Help! Not sure how to proceed with the 0.5 eq factor, and will
#2 have two alcohol substitutents? Does the different solvent in #3
and different reactant in #4 also matter?
Homework Answers
Add Answer to:
Help! Not sure how to proceed with the 0.5 eq factor, and will
#2 have two...
Predict the Product. Provide the stable organic product(s) for each reaction below 1. NaBH4, CH,OH 2....
Predict the Product. Provide the
stable organic product(s) for each reaction below
1. NaBH4, CH,OH 2. HCI, H20 1. NaBH4 (0.50 eq.), CH3OH 2. HCI, H,0 1. LIAIH4 (1 eq.), THF 2. HCI, H20 1. NaBH(OCH3)3, (1 eq.), CH3OH 2. HCI, H2O
Predict the product. Provide the stable organic product(s) for each reaction. 1. LAIHA (1 eq.), THF...
Predict the product. Provide
the stable organic product(s) for each reaction.
1. LAIHA (1 eq.), THF 2. HCI, H,0 1. NaBH(OCH), (1 eq.), CH, OH 2. HCI, H,0
Predict the Product. Provide the stable organic product(s) for each reaction below. 11:46 PM Tue Oct...
Predict the Product. Provide the stable organic product(s) for
each reaction below.
11:46 PM Tue Oct 29 42% cdn.inst-fs-iad - prod.inscloudgate.net CONCEPT QUESTION Predict the Product. Provide the stable organic product(s) for each reaction below NaBH, CH3ОH 1 2. HСI, H,о NaBHa (1 eq.), CH,он 1 2. НС, Н,0 NaBH(ОCH3)з. (1 еq.), CH,Он 1. 2. HСI, Н,о LIAIH4 (1 eq.), THF 1. 2. HCI, H,о
CONCEPT QUESTION Predict the Product. Provide the stable organic product(s) for each reaction below. CONCEPT QUESTION...
CONCEPT QUESTION Predict the Product. Provide the stable organic
product(s) for each reaction below.
CONCEPT QUESTION Predict the Product Provide the stable organic product(s) for each reaction below. NaBH4, CH,ОH 1 2. HСI, Н,О H NaBHa (0.50 ед.), СH3ОН 1. 2. HCI, Н,о LIAIH4 (1 eq.), THF 1 CI 2. HСI, Н,о NaBH(OCH)з (1 eg), CH,Он 1 2. HСI, Н,0
CONCEPT QUESTION Predict the Product. Provide the stable organic product(s) for each reaction below. CD 1....
CONCEPT QUESTION Predict the Product. Provide the stable organic product(s) for each reaction below. CD 1. NaBH CHOH 1. NaBH CH OH 2 H,0, HCI C) 1. NaBH. CH,OH 2 H,O HC 1. NaBH, CH,OH 1. NaHBIOCH THF 1 equiv) 2. H,O, HCI
CONCEPT QUESTION Predict the Product. Provide the stable organic product(s) for each reaction below. 1. NaBH4,...
CONCEPT QUESTION Predict the Product. Provide the stable organic product(s) for each reaction below. 1. NaBH4, CH3OH 2. HCI, H20 1. NaBHA (0.50 eq.), CH3OH 2. HCI, H2O 1. LiAIHA (1 eq.), THE 2. HCI, H2O 1. NaBH(CH3)3, (1 eq.), CH3OH 2. HCI, H2O
Predict the products, please provide the stable organic product(s) for each reaction. 1. NaBH4, CH3OH 2....
Predict the products, please provide the stable organic
product(s) for each reaction.
1. NaBH4, CH3OH 2. HCI, H20 1. NaBH4 (0.50 eq.), CH3OH 2. HCI, H2O 1. LIAIHA (1 eq.), THE 2. HCI, H2O 1. NaBH(OCH3)3, (1 eq.), CH3OH 2. HCI, H20
predict the product (or reactants) 1. Mg (1 eq). Et20 2. (1 eq) -CHO 3. HCI,...
predict the product (or reactants)
1. Mg (1 eq). Et20 2. (1 eq) -CHO 3. HCI, H2O 1. NaBH4, MeOH, 0°C 2. PBrz. THE 3. LIAID, THE 4. HCI, H20 1. SOCI, NEt3, THF 2. 2 eq Li, hexane CHO 3, HCl, H2O hint multiple steps CH 1. LiAIH, THE 2. HCI, H2O 3. PBr3, THF OH 1. PCC, DCM 2. Mg, Et20 3. HCI, H2O 1. MSCI, pyr 2. KO'Bu, 'BuOH
Predict the (stable organic) products NaBH, CH,оH 1 2. HC, H,о NaBH, (1 eq.), сн,он 1....
Predict the (stable organic) products
NaBH, CH,оH 1 2. HC, H,о NaBH, (1 eq.), сн,он 1. 2. HC, H,о NaBн(осн)» (1 еч.), сн,он 1. 2 HCI, H,о LIAIH (1 eq THF 1. Br 2. HC, H,о
CONCEPT QUESTION Predict the Product. Provide the stable organic product(s) for each reaction below. 1. NaBH4,...
CONCEPT QUESTION Predict the Product. Provide the stable organic product(s) for each reaction below. 1. NaBH4, CH3OH 2. HCI, H20 1. NaBH4 (1 eq.), CH3OH 2. HCI, H2O H 1. NaBH(OCH3)3, (1 eq.), CH3OH 2. HCI, H20 1. LIAIH4 (1 eq.), THE 2. HCI, H2O
Predict the Product. Provide the
stable organic product(s) for each reaction below
1. NaBH4, CH,OH 2. HCI, H20 1. NaBH4 (0.50 eq.), CH3OH 2. HCI, H,0 1. LIAIH4 (1 eq.), THF 2. HCI, H20 1. NaBH(OCH3)3, (1 eq.), CH3OH 2. HCI, H2O
Predict the product. Provide
the stable organic product(s) for each reaction.
1. LAIHA (1 eq.), THF 2. HCI, H,0 1. NaBH(OCH), (1 eq.), CH, OH 2. HCI, H,0
Predict the Product. Provide the stable organic product(s) for
each reaction below.
11:46 PM Tue Oct 29 42% cdn.inst-fs-iad - prod.inscloudgate.net CONCEPT QUESTION Predict the Product. Provide the stable organic product(s) for each reaction below NaBH, CH3ОH 1 2. HСI, H,о NaBHa (1 eq.), CH,он 1 2. НС, Н,0 NaBH(ОCH3)з. (1 еq.), CH,Он 1. 2. HСI, Н,о LIAIH4 (1 eq.), THF 1. 2. HCI, H,о
CONCEPT QUESTION Predict the Product. Provide the stable organic
product(s) for each reaction below.
CONCEPT QUESTION Predict the Product Provide the stable organic product(s) for each reaction below. NaBH4, CH,ОH 1 2. HСI, Н,О H NaBHa (0.50 ед.), СH3ОН 1. 2. HCI, Н,о LIAIH4 (1 eq.), THF 1 CI 2. HСI, Н,о NaBH(OCH)з (1 eg), CH,Он 1 2. HСI, Н,0
CONCEPT QUESTION Predict the Product. Provide the stable organic product(s) for each reaction below. CD 1. NaBH CHOH 1. NaBH CH OH 2 H,0, HCI C) 1. NaBH. CH,OH 2 H,O HC 1. NaBH, CH,OH 1. NaHBIOCH THF 1 equiv) 2. H,O, HCI
CONCEPT QUESTION Predict the Product. Provide the stable organic product(s) for each reaction below. 1. NaBH4, CH3OH 2. HCI, H20 1. NaBHA (0.50 eq.), CH3OH 2. HCI, H2O 1. LiAIHA (1 eq.), THE 2. HCI, H2O 1. NaBH(CH3)3, (1 eq.), CH3OH 2. HCI, H2O
Predict the products, please provide the stable organic
product(s) for each reaction.
1. NaBH4, CH3OH 2. HCI, H20 1. NaBH4 (0.50 eq.), CH3OH 2. HCI, H2O 1. LIAIHA (1 eq.), THE 2. HCI, H2O 1. NaBH(OCH3)3, (1 eq.), CH3OH 2. HCI, H20
predict the product (or reactants)
1. Mg (1 eq). Et20 2. (1 eq) -CHO 3. HCI, H2O 1. NaBH4, MeOH, 0°C 2. PBrz. THE 3. LIAID, THE 4. HCI, H20 1. SOCI, NEt3, THF 2. 2 eq Li, hexane CHO 3, HCl, H2O hint multiple steps CH 1. LiAIH, THE 2. HCI, H2O 3. PBr3, THF OH 1. PCC, DCM 2. Mg, Et20 3. HCI, H2O 1. MSCI, pyr 2. KO'Bu, 'BuOH
Predict the (stable organic) products
NaBH, CH,оH 1 2. HC, H,о NaBH, (1 eq.), сн,он 1. 2. HC, H,о NaBн(осн)» (1 еч.), сн,он 1. 2 HCI, H,о LIAIH (1 eq THF 1. Br 2. HC, H,о
CONCEPT QUESTION Predict the Product. Provide the stable organic product(s) for each reaction below. 1. NaBH4, CH3OH 2. HCI, H20 1. NaBH4 (1 eq.), CH3OH 2. HCI, H2O H 1. NaBH(OCH3)3, (1 eq.), CH3OH 2. HCI, H20 1. LIAIH4 (1 eq.), THE 2. HCI, H2O
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 1 minute ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 24 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago