC Name: 2-methylpropene CH2O IUPAC Name: methanal CH3CH(NH2)CH3 IUPAC Name: isopropylamine CH3OCH2CH2CH3 IUPAC Name: methoxyethane (ethyl methyl ether) CH(CH3)2COOH IUPAC Name: 2-methylpropanoic acid
Ignoring the possibility of stereoisomers, what is the IUPAC name of the following substance? CH3 CH2CH=CHCHCH,