How to determine the H3O+ of the buffer solution made by mixing two solutions? Given volume...
How to determine the H3O+ of the buffer solution made by mixing two solutions? Given volume and concentration for both and the pKa.
For example, mixing 6.4 mL of 1.3 M acetic acid and 3.6 mL of 0.85 M sodium acetate. The pKa for the acetic acid being 4.8.
Homework Answers
The number of millimoles of acetic acid = molarity*
volume in mL = 1.3*6.4 = 8.32 mmoles
The number of millimoles of sodium acetate
= 0.85*3.6 = 3.06
mmoles
pH of acidic buffer = pKa + log(CH3COONa/ CH3COOH)
= 4.8 + log(3.06/8.32) = 4.37
But, pH = -log(H3O+) = 4.37
Therefore, the concentration of H3O+ ion, [H3O+] = 4.27*10^-5 M
Add Answer to:
How to determine the H3O+ of the buffer solution made by mixing
two solutions? Given volume...
You need to prepare 900 mL of a 0.25 M acetate buffer solution with a pH...
You need to prepare 900 mL of a 0.25 M acetate buffer solution with a pH of 4.3 a. Determine the concentration of both the acetate (conjugate base) and acetic acid (weak acid) in this solution. b. If you made the solution above using solid sodium acetate and liquid acetic acid, what mass of sodium acetate is required and what volume of glacial acetic acid is required?
Calculate the pH of a buffer solution prepared by mixing 75 mL of 1.0 M lactic...
Calculate the pH of a buffer solution prepared by mixing 75 mL of 1.0 M lactic acid and 25 mL of a 1.0M sodium lactate. (pka of lactic acid = 3.86) Calculate the change in pH that occurs when 0.01moles of OH are added to a 1L buffered solution that contains 0.5M acetic acid (HC_2H_3O_2) and 0.5M acetate ion (C_2H_3O_2). Acetic acid pka = 4.76.
The acetic acid/acetate buffer system is a common buffer used in the laboratory.
The acetic acid/acetate buffer system is a common buffer used in the laboratory. Write the equilibrium equation for the acetic acid/acetate buffer system. The formula of acetic acid is CH3CO2H. equilibrium equation: Which way does the equilibrium shift if more H3O+ is added? The equilibrium will not change. The equilibrium will shift to the left. The equilibrium will shift to the right. Which way does the equilibrium shift if more OH- is added? The equilibrium will shift to the right. The equilibrium will shift to the left. The equilibrium will...
D. Buffers 1. A buffer solution was made by dissolving 10.0 grams of sodium acetate in...
D. Buffers 1. A buffer solution was made by dissolving 10.0 grams of sodium acetate in 200.0 mL of 1.50 M acetic acid. Assuming the change in volume when the sodium acetate is added is not significant, estimate the pH of the acetic acid/sodium acetate buffer solution. The K, for acetic acid is 1.8 x 105. 2. Calculate the pH of a buffer solution that initially consists of 0.0400 moles of ammonia and 0.0250 moles of ammonium ion, after 20.0...
Calculate the pH of the following solutions 1. A solution that is 6.0×10−2 M in potassium...
Calculate the pH of the following solutions 1. A solution that is 6.0×10−2 M in potassium propionate (C2H5COOK or KC3H5O2 ) and 8.5×10−2 M in propionic acid (C2H5COOH or HC3H5O2 ). The Ka of propionic acid is 1.3×10-5. 2. A solution that is 8.0×10−2 M in trimethylamine, (CH3)3N, and 0.12 M in trimethylammonium chloride, (CH3)3NHCl. The Kb of trimethylamine is 6.4×10-5. 3. A solution that is made by mixing 50.0 mL of 0.16 M acetic acid and 50.0 mL of...
Suppose you are given solutions of 1.00 M acetic acid and 1.00 M sodium acetate and...
Suppose you are given solutions of 1.00 M acetic acid and 1.00 M sodium acetate and are asked to make 100.00 mL of buffer at pH 5.00 using only these two solutions. What volume, in milliliters, of acid would you need? The pKa of acetic acid is 4.75
Key Ouestion #2: Determine the initial concentrations for the following solutions. Solution Preparation Acetic Acid Acetate...
Key Ouestion #2: Determine the initial concentrations for the following solutions. Solution Preparation Acetic Acid Acetate Ion Concentration Concentration Solution #1 50.0 mL of 0.0500 M acetic acid and 0.205 grams of sodium acetate Solution #2 25.0 mL of 0.0500 M acetic acid, 25.0 mL of deionized water, and 0.205 grams of sodium acetate 50.0 mL of 0.0500 M acetic acid and 0.102 grams of sodium acetate Solution #3 Solution # 4 50.0 mL of 0.0500 M acetic acid Solution...
1) Calculate the pH of the 1L buffer composed of 500 mL of 0.60 M acetic...
1) Calculate the pH of the 1L buffer composed of 500 mL of 0.60 M acetic acid plus 500 mL of 0.60 M sodium acetate, after 0.010 mol of HCl is added (Ka HC2H3O2 = 1.75 x 10-5). Report your answer to the hundredths place. 2) Calculate the pH of the 1L buffer composed of 500 mL 0.60 M acetic acid plus 500 mL of 0.60 M sodium acetate, after 0.010 mol of NaOH is added (Ka HC2H3O2 = 1.75...
1. Determine the number of moles of reagent in the following solutions: a. 25.00 mL of...
1. Determine the number of moles of reagent in the following solutions: a. 25.00 mL of 0.10 M acetic acid b. 5.55 mL of 0.092 M NaOH C. 0.50 mL of 0.087 M HCI 2. A buffer solution contains 0.120 M acetic acid and 0.150 M sodium acetate. a. How many moles of acetic acid and of sodium acetate are present in 50.0 mL of solution? b. If we add 5.55 mL of 0.092 M NaOH to the solution in...
3. One liter of buffer solution was prepared by mixing 0.1 mole of acetic acid CH3COOH...
3. One liter of buffer solution was prepared by mixing 0.1 mole of acetic acid CH3COOH and 0.05 mole of sodium acetate CH3COONa. Calculate a. pH of that solution b. How much of a strong base, say NaOH, in mol/L needs to be added to that solution to change its pH to 6.0? Notes and useful data: For acetic acid pK4.75 For carbonic acid pKa 6.3 and pKa 10.3 Sodium acetate CH3COONa dissociates entirely to Na'CH3COO
Calculate the pH of a buffer solution prepared by mixing 75 mL of 1.0 M lactic acid and 25 mL of a 1.0M sodium lactate. (pka of lactic acid = 3.86) Calculate the change in pH that occurs when 0.01moles of OH are added to a 1L buffered solution that contains 0.5M acetic acid (HC_2H_3O_2) and 0.5M acetate ion (C_2H_3O_2). Acetic acid pka = 4.76.
D. Buffers 1. A buffer solution was made by dissolving 10.0 grams of sodium acetate in 200.0 mL of 1.50 M acetic acid. Assuming the change in volume when the sodium acetate is added is not significant, estimate the pH of the acetic acid/sodium acetate buffer solution. The K, for acetic acid is 1.8 x 105. 2. Calculate the pH of a buffer solution that initially consists of 0.0400 moles of ammonia and 0.0250 moles of ammonium ion, after 20.0...
Key Ouestion #2: Determine the initial concentrations for the following solutions. Solution Preparation Acetic Acid Acetate Ion Concentration Concentration Solution #1 50.0 mL of 0.0500 M acetic acid and 0.205 grams of sodium acetate Solution #2 25.0 mL of 0.0500 M acetic acid, 25.0 mL of deionized water, and 0.205 grams of sodium acetate 50.0 mL of 0.0500 M acetic acid and 0.102 grams of sodium acetate Solution #3 Solution # 4 50.0 mL of 0.0500 M acetic acid Solution...
1. Determine the number of moles of reagent in the following solutions: a. 25.00 mL of 0.10 M acetic acid b. 5.55 mL of 0.092 M NaOH C. 0.50 mL of 0.087 M HCI 2. A buffer solution contains 0.120 M acetic acid and 0.150 M sodium acetate. a. How many moles of acetic acid and of sodium acetate are present in 50.0 mL of solution? b. If we add 5.55 mL of 0.092 M NaOH to the solution in...
3. One liter of buffer solution was prepared by mixing 0.1 mole of acetic acid CH3COOH and 0.05 mole of sodium acetate CH3COONa. Calculate a. pH of that solution b. How much of a strong base, say NaOH, in mol/L needs to be added to that solution to change its pH to 6.0? Notes and useful data: For acetic acid pK4.75 For carbonic acid pKa 6.3 and pKa 10.3 Sodium acetate CH3COONa dissociates entirely to Na'CH3COO
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 45 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago