Write the net ionic equation for the following chemical reaction. (Use the lowest possible coefficients. Do...
Balancing Equations Balance the following chemical equations. Sicla(l)+ SiO (s)HCl(aq) 2. As 3 NaOH NaOH H2 3. Ha Au + н,s но-> voC+ H20 5. -Hg(OH)2 + H3PO4 H20 SiO2 + HF→ SiF4 + -ho 7. 2 Zn Ha → ZnClz + H2 8. HCIO4 02(g)HO HNOs(aq) NH4NO3 ut Chemistry http://chemistry.about.com Balancing Equations Balance the following chemical equations но 2. cr→ Naa 3.4 A1 +302 -Al2O3 NH3 5. CO(g) + HO 6. FeO3(s) +-- CO(g) → Fel)+ CO2(9) 7. HSO_...
16) Write a balanced net ionic equation for the reaction of H2SO4iag) with Ba(OH)2(g) A) Ba2+(ag) + SO42-(a)- BaSO4) B) 2 H+(aq) SO42-(a) Ba2 (ag) +2 OH-(a)-BaSO4(0 2 H20) C) H2SO4(a) + Ba(OH)2(e) - BaSO40) 2 H20() D) H (ag) OH(ag)--H2O) 16) 17) Write a balanced net ionic equation for the reaction of Pb(NO3)2(ag) with Nal(ag). A) Pb2 (ag)+2 NO3-(4g) +2 Na+ (ag) +2 1-(a4)-- Pb2+(ag)+ 2 1-(a4)+ 2 Na (a) +2 NO3-(a) B) Pb2+(ag) 2 NO3-(a) + 2 Na...
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...
Write balanced net ionic equation for the following reaction: Fe(OH)3(s)+H2SO4(aq)→? Express your answer as a chemical equation. Identify all of the phases in your answer. Write balanced net ionic equation for the following reaction: HClO3(aq)+NaOH(aq)→? Note that HClO3 is a strong acid. Express your answer as a chemical equation. Identify all of the phases in your answer.
RTILLİpoints.coch)Pleasesiwwalluusrwwrk I. Write a complete ionic and net-ionic equation for the following reaction. CuCl(aq)+ Pb(s) hat volume( ml) of 0.1 15 M HCIO. solution is required to neutralize 50.00 ml of 0.0875 M b) A solution conta Ca(OH)2? ins 3.2 g NaOH (MW -40) in 20.0 ml of solution. What is the molarity of the solution? 3. A 170.0-g sample of metal at 78.0°C is added to 170.0 g of H20) at lsrc in an insulated container. temperature rises to...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of whole numbers? __Cas(PO4h + H2SO4 - Caso + HPO. A) 3 B) 8 C) 10 D) 11 2) What is the coefficient of H20 when the following equation is properly balanced with smallest set of whole numbers? ALC + H2O - AM(OH), + CHE A) 3 B) 4 C) 6 D) 12 E) 24 3) of the reactions below, which one is...