Homework Answers
Reaction steps of
NaCl -------> NaHCO3 --------> Na2CO3 --------> NaCl --------> NaOH ---------> NaCl
NaCl ------> NaHCO3
The reaction involves Sodium Chloride, Ammonia, Carbondi oxide with water to form Sodium Carbonate. Then Sodium Carbonate reacts with Carbondi oxide and water to give Sodium bicarbonate, and this process is Solvay Process.
NaCl + NH3 + CO2 + H2O --------> Na2CO3 + NH4Cl
Na2CO3 + CO2 + H2O --------> 2NaHCO3
NaHCO3 -------> Na2CO3
The reaction takes place by the heating Sodium bicarbonate at 200 F to form Sodium Carbonate, Carbon dioxide and water.
2NaHCO3 ------> Na2CO3 + CO2 + H2O
Na2CO3 -------> NaCl
Sodium Carbonate reacts with Hydrochloric acid to give Sodium Chloride, Carbon dioxide and water.
Na2CO3 + HCl ------> NaCl + + CO2 + H2O
NaCl -------> NaOH
Concentrated Sadium Chloride under Electrolysis gives Sodium hydroxide, Chlorine gas and Hydrogen gas
2NaCl(aq) + 2H2O(l) -------> 2NaOH(aq) + H2(g) + Cl2(g)
NaOH -------> NaCl
Sodium Hydroxide reacts with Hydrochloride acid to give Sodium Chloride
NaOH + HCl -------> NaCl + H2O(l)
Add Answer to:
please help with the reactions in each step
NaCl → NaHCO3 → Na2CO3 → NaCl →...
which chemical would you use to synthesize NaHCO3 from NaCl? Write balanced chemical reactions. NaCl →...
which chemical would you use to synthesize NaHCO3 from NaCl?
Write balanced chemical reactions.
NaCl → NaHCO3 → Na2CO3 → NaCl → NaOH + NaCl
Classify each of the following as strong electrolytes, weak electrolytes or nonelectrolytes. NaCl NaHCO3 C12H22O11 Na2CO3...
Classify each of the following as strong electrolytes, weak electrolytes or nonelectrolytes. NaCl NaHCO3 C12H22O11 Na2CO3 CaCO3 HC2H3O2 C3H6O
Please balance the following chemical reactions: Al2(SO3)3 + NaOH- Na2SO3 + Al(OH)3 NaHCO3- Na2CO3 + H20+...
Please balance the following chemical reactions: Al2(SO3)3 + NaOH- Na2SO3 + Al(OH)3 NaHCO3- Na2CO3 + H20+ CO2 Pat P203
Write the complete reactions of all the possible combinations in this set: NaCl, ZnCl2, NaOH, Na2CO3,...
Write the complete reactions of all the possible combinations in this set: NaCl, ZnCl2, NaOH, Na2CO3, and HCl and write which combinations produce precipitates, gases or any other indications of a reaction
Write the reaction equation with line structures for the following reactions: NaCl + H2O--> NaCl +...
Write the reaction equation with line structures for the following reactions: NaCl + H2O--> NaCl + Et2O--> NaCl + HCl--> NaCl + NaOH --> NaCl + NaHCO3-->
Possible Chemical Equations NaHCO3 (s) → NaOH (s) CO2(g) NaHCO3 (s) → Na2CO3(s) + CO2(g) +...
Possible Chemical Equations NaHCO3 (s) → NaOH (s) CO2(g) NaHCO3 (s) → Na2CO3(s) + CO2(g) + H2O(g) NaHCO3 (s) → Na2O(s) + CO2(g) + H2O(g) NaHCO3 (s) → Na(s) + H2(g) + C(s) + O2(g) Conclusions: 1. Rewrite and balance each of the four chemical equations from the lab introduction.
Possible Chemical Equations NaHCO3 (s) → NaOH (s) CO2(g) NaHCO3 (s) → Na2CO3(s) + CO2(g) +...
Possible Chemical Equations NaHCO3 (s) → NaOH (s) CO2(g) NaHCO3 (s) → Na2CO3(s) + CO2(g) + H2O(g) NaHCO3 (s) → Na2O(s) + CO2(g) + H2O(g) NaHCO3 (s) → Na(s) + H2(g) + C(s) + O2(g) Conclusions: 1. Rewrite and balance each of the four chemical equations from the lab introduction.
Please help me write molecular , total, net ionic equation for the following reactions: Ca(NO3)2 +NaCl...
Please help me write molecular , total, net ionic equation for the following reactions: Ca(NO3)2 +NaCl Na2CO3 + Ca(NO3)2 Na2SO4 + CuCl2 Na2SO4 +Pb(NO3)2 Pb(NO3)2 +CuCl2 AgNO3 + Na2SO4 AgNO3 +CuCl2
7. Given a buffer solution of sodium hydrogen carbonate (NaHCO3) and sodium carbonate (Na2CO3). a. Calculate...
7. Given a buffer solution of sodium hydrogen carbonate (NaHCO3) and sodium carbonate (Na2CO3). a. Calculate the pH of this buffer solution when 0.100M sodium hydrogen carbonate (NaHCO3) and 0.100M sodium carbonate (Na2CO3). (Ka = 7.94 x 10-7) b. Calculate the new pH value of this buffer solution when 1.00mL of 0.100M NaOH is added to to 100mL of this buffer
please help fill these out Al(s) + CuCl(aq) - Cu(s) + AgNO,(aq) + Double replacement reactions...
please help fill these out
Al(s) + CuCl(aq) - Cu(s) + AgNO,(aq) + Double replacement reactions 9. Test tube number 1. NaCl(aq) +_ KNO3(aq) - NaCl(aq) + _ AgNO3(aq) - Na2CO3(aq) +_ _ HCl(aq) - NaOH(aq) + HCl(aq) - BaCl2(aq) + H2SO (aq) Pb(NO3)2(aq) + __KCrO (aq) + Fe(NO3)3(aq) +_ NaOH(aq) - 8. Cu(NO3)2(aq) +_ _NaOH(aq) --
which chemical would you use to synthesize NaHCO3 from NaCl?
Write balanced chemical reactions.
NaCl → NaHCO3 → Na2CO3 → NaCl → NaOH + NaCl
Please balance the following chemical reactions: Al2(SO3)3 + NaOH- Na2SO3 + Al(OH)3 NaHCO3- Na2CO3 + H20+ CO2 Pat P203
Possible Chemical Equations NaHCO3 (s) → NaOH (s) CO2(g) NaHCO3 (s) → Na2CO3(s) + CO2(g) + H2O(g) NaHCO3 (s) → Na2O(s) + CO2(g) + H2O(g) NaHCO3 (s) → Na(s) + H2(g) + C(s) + O2(g) Conclusions: 1. Rewrite and balance each of the four chemical equations from the lab introduction.
Possible Chemical Equations NaHCO3 (s) → NaOH (s) CO2(g) NaHCO3 (s) → Na2CO3(s) + CO2(g) + H2O(g) NaHCO3 (s) → Na2O(s) + CO2(g) + H2O(g) NaHCO3 (s) → Na(s) + H2(g) + C(s) + O2(g) Conclusions: 1. Rewrite and balance each of the four chemical equations from the lab introduction.
please help fill these out
Al(s) + CuCl(aq) - Cu(s) + AgNO,(aq) + Double replacement reactions 9. Test tube number 1. NaCl(aq) +_ KNO3(aq) - NaCl(aq) + _ AgNO3(aq) - Na2CO3(aq) +_ _ HCl(aq) - NaOH(aq) + HCl(aq) - BaCl2(aq) + H2SO (aq) Pb(NO3)2(aq) + __KCrO (aq) + Fe(NO3)3(aq) +_ NaOH(aq) - 8. Cu(NO3)2(aq) +_ _NaOH(aq) --
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 4 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago