Homework Answers
AS we know that hydrogen bond is an interaction between Hydrogen and electronegative atom such as O,N F. Hydrogen bonding affects the properties of molecules such as high and low boiling point, solubility and so on.
In alcohols there is OH group due to which alcohols do hydrogen bonding that too extensive because of more electronegative O atom and this property also leads to solubility of alcohols in water, high boiling point etc in case of thiols there is SH group instead of OH group S is less electronegative than O anf thiols are less soluble in water
so all the options given in question explains the difference
Add Answer to:
Which of the following explains the fact that there is extensive hydrogen bonding in alcohols but...
-give reasone SH bond is less polar than OH bond. Hydrogen bonding is much weakerin thiols...
-give reasone SH bond is less polar than OH bond. Hydrogen bonding is much weakerin thiols than in alcohols. 2. Thiols are less soluble in water than alcohols. Thiols have low boiling points than alcohols
The graph below shows the boiling points of four hydrogen containing compounds. 120 100 80 40...
The graph below shows the boiling points of four hydrogen containing compounds. 120 100 80 40 Temperature (°C) 20 0 -20 40 60 -80 HO HS H, SC Н.Те What type of intermolecular forces explains the large difference between boiling points of water, H2O, and the other hydrogen containing compounds? O hydrogen bonding O dispersion forces O covalent bonding O ionic bonding
10. (8 pts) Oxygen, sulfur and selenium are in the same column of the periodic table....
10. (8 pts) Oxygen, sulfur and selenium are in the same column of the periodic table. One sitting under each other in the order listed. All reaction with two hydrogen atoms to form a stable compound H2Se has a higher boiling point than H2S. It is also heavier. Explain how this does (or doesn't) make sense. What explains the fact that water, H O, has a higher boiling point than hydrogen sulfide, H2S, which is heavier
1.The addition of hydrogen to an organic compound or the loss of oxygen is called 1)...
1.The addition of hydrogen to an organic compound or the loss of oxygen is called 1) reduction. 2) oxidation. 3) dehydration. 4) halogenation. 5) hydration. Question 2 The carbonyl group does not have a dipole. 1) True 2) False Question 3 How many hydrogen atoms is the carbonyl group in a ketone bonded to? Question 3 options: 1) none 2) one 3) two 4) three 5) four Question 5 The increased boiling point of ketones compared to alkanes and ethers...
Identify the strongest intermolecular force in the compound KHSO4 O lonic forces Dipole-dipole Hydrogen bonding O...
Identify the strongest intermolecular force in the compound KHSO4 O lonic forces Dipole-dipole Hydrogen bonding O lon-dipole London dispersion forces Question 23 1.5 pts What intermolecular force or bond is responsible for the density of solid water (ice) being less than that of liquid water? O London dispersion forces Olonic bonding O Covalent bonding O Dipole-dipole forces Hydrogen bonding In which of the following molecules and ions does the central carbon atom or sulfur atom have sp hybridization: Cl,CO, SO32-,...
Part A H,0 (100°C) has a higher boiling point than CH, OH (65°C). There are more...
Part A H,0 (100°C) has a higher boiling point than CH, OH (65°C). There are more hydrogen bonds between water molecules than between alcohol molecules. There are less hydrogen bonds between water molecules than between alcohol molecules. CH, OH has the higher molecular mass than H,O. There are no hydrogen bonds between alcohol molecules while there are plenty of them between water molecules. O Submit Previous Answers Request Answer X Incorrect; Try Again; 2 attempts remaining Part B H,O (100°C)...
Which of the following compounds shows an abnormal boiling point because of hydrogen bonding? CH_3NH_2 CH_3OCH_3...
Which of the following compounds shows an abnormal boiling point because of hydrogen bonding? CH_3NH_2 CH_3OCH_3 CH_3OCH_3 CH_3SH CH_3Cl HCI of the following substances, which is expected to have the highest critical temperature CH_3OH CH_3Cl CH_4 C_2H_6 C_3H_s If heat is added to ice and liquid water in a closed container and, after the addition of the heat, ice and liquid water remain, the vapor pressure of the water will decrease. the temperature will increase somewhat. the temperature will decrease...
For which of the following molecules is hydrogen bonding NOT possible? ОА H2O OB. All of...
For which of the following molecules is hydrogen bonding NOT possible? ОА H2O OB. All of these can hydrogen bond OC NH OD OEHF ♡ QUESTION 2 + + HCO31 H20 coz 2 H30* What role is water playing in the acid-base chemical reaction above? O A BASE OB CONJGATE BASE OC.CONJUGATE ACID D. ACID QUESTION 3 At room temperature, water is a liquid while methane is a gas. Which statement compares the intermolecular forces in these molecules correctly? O...
Which of the following is a characteristic of aldehydes? Select all that apply: a. Aldehydes contain...
Which of the following is a characteristic of aldehydes? Select all that apply: a. Aldehydes contain an oxygen atom. b. Aldehydes have lower boiling points than the corresponding alkanes. c. Aldehydes contain an oxygen atom bound directly to a hydrogen atom. d. The carbonyl group in an aldehyde must be attached to a hydrogen atom.
Which of the following statements best explains the pKa difference between cyclohexanol and phenol? How are...
Which of the following statements best explains the pKa
difference between cyclohexanol and phenol?
How are the following compounds related?
Which reagents are needed to convert 1-octyne to 2-octanone?
6. Which of the following statements best explains the pKa difference between cyclohexanol and phenol? a. cyclohexanol has a lower pka than phenol because spoxygens anions are more stable than sp2 oxygen anions. b. phenol has a higher pka than cyclohexanol because the conjugate base is resonance stabilized C. cyclohexanol has...
-give reasone SH bond is less polar than OH bond. Hydrogen bonding is much weakerin thiols than in alcohols. 2. Thiols are less soluble in water than alcohols. Thiols have low boiling points than alcohols
The graph below shows the boiling points of four hydrogen containing compounds. 120 100 80 40 Temperature (°C) 20 0 -20 40 60 -80 HO HS H, SC Н.Те What type of intermolecular forces explains the large difference between boiling points of water, H2O, and the other hydrogen containing compounds? O hydrogen bonding O dispersion forces O covalent bonding O ionic bonding
10. (8 pts) Oxygen, sulfur and selenium are in the same column of the periodic table. One sitting under each other in the order listed. All reaction with two hydrogen atoms to form a stable compound H2Se has a higher boiling point than H2S. It is also heavier. Explain how this does (or doesn't) make sense. What explains the fact that water, H O, has a higher boiling point than hydrogen sulfide, H2S, which is heavier
Identify the strongest intermolecular force in the compound KHSO4 O lonic forces Dipole-dipole Hydrogen bonding O lon-dipole London dispersion forces Question 23 1.5 pts What intermolecular force or bond is responsible for the density of solid water (ice) being less than that of liquid water? O London dispersion forces Olonic bonding O Covalent bonding O Dipole-dipole forces Hydrogen bonding In which of the following molecules and ions does the central carbon atom or sulfur atom have sp hybridization: Cl,CO, SO32-,...
Part A H,0 (100°C) has a higher boiling point than CH, OH (65°C). There are more hydrogen bonds between water molecules than between alcohol molecules. There are less hydrogen bonds between water molecules than between alcohol molecules. CH, OH has the higher molecular mass than H,O. There are no hydrogen bonds between alcohol molecules while there are plenty of them between water molecules. O Submit Previous Answers Request Answer X Incorrect; Try Again; 2 attempts remaining Part B H,O (100°C)...
Which of the following compounds shows an abnormal boiling point because of hydrogen bonding? CH_3NH_2 CH_3OCH_3 CH_3OCH_3 CH_3SH CH_3Cl HCI of the following substances, which is expected to have the highest critical temperature CH_3OH CH_3Cl CH_4 C_2H_6 C_3H_s If heat is added to ice and liquid water in a closed container and, after the addition of the heat, ice and liquid water remain, the vapor pressure of the water will decrease. the temperature will increase somewhat. the temperature will decrease...
For which of the following molecules is hydrogen bonding NOT possible? ОА H2O OB. All of these can hydrogen bond OC NH OD OEHF ♡ QUESTION 2 + + HCO31 H20 coz 2 H30* What role is water playing in the acid-base chemical reaction above? O A BASE OB CONJGATE BASE OC.CONJUGATE ACID D. ACID QUESTION 3 At room temperature, water is a liquid while methane is a gas. Which statement compares the intermolecular forces in these molecules correctly? O...
Which of the following statements best explains the pKa
difference between cyclohexanol and phenol?
How are the following compounds related?
Which reagents are needed to convert 1-octyne to 2-octanone?
6. Which of the following statements best explains the pKa difference between cyclohexanol and phenol? a. cyclohexanol has a lower pka than phenol because spoxygens anions are more stable than sp2 oxygen anions. b. phenol has a higher pka than cyclohexanol because the conjugate base is resonance stabilized C. cyclohexanol has...
Most questions answered within 3 hours.
-
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 4 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 5 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 18 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago