Homework Answers
2-a -activity series of metal is a series in which metal listed in decreasing order of its ability to replace hydrogen from acid and it's solution.
b- the metal placed at top will have highest oxidising power , it will oxidised the metal which are below it or will displace the metal from its solution
Add Answer to:
2. a) Define the meaning of the term "activity series of metals. murals rov in order...
Relative Reactivity of Metals and the Activity Series Post Lab Questions You observed the relative reactivity...
Relative Reactivity of Metals and the Activity Series Post Lab Questions You observed the relative reactivity of the following metals. a. Hg reacts with HNO, but not with HCl, hot or cold water. b. Al reacts slowly with hot (100 °C) water. c. Sr reacts with cold water. d. Cd reacts with HCI but not with hot or cold water. Write the mini-activity series (left to right) for these 4 metals (most active on right), least active most active Indicate...
2. a) Define the meaning of the term "activity series" of metals b) How does it...
2. a) Define the meaning of the term "activity series" of metals b) How does it relate to oxidation? 3. Define "chemical periodicity" and use metallic properties as an example, 141 Relative Reactivity of Metals and we 4. List the changes that you will observe to indicate that a reaction all observe to indicate that a reaction has occurred. Peranapan 5. Write the equation for each of the following renctions. Construct a minature activity series listing lead, zinc, hydrogen, potassium...
ume cemse chemse An ul ir tasle Write the equation for each of the following reactions....
ume cemse chemse An ul ir tasle Write the equation for each of the following reactions. Construct a minature activity series listing lead, zinc, hydrogen, potassium and silver in order of decreasing activ- ity. a. Zinc will react with Pb ions to form lead metal and Zn but Pb ions willl not react with silver metal. 5. b. Both zine metal and lead metal will react with the H'(aq) from HCl to form hydrogen gas and Zn. Lead reacts with...
2. List a series of tests that would determine the order of activity (least active to...
2. List a series of tests that would determine the order of activity (least active to most active) for the following metals: Zn, Mn, and Ag. custom page 93
2. List a series of tests that would determine the order of activity (least active to...
2. List a series of tests that would determine the order of activity (least active to most active) for the following metals: Zn, Mn, and Ag. Znis) Mn Cla AgNo3 Znis) Ag No3 Mnus)+ Mhis) +2n INO3)
2. List a series of tests that wou following metals: Zn, Mn, and Ag. of tests...
2. List a series of tests that wou following metals: Zn, Mn, and Ag. of tests that would determine the order of activity (least active to most active) for the
Which of the following metals reacts with aqueous Fe(NO3)2? Partial Activity Series: Na > Fe >...
Which of the following metals reacts with aqueous Fe(NO3)2? Partial Activity Series: Na > Fe > Co > (H) > Cu > Ag Cu all of the above none of the above Co Ag
5. Given the following data determine the relative activities of the metals from ead series for...
5. Given the following data determine the relative activities of the metals from ead series for Ca, Cd, Mg, and Ni (10 points). a. Identify each metal as more active or less active: Cu(s) + 2AgNO3 (aq) — 2Ag (s) + Cu(NO3)2 (aq) Fe (9) + CuSO4 (29) ► FeSO4 (aq) + Cu(s) Fe (9) + Zn(NO3)2 (aq) → no reaction b. Using the data from the first part of this problem, determine the activity Mg, and Ni. Deadende
Please just complete the questions that don’t require any more supplemental information 1. Write out the...
Please just complete the questions that don’t require any more
supplemental information
1. Write out the net ionic equation for the reaction you performed in Formula Weight of a Copper Compound. Assume that you start with a Cu?- salt. Based on the reactions we have discussed, what type(s) of reaction does this represent? __( ) + ( ) → _ C + ( ) reaction type: 2. In a separate experiment, you determine that the percent-by-mass of Ag in a...
Test Table 1 Single Displacement Reactions Tube Equation (Complete) 1 epr Cuts + AG NO- 210...
Test Table 1 Single Displacement Reactions Tube Equation (Complete) 1 epr Cuts + AG NO- 210 PB + Cu(NO 32 Zn + Pb (NO) Zn + MgSO4 Cu + H2 SO. - Zn + H2SO4 (ag) - Observations bere dissolved. che Lly Owych NO ACES Na reaches Hydelse Table# 2 Relative Reactivities Test Tube Number 1 2 Greater Activity Lesser Activity Silver cu 1 2 3 4 cu Pb Pb Mg ₂ ] in 1. Arrange the metals Pb and...
Relative Reactivity of Metals and the Activity Series Post Lab Questions You observed the relative reactivity of the following metals. a. Hg reacts with HNO, but not with HCl, hot or cold water. b. Al reacts slowly with hot (100 °C) water. c. Sr reacts with cold water. d. Cd reacts with HCI but not with hot or cold water. Write the mini-activity series (left to right) for these 4 metals (most active on right), least active most active Indicate...
2. a) Define the meaning of the term "activity series" of metals b) How does it relate to oxidation? 3. Define "chemical periodicity" and use metallic properties as an example, 141 Relative Reactivity of Metals and we 4. List the changes that you will observe to indicate that a reaction all observe to indicate that a reaction has occurred. Peranapan 5. Write the equation for each of the following renctions. Construct a minature activity series listing lead, zinc, hydrogen, potassium...
ume cemse chemse An ul ir tasle Write the equation for each of the following reactions. Construct a minature activity series listing lead, zinc, hydrogen, potassium and silver in order of decreasing activ- ity. a. Zinc will react with Pb ions to form lead metal and Zn but Pb ions willl not react with silver metal. 5. b. Both zine metal and lead metal will react with the H'(aq) from HCl to form hydrogen gas and Zn. Lead reacts with...
2. List a series of tests that would determine the order of activity (least active to most active) for the following metals: Zn, Mn, and Ag. custom page 93
2. List a series of tests that would determine the order of activity (least active to most active) for the following metals: Zn, Mn, and Ag. Znis) Mn Cla AgNo3 Znis) Ag No3 Mnus)+ Mhis) +2n INO3)
2. List a series of tests that wou following metals: Zn, Mn, and Ag. of tests that would determine the order of activity (least active to most active) for the
5. Given the following data determine the relative activities of the metals from ead series for Ca, Cd, Mg, and Ni (10 points). a. Identify each metal as more active or less active: Cu(s) + 2AgNO3 (aq) — 2Ag (s) + Cu(NO3)2 (aq) Fe (9) + CuSO4 (29) ► FeSO4 (aq) + Cu(s) Fe (9) + Zn(NO3)2 (aq) → no reaction b. Using the data from the first part of this problem, determine the activity Mg, and Ni. Deadende
Please just complete the questions that don’t require any more
supplemental information
1. Write out the net ionic equation for the reaction you performed in Formula Weight of a Copper Compound. Assume that you start with a Cu?- salt. Based on the reactions we have discussed, what type(s) of reaction does this represent? __( ) + ( ) → _ C + ( ) reaction type: 2. In a separate experiment, you determine that the percent-by-mass of Ag in a...
Test Table 1 Single Displacement Reactions Tube Equation (Complete) 1 epr Cuts + AG NO- 210 PB + Cu(NO 32 Zn + Pb (NO) Zn + MgSO4 Cu + H2 SO. - Zn + H2SO4 (ag) - Observations bere dissolved. che Lly Owych NO ACES Na reaches Hydelse Table# 2 Relative Reactivities Test Tube Number 1 2 Greater Activity Lesser Activity Silver cu 1 2 3 4 cu Pb Pb Mg ₂ ] in 1. Arrange the metals Pb and...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago