Homework Answers
All these reactions are simple nucleophilic substitution reactions and give more than one products in most of the cases. The detailed information regarding the major products, as asked, is given below in the pictures:
Add Answer to:
4. Predict the major organic product of the following reactions HO SO ol o & yote...
Predict the major organic product of the following reactions 4 Hy0, Febr KMnO, 4 HNO గ,...
Predict the major organic product of the following reactions 4 Hy0, Febr KMnO, 4 HNO గ, 4 AICh AICI Кмго, Кон, н,о HNO H,SO A Feby ०६६४
predict the major organic product(s) of the following reactions. Indicate stereochemistry ps.) Predict the major organic...
predict the major organic product(s) of the following reactions.
Indicate stereochemistry
ps.) Predict the major organic product or products of the following reactions Indicate stereochemistry of product(s) where appropriate. CHCI 1. BH,THE 2. HÔ , HO, HẠO H-Br H₂O₂ Brz НО
predict the major products for the following reactions Rnx Rnx 4.(1 pt each) Predict the MAJOR organic product(s) fo...
predict the major products for the following reactions
Rnx Rnx 4.(1 pt each) Predict the MAJOR organic product(s) for the following reactions. b) wet halogenation fab catalytic hydrogention НСІ HO Ozonolysis > 1.03 H₂O* 2.DMS
Predict the major organic product of products of each of the following reactions. a) (CH),CHCH-CH- H2SO4...
Predict the major organic product of products of each of the following reactions. a) (CH),CHCH-CH- H2SO4 HO b) (CH3),CHCH=CH, 1. Hg(OAc), H2O 2. NaBH 1. BH3-THF c) (CH3),CHCH=CH2 2. H2O3, NaOH
Predict the major organic product for the following organic reactions. Show intermediates when required. If the...
Predict the major organic product for the following organic
reactions. Show intermediates when required. If the product is
given then provide the appropriate reagents above the arrow in the
reaction.
Me 1. LDA, -78°C 2. TMSCI I. LDA, -78°C 1. Eto, R.T. 2. Mel Provide repent to make the Stork Enamine Me 1) CHI 2) H,O, HO (Hydrolysis) |C,HO Provide reagents
Predict the major organic product or products of each of the following reactions: Identify the mechanism...
Predict the major organic product
or products of each of the following reactions:
Identify the mechanism
taking place in each of the reactions and please provide
explanation.
H2SO4 a) (CHỊ) CH CH=CH, HO Hg(OAc)2 NaBH4 b) (CH3)2CH CH=CH2 H2O BH3: THE H2O2, NaOH c) (CH3),CH CH=CH2 H2SO4, H2O d) CHCECH HgSO4 HZ/Ni f) + Cl2 + H2O g) Cold KMnO4 dilute h) 1. CH CO-OH 2. Hz0 Br2 i) CC14
Thanks! Predict the major organic product SNH2 ? 1 Bro Nooh, Ho 2)CH₂ {ci spyridine НО...
Thanks!
Predict the major organic product SNH2 ? 1 Bro Nooh, Ho 2)CH₂ {ci spyridine НО HNO: A CHO H .OH -oh -H Ho. Ć Hoh. Predict the major product
4. Predict the major organic product obtained from the following reactions, 1 mol a) 2 mol...
4. Predict the major organic product obtained from the following reactions, 1 mol a) 2 mol 2 mol 1 mol Cul B20 E10 1. CHMgBr 2. H30 b) 1. Mg 2. CO2 3. Ho
5. Predict the major organie product(s) for the following reactions: HO a. O b. OH c....
5. Predict the major organie product(s) for the following reactions: HO a. O b. OH c. OH d. OH e.
4. Predict the major product for the following reaction. Cly/AICI, OH 5. Predict the major product...
4. Predict the major product for the following reaction. Cly/AICI, OH 5. Predict the major product for the following reaction. OCH, HNO/H2SO4 OCH 6. Discuss ortho, meta para directors, activators and deactivators and predict products. De 9 © PL
Predict the major organic product of the following reactions 4 Hy0, Febr KMnO, 4 HNO గ, 4 AICh AICI Кмго, Кон, н,о HNO H,SO A Feby ०६६४
predict the major organic product(s) of the following reactions.
Indicate stereochemistry
ps.) Predict the major organic product or products of the following reactions Indicate stereochemistry of product(s) where appropriate. CHCI 1. BH,THE 2. HÔ , HO, HẠO H-Br H₂O₂ Brz НО
predict the major products for the following reactions
Rnx Rnx 4.(1 pt each) Predict the MAJOR organic product(s) for the following reactions. b) wet halogenation fab catalytic hydrogention НСІ HO Ozonolysis > 1.03 H₂O* 2.DMS
Predict the major organic product of products of each of the following reactions. a) (CH),CHCH-CH- H2SO4 HO b) (CH3),CHCH=CH, 1. Hg(OAc), H2O 2. NaBH 1. BH3-THF c) (CH3),CHCH=CH2 2. H2O3, NaOH
Predict the major organic product for the following organic
reactions. Show intermediates when required. If the product is
given then provide the appropriate reagents above the arrow in the
reaction.
Me 1. LDA, -78°C 2. TMSCI I. LDA, -78°C 1. Eto, R.T. 2. Mel Provide repent to make the Stork Enamine Me 1) CHI 2) H,O, HO (Hydrolysis) |C,HO Provide reagents
Predict the major organic product
or products of each of the following reactions:
Identify the mechanism
taking place in each of the reactions and please provide
explanation.
H2SO4 a) (CHỊ) CH CH=CH, HO Hg(OAc)2 NaBH4 b) (CH3)2CH CH=CH2 H2O BH3: THE H2O2, NaOH c) (CH3),CH CH=CH2 H2SO4, H2O d) CHCECH HgSO4 HZ/Ni f) + Cl2 + H2O g) Cold KMnO4 dilute h) 1. CH CO-OH 2. Hz0 Br2 i) CC14
Thanks!
Predict the major organic product SNH2 ? 1 Bro Nooh, Ho 2)CH₂ {ci spyridine НО HNO: A CHO H .OH -oh -H Ho. Ć Hoh. Predict the major product
4. Predict the major organic product obtained from the following reactions, 1 mol a) 2 mol 2 mol 1 mol Cul B20 E10 1. CHMgBr 2. H30 b) 1. Mg 2. CO2 3. Ho
5. Predict the major organie product(s) for the following reactions: HO a. O b. OH c. OH d. OH e.
4. Predict the major product for the following reaction. Cly/AICI, OH 5. Predict the major product for the following reaction. OCH, HNO/H2SO4 OCH 6. Discuss ortho, meta para directors, activators and deactivators and predict products. De 9 © PL
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 23 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago