Homework Answers
![®» [kzso41 - ошн, 42504 - анso- e o-1xto 3 рн7 = 2+o 1 хіб ч рі: - Cotu 17 ? - la (450-1 xio ) - зат 6) ГН 64 ] = 0:14 : [#](http://img.homeworklib.com/questions/5830b350-7284-11ea-8711-6747c8ce6a00.png?x-oss-process=image/resize,w_560)
Add Answer to:
2. Acid-Base Calculations (30 points total, 10 points/each) Partial credit will be given for (1) MB,...
10) Given the towing chemical 2 K 3 K 2 K K - 2 C CE...
10) Given the towing chemical 2 K 3 K 2 K K - 2 C CE 2 Cb KCL 4 KC 2 KC KC d 2 C e the only one equation above that com Based on your selected equation above determine how many m o hon gas Cb will react with a total of 6.0 mots of potassium Korce your 6.0 moles Cla 3.0 moles Cl 20 mois Cle 40 mole Cb c Circle the type of reaction regarding...
please help with this question. Extra credit Homework on Acid-Base Titration You can use the technique...
please help with this question.
Extra credit Homework on Acid-Base Titration You can use the technique of titration to determine the concentration of a mixture of sodium carbonate and sodium bicarbonate. Titration is performed using a solution with a known concentration of hydrochloric acid (HCI). During the titration, HCl reduces gradually the alkalinity of the solution until the pH is acid. The reaction occurs in two stages in the first part you titrate the total amount of carbonates present in...
Calculations The following calculations are necessary to complete your Report Sheet. Consult the table on page...
Calculations The following calculations are necessary to complete your Report Sheet. Consult the table on page 119 for appropriate K and K, values. Complete these calculations on your Report Sheet for complete credit. I. pH of Strong and Weak Acids 1. Calculate the pH of a 0.10 M hydrochloric acid solution, HCl(aq). 2. Calculate the pH of a solution prepared by diluting 5.00 mL of 0.10 M hydrochloric acid, HCl (aq), in enough water to make a 50.0 mL solution....
2. Answer the following questions about phosphoric acid (H3PO4). a. (2 points) What color will a...
2. Answer the following questions about phosphoric acid (H3PO4). a. (2 points) What color will a 0.1 M solution of H3PO4 turn blue litmus paper? b. (2 points) What color will a 0.1 M solution of H3PO4 turn red litmus paper? c. (2 points) What color will phenolphthalein be in a 0.1 M solution of H,POA? d. (5 points) Write an equation for the reaction that takes place when phosphoric acid is added to water e. (4 points) What is...
with at least 10 data points choose a weak acid (such as formic acid, acetic acid,...
with at least 10 data points
choose a weak acid (such as formic acid, acetic acid, benzoic acid) and calculate/plot a titration curve for a 0.1 M solution of this acid with strong base using Excel. Do the same for a weak base (ammonia, TRIS) titrated with strong acid Prepare a titration curve (pH vs. equivalents strong base added if you choose a weak acid to be titrated) in which you plot at least 10 data points starting from 0-equiv...
multi photo exp # on last photo Acid-Base Properties of Salt Solutions Worksheet 1. What is...
multi photo exp # on last photo
Acid-Base Properties of Salt Solutions Worksheet 1. What is a salt? How is it formed? 2. What is pK, and what does it represent? How does this value correspond to the strength of an acid? 3. What is pK, and what does it represent? How does this value correspond to the strength of a base? 4. How is pH affected by the concentration of a solution? 5. What does Kw represent? How is...
Acid & Base 1. Follow the acid & base experiment procedure and answer the following questions 2- Watch t...
Acid & Base 1. Follow the acid & base experiment procedure and answer the following questions 2- Watch the atom viewer for sodium hydroxide and hydrochloric acid then write what you observe. 3. Is sodium hydroxide acid or base and why? 4- Is hydrochloric acid or base and why? 5. Write the dissociation reaction for sodium hydroxide and for hydrochloric acid. 6- What is Unknown Solution 2 in the experiment represents acid or base and why? 7- Write the name...
Post Lab Activity Acids, Bases, pH, and Buffers 1. Calculate the pH of a 0.08 M NaOH solution. 2. Hydrochloric acid...
Post Lab Activity Acids, Bases, pH, and Buffers 1. Calculate the pH of a 0.08 M NaOH solution. 2. Hydrochloric acid is a strong acid and dissociate almost 100% in aqueous solution. If two drops (0.1 mL) of 1.0 MHCI are added to pure water to make 1.0 L solution. What is the pH of this solution? 3. M. What will be the A dilute solution of hydrochloric acid (HCI) has a concentration of 0.1 pH of this solution? 4....
Question 1 (2 points) The relationship between a weak acid and its conjugate base at the...
Question 1 (2 points) The relationship between a weak acid and its conjugate base at the 1/2 neutralization point is: the weak acid's concentration is greater than the conjugate base concentration. the weak acid's concentration is less than the conjugate base's concentration the weak acid's concentration is 1/2 the concentration of the conjugate base's concentration the weak acid and conjugate base have the same concentration. Question 2 (3 points) ✓ Saved The pka of acid is 4.8. Determine the acid's...
(1 point) a) Calculate the pH of the following solutions of weak acids: i) 0.095 M...
(1 point) a) Calculate the pH of the following solutions of weak acids: i) 0.095 M propionic acid, K. = 1.3*10% ii) 0.0085 M phenol, K. = 1.3*100 b) Calculate the pH of 0.1 M sulfuric acid, being a strong acid for giving away the first H', and K, for the second step is 1.2*10? (2 points) c) Calculate the pH of a 0.1 M aqueous solution of NaCN. NaOH is a strong base, while the K. of HCN is...
10) Given the towing chemical 2 K 3 K 2 K K - 2 C CE 2 Cb KCL 4 KC 2 KC KC d 2 C e the only one equation above that com Based on your selected equation above determine how many m o hon gas Cb will react with a total of 6.0 mots of potassium Korce your 6.0 moles Cla 3.0 moles Cl 20 mois Cle 40 mole Cb c Circle the type of reaction regarding...
please help with this question.
Extra credit Homework on Acid-Base Titration You can use the technique of titration to determine the concentration of a mixture of sodium carbonate and sodium bicarbonate. Titration is performed using a solution with a known concentration of hydrochloric acid (HCI). During the titration, HCl reduces gradually the alkalinity of the solution until the pH is acid. The reaction occurs in two stages in the first part you titrate the total amount of carbonates present in...
Calculations The following calculations are necessary to complete your Report Sheet. Consult the table on page 119 for appropriate K and K, values. Complete these calculations on your Report Sheet for complete credit. I. pH of Strong and Weak Acids 1. Calculate the pH of a 0.10 M hydrochloric acid solution, HCl(aq). 2. Calculate the pH of a solution prepared by diluting 5.00 mL of 0.10 M hydrochloric acid, HCl (aq), in enough water to make a 50.0 mL solution....
2. Answer the following questions about phosphoric acid (H3PO4). a. (2 points) What color will a 0.1 M solution of H3PO4 turn blue litmus paper? b. (2 points) What color will a 0.1 M solution of H3PO4 turn red litmus paper? c. (2 points) What color will phenolphthalein be in a 0.1 M solution of H,POA? d. (5 points) Write an equation for the reaction that takes place when phosphoric acid is added to water e. (4 points) What is...
with at least 10 data points
choose a weak acid (such as formic acid, acetic acid, benzoic acid) and calculate/plot a titration curve for a 0.1 M solution of this acid with strong base using Excel. Do the same for a weak base (ammonia, TRIS) titrated with strong acid Prepare a titration curve (pH vs. equivalents strong base added if you choose a weak acid to be titrated) in which you plot at least 10 data points starting from 0-equiv...
multi photo exp # on last photo
Acid-Base Properties of Salt Solutions Worksheet 1. What is a salt? How is it formed? 2. What is pK, and what does it represent? How does this value correspond to the strength of an acid? 3. What is pK, and what does it represent? How does this value correspond to the strength of a base? 4. How is pH affected by the concentration of a solution? 5. What does Kw represent? How is...
Acid & Base 1. Follow the acid & base experiment procedure and answer the following questions 2- Watch the atom viewer for sodium hydroxide and hydrochloric acid then write what you observe. 3. Is sodium hydroxide acid or base and why? 4- Is hydrochloric acid or base and why? 5. Write the dissociation reaction for sodium hydroxide and for hydrochloric acid. 6- What is Unknown Solution 2 in the experiment represents acid or base and why? 7- Write the name...
Post Lab Activity Acids, Bases, pH, and Buffers 1. Calculate the pH of a 0.08 M NaOH solution. 2. Hydrochloric acid is a strong acid and dissociate almost 100% in aqueous solution. If two drops (0.1 mL) of 1.0 MHCI are added to pure water to make 1.0 L solution. What is the pH of this solution? 3. M. What will be the A dilute solution of hydrochloric acid (HCI) has a concentration of 0.1 pH of this solution? 4....
Question 1 (2 points) The relationship between a weak acid and its conjugate base at the 1/2 neutralization point is: the weak acid's concentration is greater than the conjugate base concentration. the weak acid's concentration is less than the conjugate base's concentration the weak acid's concentration is 1/2 the concentration of the conjugate base's concentration the weak acid and conjugate base have the same concentration. Question 2 (3 points) ✓ Saved The pka of acid is 4.8. Determine the acid's...
(1 point) a) Calculate the pH of the following solutions of weak acids: i) 0.095 M propionic acid, K. = 1.3*10% ii) 0.0085 M phenol, K. = 1.3*100 b) Calculate the pH of 0.1 M sulfuric acid, being a strong acid for giving away the first H', and K, for the second step is 1.2*10? (2 points) c) Calculate the pH of a 0.1 M aqueous solution of NaCN. NaOH is a strong base, while the K. of HCN is...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 6 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago