1. If the lid of a glass jar is stuck, why do you run it under...
1. If the lid of a glass jar is stuck, why do you run it under hot water to open it?
2. When performing a calorimetry experiment using water and ice, why must ice be dried off before placing it into the calorimeter?
Homework Answers
1. Because while running under hot water the lid (mostly made up of metal), heats up and thus expand, the rim of the jar also expand but expansion in metals is larger than that in glass. Hence it becomes easier to open the lid.
2. If the ice is not dried there will be water at zero degrees celsius on the surface of ice block. This water will contribute to the final mass of the liquid but will not need the equivalent amount of heat the ice would need. The temperature of water in the calorimeter will not drop as much thus the resulting temperature will be higher than that expected. This will lead to error in the result.
PART B. HEAT OF SOLUTION REACTION Obtain a sample bottle with an unknown ionic salt. Record...
PART B. HEAT OF SOLUTION REACTION Obtain a sample bottle with an unknown ionic salt. Record its identification letter. Gently dry the inside of the calorimeter and weigh it. If the calorimeter is not dry, you will not be able to accurately find the mass of water in your calorimeter. Add about 50 mL of distilled water and weigh again. Measure the water's initial temperature. Use a plastic weighing "boat" set to zero on the balance and use it to...
PART B. HEAT OF SOLUTION REACTION Obtain a sample bottle with an unknown ionic salt. Record its identification let...
PART B. HEAT OF SOLUTION REACTION Obtain a sample bottle with an unknown ionic salt. Record its identification letter. Gently dry the inside of the calorimeter and weigh it. If the calorimeter is not dry, you will not be able to accurately find the mass of water in your calorimeter. Add about 50 mL of distilled water and weigh again. Measure the water's initial temperature. Use a plastic weighing "boat" set to zero on the balance and use it to...
QUESTIONS Why do the crucible and lid need to be cooled before weighing? Be specific. 1....
QUESTIONS Why do the crucible and lid need to be cooled before weighing? Be specific. 1. Assume that you failed to clean some grease off of your crucible before doing the percent water determination. If that grease then burned off during the determi- nation, explain how the percent water you calculated would be affected (i.e., to0 low, too high, no effect). Be specific. 2. Explain how each of the following would affect the percent sulfate you calculated, i.e, too low,...
The second pic is the experiment result. Experiment 1 Determine the Latent heat of fusion for...
The second pic is the experiment result.
Experiment 1 Determine the Latent heat of fusion for ice LU kg) to 3 significant figures using calorimetry and the table below. Note that the shaded cell should be evaluated using your data LAST Equation and then value value value (10s//kg) 2. mice = mwater Equation 1: Construct the conservation of energy equation for heat Q m c ar n c (Trnal-Tinitial) Adding heat to an object can raise its temperature: Adding heat...
Calorimetry Materials: Styrofoam cup & lid Digital thermometer Metal sample Graduated cylinder Beaker Test tube with...
Calorimetry Materials: Styrofoam cup & lid Digital thermometer Metal sample Graduated cylinder Beaker Test tube with stopper Heating setup for beaker Behind a calorimetry experiment is the known occurrence of heat flow from a warm object to a cooler object. Heat scales with the amount of matter and also depends on the resistance of an object to change temperature. Temperature is just the average of the amount of energy contained inside a given area. Heat is represented by the letter...
subject: calorimetry Post Laboratory Questions 1. A student places 138 g of an unknown metal at...
subject: calorimetry
Post Laboratory Questions 1. A student places 138 g of an unknown metal at 99.9°C into 60.00 g of water at 22.2 °C. The entire system reaches a uniform temperature of 31.5 °C. Calculate the specific heat capacity of the metal. 2. If the correct specific heat of the metal in problem 1 is 0.25 J/gºC, calculate the percent crror. 3. While transferring the piece of unknown metal to the calorimeter, the student dropped the metal into the...
E AFTER COMPLETING LAB. ANSWER IN SPACE PROVIDED. Suppose the heat of neutralization had been determined using a glass beaker instead of a polystyrene coffee cup How would the measured value have...
E AFTER COMPLETING LAB. ANSWER IN SPACE PROVIDED. Suppose the heat of neutralization had been determined using a glass beaker instead of a polystyrene coffee cup How would the measured value have been affected? The heat of combustion of octane, C,H,. can be measured in a way similar to the method youC used to measure the heat of neutralization. The bomb calorimeter is used instead of a coffee cup. The reaction is 2C,H,1)+ 25 O, (g) 16 CO, (g) +...
Pre-Lab Questions: Thermochemistry MUST be completed before an experiment is started. Show all work and be...
Pre-Lab Questions: Thermochemistry MUST be completed before an experiment is started. Show all work and be sure to include units. Q What is the difference between heat capacity and specifie heat? What are the units for each? Q2. What is a calorimeter, and why is it used in thermochemistry? Why should you measure the specific h the calorimeter? Q3. What is the sign +or-) of the temperature change for a piece of hot metal when it is placed in cold...
plz try to give all the answers. In the reducing sugar exercise, why do you think...
plz
try to give all the answers.
In the reducing sugar exercise, why do you think the time that the samples are in the hot water bath not exceed two minutes? In the starch exercise, why must you shake the positive control and each of the unknowns before taking a sample of each? 2. 3. What structure, within proteins, does the biuret reagent actually react with when it gets reduced giving positive result? 4. Now that you have completed all...
9 Pre-Lab Questions 1. Why can you use a calorimeter to study the exchange of heat? EXPERIMENT A ...
9 Pre-Lab Questions 1. Why can you use a calorimeter to study the exchange of heat? EXPERIMENT A calorimeier is a device u s eol to measure hot of roactisn th lainer wn th vr meni o insulated wall's to prevent hret exchange he enviran 2. Why is specific heat an intensive property? energy at o particular temperature 'is the some Its 9uanhhy towhich no physical alimen sian is agsian eof Nomaler heuw mach alaminunh, Is abiliy to aborb heat...
PART B. HEAT OF SOLUTION REACTION Obtain a sample bottle with an unknown ionic salt. Record its identification letter. Gently dry the inside of the calorimeter and weigh it. If the calorimeter is not dry, you will not be able to accurately find the mass of water in your calorimeter. Add about 50 mL of distilled water and weigh again. Measure the water's initial temperature. Use a plastic weighing "boat" set to zero on the balance and use it to...
PART B. HEAT OF SOLUTION REACTION Obtain a sample bottle with an unknown ionic salt. Record its identification letter. Gently dry the inside of the calorimeter and weigh it. If the calorimeter is not dry, you will not be able to accurately find the mass of water in your calorimeter. Add about 50 mL of distilled water and weigh again. Measure the water's initial temperature. Use a plastic weighing "boat" set to zero on the balance and use it to...
QUESTIONS Why do the crucible and lid need to be cooled before weighing? Be specific. 1. Assume that you failed to clean some grease off of your crucible before doing the percent water determination. If that grease then burned off during the determi- nation, explain how the percent water you calculated would be affected (i.e., to0 low, too high, no effect). Be specific. 2. Explain how each of the following would affect the percent sulfate you calculated, i.e, too low,...
The second pic is the experiment result.
Experiment 1 Determine the Latent heat of fusion for ice LU kg) to 3 significant figures using calorimetry and the table below. Note that the shaded cell should be evaluated using your data LAST Equation and then value value value (10s//kg) 2. mice = mwater Equation 1: Construct the conservation of energy equation for heat Q m c ar n c (Trnal-Tinitial) Adding heat to an object can raise its temperature: Adding heat...
Calorimetry Materials: Styrofoam cup & lid Digital thermometer Metal sample Graduated cylinder Beaker Test tube with stopper Heating setup for beaker Behind a calorimetry experiment is the known occurrence of heat flow from a warm object to a cooler object. Heat scales with the amount of matter and also depends on the resistance of an object to change temperature. Temperature is just the average of the amount of energy contained inside a given area. Heat is represented by the letter...
subject: calorimetry
Post Laboratory Questions 1. A student places 138 g of an unknown metal at 99.9°C into 60.00 g of water at 22.2 °C. The entire system reaches a uniform temperature of 31.5 °C. Calculate the specific heat capacity of the metal. 2. If the correct specific heat of the metal in problem 1 is 0.25 J/gºC, calculate the percent crror. 3. While transferring the piece of unknown metal to the calorimeter, the student dropped the metal into the...
E AFTER COMPLETING LAB. ANSWER IN SPACE PROVIDED. Suppose the heat of neutralization had been determined using a glass beaker instead of a polystyrene coffee cup How would the measured value have been affected? The heat of combustion of octane, C,H,. can be measured in a way similar to the method youC used to measure the heat of neutralization. The bomb calorimeter is used instead of a coffee cup. The reaction is 2C,H,1)+ 25 O, (g) 16 CO, (g) +...
Pre-Lab Questions: Thermochemistry MUST be completed before an experiment is started. Show all work and be sure to include units. Q What is the difference between heat capacity and specifie heat? What are the units for each? Q2. What is a calorimeter, and why is it used in thermochemistry? Why should you measure the specific h the calorimeter? Q3. What is the sign +or-) of the temperature change for a piece of hot metal when it is placed in cold...
plz
try to give all the answers.
In the reducing sugar exercise, why do you think the time that the samples are in the hot water bath not exceed two minutes? In the starch exercise, why must you shake the positive control and each of the unknowns before taking a sample of each? 2. 3. What structure, within proteins, does the biuret reagent actually react with when it gets reduced giving positive result? 4. Now that you have completed all...
9 Pre-Lab Questions 1. Why can you use a calorimeter to study the exchange of heat? EXPERIMENT A calorimeier is a device u s eol to measure hot of roactisn th lainer wn th vr meni o insulated wall's to prevent hret exchange he enviran 2. Why is specific heat an intensive property? energy at o particular temperature 'is the some Its 9uanhhy towhich no physical alimen sian is agsian eof Nomaler heuw mach alaminunh, Is abiliy to aborb heat...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 29 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago