Question 46 What is the major product of the reaction shown below? Pt CH3-CH2-CH=CH2 + H2...

Question

Question

Answer 1

Answer #1

CH₂-CH2-CH=CH2 + H2 C H₂-CH₂-CH2-CHE this is reduction reaction alkene cuill bedure to alkane. As option - is an alkene so, t

Answer 2

Similar Homework Help Questions

Question 7 What is the major product of the reaction shown below? H+ CH3-CH2-CH=CH2 + HOH...

Question 7 What is the major product of the reaction shown below? H+ CH3-CH2-CH=CH2 + HOH A) OH OH CH3 - CH2 -CH-CH2 B) OH | CH3 - CH2 -CH-CH3 OH OH CH3 -CH-CH - CH3 D) OH CH3 - CH2 -C=CH2 Choice A Choice B Choice C Choice D
What is the major product of the reaction shown below? Question 4 What b the major...

What is the major product of the reaction shown below? Question 4 What b the major product of the reacton shown below CH,-CH2-CH-CH2+ HOH → ● CH,-CHI-CH2-CH2CH o CH CH 3-CE-CH.CH3 CH 매3-CH2-c.on CH3 CH2-C CH2 CH3 CH2-CH-CH3 OH OH CH3-CH2-CH CH2
Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3...

Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3 - > ??????? OH Question 47 options: OH CH3-(CH2)3-2-0-CH-CH2-CH3 CH3C(CH3)3-CH CH-(CH3)2 CH3-(CH2)2-2-0-C-(CH3)2 CH3-(CH2) 3-2-0-CH-(CH3)2 CH3CH2CH2CH2OCH2OCH(CH3)2

predict the major product of the following reactions: H2, Pt E CH=CH2 CH3 d2 az но...

predict the major product of the following reactions: H2, Pt E CH=CH2 CH3 d2 az но CH3 Hz Pd CH3 нс н с с н Сн, CHCl3 КОН 1. О, сна, 270, HOẶC
What is the major product of the reaction shown below? он сHz CH-CH2 + нон нь...

What is the major product of the reaction shown below? он сHz CH-CH2 + нон нь Он от сн; - сну сH - сну он CH3-CH2-CH - CH; w CH Cha-CH2-020- он он сну сн сH - сну CH сн; - сH2 с- сну
explain the answer 23. What would be the major organic product of the following reaction? H:C-CH2-CH(CH2...

explain the answer 23. What would be the major organic product of the following reaction? H:C-CH2-CH(CH2 H30. H2SO4 CH نه H3C-CH3-CH CH2-OH CH3 ف H3C-CH2-CH, OHCH CH; ن HỌC-CH2-CH, CH4-OOH CH ا d. H H3C-CH2-CH10 CH CH3

16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br...

16) What is the major product of the following reaction? CH, CH2-C-CH3 + KOH IC Br CH CH2-C-CH3 он CH CH-C=CH2 CH CH-GẠCH он н сна -CH=CH-CH3 CH CH2-CH-CH, OH AI B) II C) III D) IV 17) What is the major product of the following reaction? CH3 e CH3CH20 + CH3CBC - CH 3 A) CH2=CH2 B) СН3 CH3CH20C-CH3 CH3 CH 3C=CH2 CH3 D) A and B E) A and C
What is the major product of the following reaction? CH -CH₂-C- CH2-C-CH3 + KOH Br alcohol...

What is the major product of the following reaction? CH -CH₂-C- CH2-C-CH3 + KOH Br alcohol heat ? сні -CH2-C-CH OH IV. I CH3 -CH-CACH OHH CHE -CH=C-CH3 сн -CH2-C=CH2 II. V. CH3 -CH2-CH-CH2OH TIL A) B) 11 OC) IV D) v
What is the major product of the following reaction? CH3 CH2-C-CH3 + KOH Br ? CH3...

What is the major product of the following reaction? CH3 CH2-C-CH3 + KOH Br ? CH3 CH3 -CH2-C-CH3 -CH-¢- I. IV. OH CH3 -CH2-C=CH2 OH H CH -CH=C-CH3 II. V. CH3 -CH2-CH-CH2OH -CH II. OT OI O III O TV OV

What product is formed by the addition of two H2 molecules to CH2CH-CHCH2? a. CH3-CH2-CH=CH2 b....

What product is formed by the addition of two H2 molecules to CH2CH-CHCH2? a. CH3-CH2-CH=CH2 b. CH3-CH2-CH=CH3 c. CH3-CH2-CH2-CH3 d. CH3-CH2-C=CH