Homework Answers
If you are using pneumatic trough, then the answer is option-4) the gas will be captured in the water-filled container by displacing the water.
The gas has low density and hence it difficult to collect the gas and find its mass. The gas is bubbled in the container and as it enters the container it displaces the water in it. Thus using this collected gas we can measure the volume of gas and from that, we can calculate number of moles.
PV = nRT
Where, P = Pressure of the gas V = Volume of water displaced n = number of moles of gas R = the ideal gas constant T = the temperature of the gas
Add Answer to:
The gases used in this experiment will be collected and stored using this technique. The gas...
2. The gas laws are defined for ideal gases. Real gases do not always follow the...
2. The gas laws are defined for ideal gases. Real gases do not always follow the gas laws exactly Under what conditions would you predict that real gases least approximate ideal gas behavior Explain why real gases behave least like ideal at the conditions you stated. 3. Define molar mass including the units in which it is expressed. on produced a 0.311 g sample of gas which occupied 225 ml at 55°C exerting a pressure of 886 mm Hg. What...
6. Gases must be stored at certain conditions because of possible explosions. Which of the following...
6. Gases must be stored at certain conditions because of possible explosions. Which of the following conditions would be the most hazardous for a gas initially having a pressure of 2.35 atm and stored in a 1.5 L container at 25.0°C? Support your answer using calculations. a. Changing the size of the container to 1.00 L b. Raising the temperature to 37.4°C.
1. List the types and amounts (volume %) of the four most abundant gases in the...
1. List the types and amounts (volume %) of the four most abundant gases in the atmosphere, excluding water. Use these percentages to calculate the partial pressure in atmospheres of each gas. a). An aerosol can holds 0.35 L at 4.5 atm pressure. What is the volume when the gas is released into 1.0 atm pressure? b). Mt. Whitney, in Claifornia, is the highest point in the lower 48 states and is within 150 miles of the lowest place in...
9. In a laboratory experiment, 259 mL of gas was collected over water at 24 °C...
9. In a laboratory experiment, 259 mL of gas was collected over water at 24 °C and 751 torr Calulat the volume that the dry gas would occupy at STP. (The vapor pressure of water at 24 °C is 22.4 torr.) A sample of neon effuses from a container in 76 seconds. The same amount of an unknown noble gas requires 155 seconds. Identify the gas. 10. 82 ri si
A student devised an experiment to determine the molar mass of an unknown gas X. Firstly,...
A student devised an experiment to determine the molar mass of an unknown gas X. Firstly, he filled a glass gas syringe (accurate to ± 0.5 cm3 ) with 100 cm3 of air then placed a rubber seal over the nozzle and weighed the syringe. He then emptied the gas syringe, refilled it with 100 cm3 of the unknown gas X, replaced the rubber seal and reweighed the syringe. Finally, he measured the temperature of the room. He obtained the...
10.5 Explain and apply Dalton’s law to gas mixtures and gases collected from aqueous reactions. Explain...
10.5 Explain and apply Dalton’s law to gas mixtures and gases collected from aqueous reactions. Explain the concept of partial pressure and total pressure for a mixture of gases Determine the partial pressure of gases based on the moles of each present or determine the mole fraction based on partial pressures For reactions from aqueous solutions be able to determine the partial pressure of the gas collected from the total pressure and vapor pressure of water.
3. Nitrogen gas was collected in a eudiometer during a chemistry experiment by displacement of water....
3. Nitrogen gas was collected in a eudiometer during a chemistry experiment by displacement of water. When the levels of water inside and outside the eudiometer were adjusted to be the same, the volume of the collected gas was found to be 85.2 mL. The water temperature was 24°C and the barometric (atmospheric) pressure was found to be 764.0 mm Hg. What would be the volume of dry nitrogen gas at STP?
In an electrolysis of water experiment, 39.75 mL of H2 gas was collected over water at...
In an electrolysis of water experiment, 39.75 mL of H2 gas was collected over water at 60.0 °C and an atmospheric pressure of 1.03 atm. The vapour pressure of water at 60.0 °C is 19.92 kPa. What mass of H2 was collected
need help with questions EXPERIMENT 9: ELECTROLYSIS AND AVOGADRO'S NUMBER QUESTIONS 1. What solution is used...
need help with questions
EXPERIMENT 9: ELECTROLYSIS AND AVOGADRO'S NUMBER QUESTIONS 1. What solution is used in the apparatus for this experiment? a. Would anything else work? b. If so, what are some examples? 2. What gas forms at the cathode in this experiment? 3. What gas forms at the anode in this experiment? 4. How is the temperature of each of the gases determined? EXPERIMENT ELECTROLYSIS & AVOGADRO'S NUMBER UUUUUUUUUUU INTRODUCTION Electrolysis is the process of causing a chemical...
A-D A student performed an experiment in which they collected hydrogen gas from the reaction of...
A-D
A student performed an experiment in which they collected hydrogen gas from the reaction of magnesium with hydrochloric acid using the same apparatus that you will be using in today's lab. The reaction is: Mg(s) + 2 HCl(aq) → H2(g) + MgCl2 (aq) The data they collected are shown below: Mass of Mg Volume of HCI Volume of H2 collected Temperature of H2 collected Barometric pressure 0.100 g 10 mL 57.5 mL 22 °C 29.94 in Hg a. Barometric...
2. The gas laws are defined for ideal gases. Real gases do not always follow the gas laws exactly Under what conditions would you predict that real gases least approximate ideal gas behavior Explain why real gases behave least like ideal at the conditions you stated. 3. Define molar mass including the units in which it is expressed. on produced a 0.311 g sample of gas which occupied 225 ml at 55°C exerting a pressure of 886 mm Hg. What...
6. Gases must be stored at certain conditions because of possible explosions. Which of the following conditions would be the most hazardous for a gas initially having a pressure of 2.35 atm and stored in a 1.5 L container at 25.0°C? Support your answer using calculations. a. Changing the size of the container to 1.00 L b. Raising the temperature to 37.4°C.
9. In a laboratory experiment, 259 mL of gas was collected over water at 24 °C and 751 torr Calulat the volume that the dry gas would occupy at STP. (The vapor pressure of water at 24 °C is 22.4 torr.) A sample of neon effuses from a container in 76 seconds. The same amount of an unknown noble gas requires 155 seconds. Identify the gas. 10. 82 ri si
3. Nitrogen gas was collected in a eudiometer during a chemistry experiment by displacement of water. When the levels of water inside and outside the eudiometer were adjusted to be the same, the volume of the collected gas was found to be 85.2 mL. The water temperature was 24°C and the barometric (atmospheric) pressure was found to be 764.0 mm Hg. What would be the volume of dry nitrogen gas at STP?
need help with questions
EXPERIMENT 9: ELECTROLYSIS AND AVOGADRO'S NUMBER QUESTIONS 1. What solution is used in the apparatus for this experiment? a. Would anything else work? b. If so, what are some examples? 2. What gas forms at the cathode in this experiment? 3. What gas forms at the anode in this experiment? 4. How is the temperature of each of the gases determined? EXPERIMENT ELECTROLYSIS & AVOGADRO'S NUMBER UUUUUUUUUUU INTRODUCTION Electrolysis is the process of causing a chemical...
A-D
A student performed an experiment in which they collected hydrogen gas from the reaction of magnesium with hydrochloric acid using the same apparatus that you will be using in today's lab. The reaction is: Mg(s) + 2 HCl(aq) → H2(g) + MgCl2 (aq) The data they collected are shown below: Mass of Mg Volume of HCI Volume of H2 collected Temperature of H2 collected Barometric pressure 0.100 g 10 mL 57.5 mL 22 °C 29.94 in Hg a. Barometric...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 37 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 6 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 6 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago