![6.) a.) Calculate CFSE in terms of A for (CoCl4]? (12 marks). b.) Is [Cr(CO).] expected to be paramagnetic or diamagnetic? Ex](http://img.homeworklib.com/questions/71e47000-732f-11ea-ae67-d575feac55ac.png?x-oss-process=image/resize,w_560)
Homework Answers
Add Answer to:
6.) a.) Calculate CFSE in terms of A for (CoCl4]? (12 marks). b.) Is [Cr(CO).] expected...
[6] (a) Write an orbital diagram for the ground state of Magnesium (Mg) and Phosphorous (P). (Marks = 1) [6] (b) Which of the following elements would be expected to be paramagnetic or diamagnetic and...
[6] (a) Write an orbital
diagram for the ground state of Magnesium (Mg) and Phosphorous (P).
(Marks = 1) [6] (b) Which of the following elements would be
expected to be paramagnetic or diamagnetic and why? (Marks = 1)
Magnesium (Mg) and Phosphorous (P)
[6] (a) Write an orbital diagram for the ground state of Magnesium (Mg) and Phosphorous (P) Marks-I) [6] (b) Which of the following elements would be expected to be paramagnetic or diamagnetic and why? (Marks 1)...
Consider the coordination compound Caz[Co(CN)6]: i. ii. Give the systematic name of the compound. What is...
Consider the coordination compound Caz[Co(CN)6]: i. ii. Give the systematic name of the compound. What is the magnetic property of the complex (diamagnetic, strong or weakly paramagnetic)? (Use the appropriate d-orbital splitting diagram from the formula sheet to explain your answer) iii. Will the complex be a high-spin or low-spin complex?
b) Is CO paramagnetic or diamagnetic? What is the bond order of CO? c) Draw a Lewis structure...
Draw an energy-level diagram for the valence molecular orbitals of CO. Include the relevant atomic orbitals in your diagram. Clearly label each molecular orbital (e.gs2s, p2p, etc.) and fill in the appropriate number of electrons. Use the same energy order as the neutral O2 molecule.b) Is CO paramagnetic or diamagnetic? What is the bond order of CO? c) Draw a Lewis structure for CO. Does this match the predicted bond order? d) CO can react withOH– to form the formate...
(i) explain how they differ. b. (ii) Explain how the following reaction was used to deduce the mechanism of inner sphere electron transfer. [Co(NH,),Cl]Cr(Hd+SH,OCo(H,O)+ [Cr(HO),ci+5NH 8 marks]...
(i) explain how they differ. b. (ii) Explain how the following reaction was used to deduce the mechanism of inner sphere electron transfer. [Co(NH,),Cl]Cr(Hd+SH,OCo(H,O)+ [Cr(HO),ci+5NH 8 marks] (i) Given the following ligands, suggest which one you would use as a chelating agent to treat an excess of Fe(III). Explain your choice. c. HS SH он HS NH2 Ci) Assuming an octahedral geometry, draw the strueture (inecluding any possible isomers) of the neutral Fe(III) complex that would be formed if it...
a. Predict the structure of [Cr(OH2)6]2+ - I wrote that the complex will undergo Jahn-Teller distortion,...
a. Predict the structure of [Cr(OH2)6]2+ - I wrote that the complex will undergo Jahn-Teller distortion, making the octahedral complex become tetragonal (don't know if that's correct) b. Account for the variation in the lattice enthalpy of Mn (2780 kJ/mol), Fe (2926 kJ/mol), Co (2976 kJ/mol), Ni (3060 kJ/mol), and Zn (2985 kJ/mol) flouride given that the metal center in all of the flourides is surrounded by an octahedral array of F-ions. c. Explain the effect on the d-orbital energies...
QUESTION 6 (20 Marks) CO CO6 Marks20 Use five decimals points throughout your calculations when solving this question....
QUESTION 6 (20 Marks) CO CO6 Marks20 Use five decimals points throughout your calculations when solving this question. Evaluate the performance of fourth order Runge-Kutta (RK-4) by using different values of h using the given function. The analytical value of y-r+21+1-0.5e Rungo-Kutta 4 Oder Equation Page 12/21 Firal Esam, SKKK 2133 1617-1 You are given an option to select h癰 0.5. a 45, 0.4, 0.35, 0.3 and h 0.25), to solve the (a) given function. Which h can give the...
From experimental data, it was found that the complexes [NiCl (PPh.),] 5. a and (PdCL,(PPh,] are paramagnetic and d...
From experimental data, it was found that the complexes [NiCl (PPh.),] 5. a and (PdCL,(PPh,] are paramagnetic and diamagnetic, respectively Propose the geometry of the complexes based on this information. Justify your answers. [6 marks] AN 20 b. Propose a possible structure for each of the following compounds: AM P JAN 20 [Co2(CO) i. [2 marks] [(n'-CHJCr(CO) ii. EXAM [2 marks] Use the 18-electron rule to determine if the proposed structures in C. part(b) are correct. XAM 20 14 marks]...
Co(H2O)6]2+, [CoCl4]2- Equilibrium (common ion) 1.Effect of concentrated HCl. Place about 10 drops of 1.0 M...
Co(H2O)6]2+, [CoCl4]2- Equilibrium (common ion) 1.Effect of concentrated HCl. Place about 10 drops of 1.0 M CoCl2 in a 75 mm test tube. 2.Add drops of concentrated HCl (Caution: Avoid inhalation and skin contact). This solution is found in the hood. Place the test tube in a test tube rack. 3.Remove and hold the coin stopper while you use it. Place coin stopper on bottle when done) until a color change occurs. 4.Slowly add water to the system and stir....
HELP ASAP PLEASE!! A) Draw the Lewis Dot structu re for 02. 3. b) What is the bond order? c) Is O2 diamagnetic or...
HELP ASAP PLEASE!!
A) Draw the Lewis Dot structu re for 02. 3. b) What is the bond order? c) Is O2 diamagnetic or paramagnetic? 6. Look up M.O. diagram for 02. a) Using the bond order formula given, calculate the bond order for O2 according to MO. Compare this answer to the bond order calculated in earlier question. d) Is O2 diamagnetic or paramagnetic according to MO? Compare this answer to the question in earlier question. hen a substance...
5.(12 pts) Identify the group of elements that correspond to each of the following generalized electron...
5.(12 pts) Identify the group of elements that correspond to each of the following generalized electron configurations. No partial credit. You should check your work using table 7.3 of text. (a) [Noble gas] ns?np (b) [Noble gas] ns?(n-1)d? (c) [Noble gas) ns-(n-1)dlºnp! (d) [Noble gas] ns (n-2015 6.(18ps) (a) 6pts. What is the ground state electron configuration and orbital diagram of Nb(41)? Is this paramagnetic or diamagnetic? (b) 4pts. The following is an excited state configuration of a neutral atom:...
[6] (a) Write an orbital
diagram for the ground state of Magnesium (Mg) and Phosphorous (P).
(Marks = 1) [6] (b) Which of the following elements would be
expected to be paramagnetic or diamagnetic and why? (Marks = 1)
Magnesium (Mg) and Phosphorous (P)
[6] (a) Write an orbital diagram for the ground state of Magnesium (Mg) and Phosphorous (P) Marks-I) [6] (b) Which of the following elements would be expected to be paramagnetic or diamagnetic and why? (Marks 1)...
Consider the coordination compound Caz[Co(CN)6]: i. ii. Give the systematic name of the compound. What is the magnetic property of the complex (diamagnetic, strong or weakly paramagnetic)? (Use the appropriate d-orbital splitting diagram from the formula sheet to explain your answer) iii. Will the complex be a high-spin or low-spin complex?
(i) explain how they differ. b. (ii) Explain how the following reaction was used to deduce the mechanism of inner sphere electron transfer. [Co(NH,),Cl]Cr(Hd+SH,OCo(H,O)+ [Cr(HO),ci+5NH 8 marks] (i) Given the following ligands, suggest which one you would use as a chelating agent to treat an excess of Fe(III). Explain your choice. c. HS SH он HS NH2 Ci) Assuming an octahedral geometry, draw the strueture (inecluding any possible isomers) of the neutral Fe(III) complex that would be formed if it...
QUESTION 6 (20 Marks) CO CO6 Marks20 Use five decimals points throughout your calculations when solving this question. Evaluate the performance of fourth order Runge-Kutta (RK-4) by using different values of h using the given function. The analytical value of y-r+21+1-0.5e Rungo-Kutta 4 Oder Equation Page 12/21 Firal Esam, SKKK 2133 1617-1 You are given an option to select h癰 0.5. a 45, 0.4, 0.35, 0.3 and h 0.25), to solve the (a) given function. Which h can give the...
From experimental data, it was found that the complexes [NiCl (PPh.),] 5. a and (PdCL,(PPh,] are paramagnetic and diamagnetic, respectively Propose the geometry of the complexes based on this information. Justify your answers. [6 marks] AN 20 b. Propose a possible structure for each of the following compounds: AM P JAN 20 [Co2(CO) i. [2 marks] [(n'-CHJCr(CO) ii. EXAM [2 marks] Use the 18-electron rule to determine if the proposed structures in C. part(b) are correct. XAM 20 14 marks]...
HELP ASAP PLEASE!!
A) Draw the Lewis Dot structu re for 02. 3. b) What is the bond order? c) Is O2 diamagnetic or paramagnetic? 6. Look up M.O. diagram for 02. a) Using the bond order formula given, calculate the bond order for O2 according to MO. Compare this answer to the bond order calculated in earlier question. d) Is O2 diamagnetic or paramagnetic according to MO? Compare this answer to the question in earlier question. hen a substance...
5.(12 pts) Identify the group of elements that correspond to each of the following generalized electron configurations. No partial credit. You should check your work using table 7.3 of text. (a) [Noble gas] ns?np (b) [Noble gas] ns?(n-1)d? (c) [Noble gas) ns-(n-1)dlºnp! (d) [Noble gas] ns (n-2015 6.(18ps) (a) 6pts. What is the ground state electron configuration and orbital diagram of Nb(41)? Is this paramagnetic or diamagnetic? (b) 4pts. The following is an excited state configuration of a neutral atom:...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 23 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago