Methylamine, CH3NH4, is a weak base. A 0.504 M solution of methylamine has equilibrium concentrations of...
Homework Answers
----- CH3NH2(aq) + H2O(l) <> CH3NH3^+(aq) + OH^-(aq)
I ----- 0.504 --------------------------- 0 ------------- 0
C ----- -0.015 ----------------------- +0.015 ------- +0.015
E ------ 0.489------------------------- +0.015 ----- + 0.015
Kb = [CH3NH3^+][OH^-]/[{CH3NH2]
= 0.015*0.015/0.489
= 4.6*10^-4
Add Answer to:
Methylamine, CH3NH4, is a weak base. A 0.504 M solution of
methylamine has equilibrium concentrations of...
Methylamine, CH3NH2, is a weak base and was featured in the TV show Breaking Bad. A...
Methylamine, CH3NH2, is a weak base and was featured in the TV show Breaking Bad. A 0.504 M solution of methylamine has equilibrium concentrations of both CH3NH,* and OH' equal to 0.0150 M. What is the Kb of the base? CH3NH2 (aq) + H20 (1) = CH3NH3* (aq) + OH (aq)
The weak base methylamine, CH3NH2, has Kb= 4.2x10^-4. CH3NH2 + H2O -> CH3NH3+ + OH- Calculate...
The weak base methylamine, CH3NH2, has Kb= 4.2x10^-4. CH3NH2 + H2O -> CH3NH3+ + OH- Calculate the equilibrium hydroxide ion concentration in a 0.95 M solution of the base. [OH-] = What are the pH and pOH of the solution?
A) Calculate the pH of a 0.0116 M aqueous solution of methylamine (CH3NH2, Kb = 4.2×10-4)...
A) Calculate the pH of a 0.0116 M aqueous solution of methylamine (CH3NH2, Kb = 4.2×10-4) and the equilibrium concentrations of the weak base and its conjugate acid. pH = ? [CH3NH2]equilibrium = ? M [CH3NH3+ ]equilibrium = ? M B)Calculate the pH of a 0.0115 M aqueous solution of nitrous acid (HNO2, Ka= 4.6×10-4) and the equilibrium concentrations of the weak acid and its conjugate base. pH = ? [HNO2]equilibrium = ? M [NO2- ]equilibrium = ? M C)...
A) CH3NH2 (methyl amine) is a weak base. Give the correct chemical equation for the aqueous...
A) CH3NH2 (methyl amine) is a weak base. Give the correct chemical equation for the aqueous base dissociation reaction. CH3NH2(aq) + H2O(l) ⇋ CH3NH3+ (aq) + HO−(aq) CH3NH2(aq) + H2O(l) ⇋ CH3NH3+ (aq) + H3O+(aq) CH3NH2(aq) + H3O+(aq) ⇋ CH3NH3+ (aq) + H2O−(l) CH3NH2(aq) + H2O(l) ⇋ CH3NH− (aq) + H3O+(aq) B) What concentration of ammonia is required to have a solution with a pH of 11.23? Kb = 1.8x10-5
Calculate the PH and concentrations of CH3NH2 and CH3NH3+ in a 0.0445M Methylamine (CH3NH2) Calculate the...
Calculate the PH and concentrations of CH3NH2 and CH3NH3+ in a
0.0445M Methylamine (CH3NH2)
Calculate the pH and concentrations of CH3NH2 and CH3NH3 in a 0.0445 M methylamine (CH3NH2) solution. The Kb of CH3NH2-4.47 x10 Number pH11.520 Number CH,NH0.0409 Number CH, NH, |-| | 0.00446
Calculate the pH of a solution consisting of 0.225 M solution of CH3NH2 (methylamine) and 0.200...
Calculate the pH of a solution consisting of 0.225 M solution of CH3NH2 (methylamine) and 0.200 M CH3NH2 tor (methylammonium chloride). Report answer to 2 decimal places. Kb CH3NH2) - 44 x 10-4 CH3NH2 (aq) + H200 + CH3NH3 (2) + OH(aq) Assuming equal initial concentrations of the given species, which of the following is the weakest acid in aqueous solution? O. HB Ky = 2.0 x 10-6 OB.HD K = 6.0 x 10-2 ОС: НЕ Kg = 4.0 x...
A 25.00 mL sample of a 0.250 M aqueous solution CH3NH2 (a weak base) is titrated...
A 25.00 mL sample of a 0.250 M aqueous solution CH3NH2 (a weak base) is titrated with an 0.100 M aqueous solution of HCl (a strong acid.) The molecular and net ionic equation for the reaction is provided below. The Kb value used for CH3NH2 is 4.4x10^-4. Find the pH of the solution after addition of 15.00 mL of the aqueous solution of HCl Molecular: CH3NH2 (aq) + HCl (aq) → CH3NH3+ + Cl— Net ionic: CH3NH2 (aq) + H+ →...
A chemistry graduate student is given 125. mL of a 0.10 M methylamine (CH3NH2 solution. Methylamine...
A chemistry graduate student is given 125. mL of a 0.10 M methylamine (CH3NH2 solution. Methylamine is a weak base with K,-4.4x 10- . what mass of CH3NH3 Br should the student dissolve in the CH3NH2 solution to turn it into a buffer with pH = 10.50? You may assume that the volume of the solution doesn't change when the CH3NH3 Br is dissolved in it. Be sure your answer has a unit symbol, student dissalve in the CH,NH, solution...
A hypothetical weak base has Kg = 5.0 x 108. Calculate the equilibrium concentrations of the...
A hypothetical weak base has Kg = 5.0 x 108. Calculate the equilibrium concentrations of the base, its conjugate acid, and OH in a 0.15 M solution of the base. What is the pH of the solution? [B] = mol/L [HB]= mol/L [OH-] = pH = Submit Show Approach Show Tutor Steps Submit Answer Try Another Version 10 item attempts remaining
Caffeine, C8H10N4O2is a weak base. Determine the value of Kbfor caffeine if a solution at equilibrium...
Caffeine, C8H10N4O2is a weak base. Determine the value of Kbfor caffeine if a solution at equilibrium has [C8H10N4O2] = 0.050M, [C8H10N4O2H+] = 5 x 10-3 M, and [OH-] = 2.5 x 10-3M C8H10N4O2(aq) + H2O(l) ⇌ C8H10N4O2H+(aq) + OH-(aq)
Methylamine, CH3NH2, is a weak base and was featured in the TV show Breaking Bad. A 0.504 M solution of methylamine has equilibrium concentrations of both CH3NH,* and OH' equal to 0.0150 M. What is the Kb of the base? CH3NH2 (aq) + H20 (1) = CH3NH3* (aq) + OH (aq)
Calculate the PH and concentrations of CH3NH2 and CH3NH3+ in a
0.0445M Methylamine (CH3NH2)
Calculate the pH and concentrations of CH3NH2 and CH3NH3 in a 0.0445 M methylamine (CH3NH2) solution. The Kb of CH3NH2-4.47 x10 Number pH11.520 Number CH,NH0.0409 Number CH, NH, |-| | 0.00446
Calculate the pH of a solution consisting of 0.225 M solution of CH3NH2 (methylamine) and 0.200 M CH3NH2 tor (methylammonium chloride). Report answer to 2 decimal places. Kb CH3NH2) - 44 x 10-4 CH3NH2 (aq) + H200 + CH3NH3 (2) + OH(aq) Assuming equal initial concentrations of the given species, which of the following is the weakest acid in aqueous solution? O. HB Ky = 2.0 x 10-6 OB.HD K = 6.0 x 10-2 ОС: НЕ Kg = 4.0 x...
A chemistry graduate student is given 125. mL of a 0.10 M methylamine (CH3NH2 solution. Methylamine is a weak base with K,-4.4x 10- . what mass of CH3NH3 Br should the student dissolve in the CH3NH2 solution to turn it into a buffer with pH = 10.50? You may assume that the volume of the solution doesn't change when the CH3NH3 Br is dissolved in it. Be sure your answer has a unit symbol, student dissalve in the CH,NH, solution...
A hypothetical weak base has Kg = 5.0 x 108. Calculate the equilibrium concentrations of the base, its conjugate acid, and OH in a 0.15 M solution of the base. What is the pH of the solution? [B] = mol/L [HB]= mol/L [OH-] = pH = Submit Show Approach Show Tutor Steps Submit Answer Try Another Version 10 item attempts remaining
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 31 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago