in an exothermic reaction, heat is a? A) reactant B)reducing agent C)catalyst D)oxidizing agent E) no...
in an exothermic reaction, heat is a?
A) reactant
B)reducing agent
C)catalyst
D)oxidizing agent
E) no correct response
Homework Answers
In exothermic reaction, heat is produced.
So, it is part of product.
This is not a reactant.
Reducing and oxidising agent are also present in reactant.
Catalyst is also present in reactant.
Answer: E
Add Answer to:
in an exothermic reaction, heat is a?
A) reactant
B)reducing agent
C)catalyst
D)oxidizing agent
E) no...
Part A: Label each reactant as the reducing agent, oxidizing agent, or neither. Drag the appropriate...
Part A: Label each reactant as the reducing agent, oxidizing agent, or neither. Drag the appropriate labels to their respective targets. Oxidizing agent Oxidizing agent Neither N2 + 3H2 ---------> 2NH3 Reactants: [] [] 2N2 + O2 ---------> 2N2O Reactants: [] [] Part B: Here is a more complex redox reaction involving the permanganate ion in acidic solution. Label each reactant as the reducing agent, oxidizing agent, or neither. Drag the appropriate labels to their respective targets. Oxidizing agent Reducing...
23. In a redox reaction, which reactant is the oxidizing agent? The reducing agent? AA What...
23. In a redox reaction, which reactant is the oxidizing agent? The reducing agent? AA What is a combustion reaction? Why are they imnortant? GI 25. Consider the unbalanced equation for the combustion of hexane: CH48) + O2(8) - CO2(8) + H2O(8)
Identify the oxidizing agent and the reducing agent on the reactant side of the following chemical...
Identify the oxidizing agent and the reducing agent on the reactant side of the following chemical equation. Then explain why you selected these compounds as the oxidizing agent and the reducing agent. MnO4 (aq) + SO2(aq) → MnO2(s) + 5042 (aq)
14) In an exothermic reaction, heat can be considered a A) reactant B) product C) rate...
14) In an exothermic reaction, heat can be considered a A) reactant B) product C) rate D) catalyst E) determinant 15) Any reaction that absorbs 150 kcal of energy can be classified as A) endothermic B) exothermic C) activated D) reduction E) oxidation 16) The is the energy difference between reactants and products in a chemical reaction. A) transition energy B) activation energy C) product energy D) overall energy E) heat of reaction 17) For the reaction of carbon with...
RO Identify the oxidizing agent and the reducing agent in each reaction Part A 3 C+Fe,03...
RO Identify the oxidizing agent and the reducing agent in each reaction Part A 3 C+Fe,03 +CO+2 Fe C is the oxidizing agent and Fe, O, is the reducing agent. Fe, O, is the oxidizing agent and C is the reducing agent.
In the following redox reaction what is the oxidizing agent and what is the reducing agent?...
In the following redox reaction what is the oxidizing agent and what is the reducing agent? H2O2 (aq) + C1O2 (aq) + Cioz (aq) + 02 (9) oxidizing agent < [Choose] reducing agent [Choose ]
3. In an oxidation avidation reaction: - mm OR MOLECULE 1oosts E An oxidizing agent gains...
3. In an oxidation avidation reaction: - mm OR MOLECULE 1oosts E An oxidizing agent gains electrons. b. An oxidizing agent loses electrons. c. A reducing agent gains electrons. d. reducing agent loses electrons.
Identify which is the reducing agent and which is the oxidizing agent in the reaction of...
Identify which is the reducing agent and which is the oxidizing agent in the reaction of benzophenone with sodium borohydride and explain your reasoning, ie. show the changes in oxidation states (best to give a drawing as per the introduction)? Identify which is the reducing agent and which is the oxidizing agent in the reaction of benzophenone with sodium borohydride and explain your reasoning, ie. show the changes in oxidation states (best to give a drawing)?
Identify the species oxidized, the species reduced, the oxidizing agent and the reducing agent in the...
Identify the species oxidized, the species reduced, the oxidizing agent and the reducing agent in the following electron transfer reaction. 2Cr3+ + 3712Cr + 3Zn2+ species oxidized species reduced oxidizing agent reducing agent As the reaction proceeds, electrons are transferred from Identify the species oxidized, the species reduced the oxidizing agent and the reducing agent in the following electron transfer reaction. Hg2+ + SnHg+Sn2+ species oxidized species reduced oxidizing agent reducing agent As the reaction proceeds, electrons are transferred from
Submit Part B Identify the oxidizing agent and the reducing agent in each reaction below. Drag...
Submit Part B Identify the oxidizing agent and the reducing agent in each reaction below. Drag each label to the appropriate target. View Available Hint(s) Reselle 2Al(s) + 3Cl2(g) 2AlCl3(s) addizing agent reducing agent Odg) + 2Mg(s) 2MgO(s)
23. In a redox reaction, which reactant is the oxidizing agent? The reducing agent? AA What is a combustion reaction? Why are they imnortant? GI 25. Consider the unbalanced equation for the combustion of hexane: CH48) + O2(8) - CO2(8) + H2O(8)
Identify the oxidizing agent and the reducing agent on the reactant side of the following chemical equation. Then explain why you selected these compounds as the oxidizing agent and the reducing agent. MnO4 (aq) + SO2(aq) → MnO2(s) + 5042 (aq)
14) In an exothermic reaction, heat can be considered a A) reactant B) product C) rate D) catalyst E) determinant 15) Any reaction that absorbs 150 kcal of energy can be classified as A) endothermic B) exothermic C) activated D) reduction E) oxidation 16) The is the energy difference between reactants and products in a chemical reaction. A) transition energy B) activation energy C) product energy D) overall energy E) heat of reaction 17) For the reaction of carbon with...
RO Identify the oxidizing agent and the reducing agent in each reaction Part A 3 C+Fe,03 +CO+2 Fe C is the oxidizing agent and Fe, O, is the reducing agent. Fe, O, is the oxidizing agent and C is the reducing agent.
In the following redox reaction what is the oxidizing agent and what is the reducing agent? H2O2 (aq) + C1O2 (aq) + Cioz (aq) + 02 (9) oxidizing agent < [Choose] reducing agent [Choose ]
3. In an oxidation avidation reaction: - mm OR MOLECULE 1oosts E An oxidizing agent gains electrons. b. An oxidizing agent loses electrons. c. A reducing agent gains electrons. d. reducing agent loses electrons.
Identify the species oxidized, the species reduced, the oxidizing agent and the reducing agent in the following electron transfer reaction. 2Cr3+ + 3712Cr + 3Zn2+ species oxidized species reduced oxidizing agent reducing agent As the reaction proceeds, electrons are transferred from Identify the species oxidized, the species reduced the oxidizing agent and the reducing agent in the following electron transfer reaction. Hg2+ + SnHg+Sn2+ species oxidized species reduced oxidizing agent reducing agent As the reaction proceeds, electrons are transferred from
Submit Part B Identify the oxidizing agent and the reducing agent in each reaction below. Drag each label to the appropriate target. View Available Hint(s) Reselle 2Al(s) + 3Cl2(g) 2AlCl3(s) addizing agent reducing agent Odg) + 2Mg(s) 2MgO(s)
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 29 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago