What is the current U.S. federal policy on stem cell use? How does this differ from...
What is the current U.S. federal policy on stem cell use? How does this differ from stem cell policies of other countries?
Homework Answers
Answer:- U.S. federal policy on stem cell use-
- Under the auspices of the Obama administration, the National
Institutes of Health (NIH) plans to expand federal funding for stem
cell lines that meet certain ethical requirements.
- the embryo was discarded after IVF
- informed consent was obtained from the donors
- the couple does not receive compensation.
- Older stem cell lines created in the spirit of the new
regulations will be considered for federal funding, whereas embryos
created solely for research purpose.
Add Answer to:
What is the current U.S. federal policy on stem cell use? How
does this differ from...
What is a stem cell? How does it apply to current health care research?
What is a stem cell? How does it apply to current health care research?
what ethical issues surround embryonic stem-cell research? should the president have limited federal stem-cell research? Are...
what ethical issues surround embryonic stem-cell research? should the president have limited federal stem-cell research? Are other alternatives such as adult stem cell and placenta as effective? why or why not?
What are the major problems of the fiscal policy? How does fiscal policy differ from the...
What are the major problems of the fiscal policy? How does fiscal policy differ from the monetary policy in the USA economic system?
Stem cell research is funded by the US government at a limited level. However, stem cell...
Stem cell research is funded by the US government at a limited level. However, stem cell research is ongoing in many private companies in the US and does not fall under federal guidelines. What other methods of using stem cells, other than from fetal material, are available? Answer in 5 to 10 sentences.
What is a financial policy, how does it differ from a financial procedure? What is the board’s...
What is a financial policy, how does it differ from a financial procedure? What is the board’s responsibility in terms of financial structure? What are the areas for board pursuit in terms of finances?
With respect to recent U.S Federal Government Fiscal policies what has the Federal Government been doing?...
With respect to recent U.S Federal Government Fiscal policies what has the Federal Government been doing? Is it following contractionary or expansionary policy? Why? What policy tools have they been using? Is the fiscal policy being followed correct for the current state of the economy?
How does the Federal Reserve System differ from the Central bank in USA?
How does the Federal Reserve System differ from the Central bank in USA?
How does the Federal Reserve System differ from the Central bank in USA?
How does the Federal Reserve System differ from the Central bank in USA?
Coronavirus What does it mean for the U.S. Economy, Federal Reserve Bank, and U.S. Multinational Corporations'...
Coronavirus What does it mean for the U.S. Economy, Federal Reserve Bank, and U.S. Multinational Corporations' performances? As coronavirus fears shake the U.S. economy, putting Wall Street on pace for its worst performance since the global financial crisis in 2008, as coronavirus infections accelerated. What does it mean for the U.S, Economy, Federal Reserve Bank Policies, and U.S. Multinational Corporations' performances?
Which of the following might help US researchers to develop and study human stem cell lines...
Which of the following might help US researchers to develop and study human stem cell lines in the future? The ability to import SC lines into the US. The establishment of stem cell banks. The ability of US companies to perform studies overseas, or in other more permissive countries. The lack of US federal law which rules on the legality of generating stem cells for research purposes. The use of iPS cells.
Which of the following might help US researchers to develop and study human stem cell lines in the future? The ability to import SC lines into the US. The establishment of stem cell banks. The ability of US companies to perform studies overseas, or in other more permissive countries. The lack of US federal law which rules on the legality of generating stem cells for research purposes. The use of iPS cells.
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago