Homework Answers
Add Answer to:
C . Fox 2 Ghe the names for the following compounds: a)Nal _b) CaCl c) KNO...
Write formulas for the following compounds. -Sodium phosphate -Magnesium hydrogen sulfate -Manganese(II) chloride -Chromium(III) carbonate Write...
Write formulas for the following compounds. -Sodium phosphate -Magnesium hydrogen sulfate -Manganese(II) chloride -Chromium(III) carbonate Write formulas for the following binary compounds. -Potassium chloride -Tin(II) bromide -Calcium oxide -Barium chloride -Aluminum hydride
Write formula for compounds wite the correct formula for the following compounds: sodium bromide calcium chloride...
Write formula for compounds
wite the correct formula for the following compounds: sodium bromide calcium chloride calcium sulfide copper(I) carbonate sulfuric acid diphosphorus pentoxide _ chloric acicd ammonium sulfate hydrochloric acid mercury(II) acetate lead (II) nitrite ammonium sulfite sodium sulfate nitrous acid nitric acid iron(III) sulfate barium fluoride copper(I) sulfite ammonium nitrate iron(III) hydroxide mercury(II) nitrate sulfurous acid hydrosulfuric acid iron(II) hydroxide lead(II) chloride calcium hydrogen carbonate sulfur trioxide phosphoric acid bromine pentafluoride dinitrogen tetroxide carbon monoxide aluminum carbonate ammonium...
Study Exercise 3 Name Write chemical formulas for the following compounds: 1. 2. 3. Potassium iodide...
Study Exercise 3 Name Write chemical formulas for the following compounds: 1. 2. 3. Potassium iodide Barium sulfate Aluminum nitrate Copper (II) carbonate Gold (III) chloride Ferric hydroxide 7. Lead (II) chromate Nickel (II) hydroxide Mercury (II) bromide Silver acetate Magnesium chlorate 12. Sodium peroxide 13. Manganese (II) phosphate Ammonium sulfide 15. Platinum (IV) fluoride Chromium (III) hydroxide Calcium oxalate Antimony trichloride Ammonia Silicon dioxide Carbon monoxide 22. Hydrobromic acid Nitrous acid 24. - Acetic acid 25. Sulfuric acid
Answer all plz!!! 4. Name the following compounds by first deciding whether they are ionic or...
Answer
all plz!!!
4. Name the following compounds by first deciding whether they are ionic or covalent, then use the appropriate nomenclature. Where applicable, you may use common names SAN4 K2O2 Pb(OH)2: Na2S Fe2O3 PF 3 ZnCr2O7 Mg3P2 BeF2 CIF 3 Ca(CIO)2: CH4 Bi(OH)3 SnCl4 3 6. Write the formulas for the following compounds. If a compound is ionic, be sure to balance charge. In case of a binary aqueous acid, include the symbol "(aq)" in the formula. Lithium cyanide...
Chemical Nomenclature: Worksheet Name B. Write the formulas for the following compounds: manganese(ll) chlorite chlorine monoxide...
Chemical Nomenclature: Worksheet Name B. Write the formulas for the following compounds: manganese(ll) chlorite chlorine monoxide potassium nitride mercury(II) sulfate cobalt(III) sulfite calcium chlorite nickel() carbonate silicon monoxide diphosphorus pentoxide carbonic acid cobalt(W) permanganate lead(IV) nitrate barium sulfite hypochlorous acid lead(ul) sulfide iron(III) chloride zinc permanganate manganese(II) bromide nitrous acid xenon pentoxide silver nitrate phosphorous pentchloride potassium cyanide
Nomenclature WS #2 Write the fomulas and names of the following: Use both names where it...
Nomenclature WS #2 Write the fomulas and names of the following: Use both names where it is appropriate. Sn,(PO) sodium sulfite CuHSO potassium cyanide HC H,O2 hydroiodic acid HBr Iron(II) permanganate magnesium hypochlorite SnS2 phosphorus pentachloride Zn(CIO) ammonia Cu SO hydrogen peroxide SO chlorine monofluoride Ca(OH) phosphoric acid Al:(COs) silver oxide Li-O plumbic sulfate Fe(CN) tetraphosphorus hexoxide NOs. calcium chlorite Cl-O magnesium nitrite XeF stannous chloride Cu(NO,)2. sodium sulfate Sn(C2H,O2) zinc hydroxide HCIO() hydrosulfuric acid РЬб. dichlorine heptoxide (NH),SOs 31
STUDENT NAME CHEM 121 POST LAB WORKSHEET NOMENCLATURE and FORMULAS of BINARY INORGANIC COMPOUNDS Do not...
STUDENT NAME CHEM 121 POST LAB WORKSHEET NOMENCLATURE and FORMULAS of BINARY INORGANIC COMPOUNDS Do not attempt to write your answers on this sheet. There is not enough room and your writing will be too small to read. Attach separate sheets with your answers. 1-43) WRITE THE IUPAC NAME FOR THE FOLLOWING COMPOUNDS ANSWERS ON A SEPARATE SHEET PLEASE 1) H20 2) Mgo 3) AIS 4) KN 5) CaCl2 6) AuCl3 7) CO 8) Cu20 9) FeCl2 10) P.0 11)...
Part E – Ionic Compounds Name Formula Formula Name Silver (I) chloride KNO2 Sodium acetate CrCl3...
Part E – Ionic Compounds Name Formula Formula Name Silver (I) chloride KNO2 Sodium acetate CrCl3 Calcium fluoride Mg(IO3)2 Iron (III) oxide CuBr2 Cobalt (III) sulfite NaNO3 Magnesium sulfide Al2O3 Zinc (II) phosphate NaHCO3 Nickel (II) bromide BaS Iron (II) carbonate MnO2 Sodium sulfate KH2PO4 Lithium nitrate CuCO3 Barium phosphate NaI Chromium (VI) bromate Fe(IO4)3 Potassium hydrogen carbonate MgF2 Titanium (IV) chloride Co(ClO2)3 Magnesium nitrite LiC2H3O2 Zinc (II) sulfite Ni(HSO4)2 Sodium hypobromite KCN Calcium carbonate Fe(OH)2
Write the molar equation and net ionic equation for each reaction. Reaction 1. silver nitrate +...
Write the molar equation and net ionic equation for each
reaction.
Reaction 1. silver nitrate + sodium chloride AgNO3 Nach 2. silver nitrate + sodium bromide AS Noz doim Narse 3. silver nitrate + potassium iodide A No3 KI 4. silver nitrate + sodium phosphate AS NO3 Naz PO 4 5. barium nitrate + potassium sulfate BaCNO3)2 Krsou 6. lead(II) nitrate + potassium sulfate Tome Pb(NO372 ksoy 7. barium chloride + sodium phosphate Dim Back Na₃PO4 8. calcium nitrate +...
Solid Nal is slowly added to a solution that is 0.0099 M Cut and 0.0089 M...
Solid Nal is slowly added to a solution that is 0.0099 M Cut and 0.0089 M Ag*. Which compound will begin to precipitate first? O Nal O Cul o Agi Calculate [Agt ] when Cul just begins to precipitate. 8.21 x 1007 Enter your answer in scientific notation. What percent of Agt remains in solution at this point? 0.01095 10- Solubility Products of Some Slightly Soluble lonic Compounds at 25°C Compound 3p Compound Aluminum hydroxide (Al(OH)3) 10- Lead(II) chromate (PCO)...
Write formula for compounds
wite the correct formula for the following compounds: sodium bromide calcium chloride calcium sulfide copper(I) carbonate sulfuric acid diphosphorus pentoxide _ chloric acicd ammonium sulfate hydrochloric acid mercury(II) acetate lead (II) nitrite ammonium sulfite sodium sulfate nitrous acid nitric acid iron(III) sulfate barium fluoride copper(I) sulfite ammonium nitrate iron(III) hydroxide mercury(II) nitrate sulfurous acid hydrosulfuric acid iron(II) hydroxide lead(II) chloride calcium hydrogen carbonate sulfur trioxide phosphoric acid bromine pentafluoride dinitrogen tetroxide carbon monoxide aluminum carbonate ammonium...
Study Exercise 3 Name Write chemical formulas for the following compounds: 1. 2. 3. Potassium iodide Barium sulfate Aluminum nitrate Copper (II) carbonate Gold (III) chloride Ferric hydroxide 7. Lead (II) chromate Nickel (II) hydroxide Mercury (II) bromide Silver acetate Magnesium chlorate 12. Sodium peroxide 13. Manganese (II) phosphate Ammonium sulfide 15. Platinum (IV) fluoride Chromium (III) hydroxide Calcium oxalate Antimony trichloride Ammonia Silicon dioxide Carbon monoxide 22. Hydrobromic acid Nitrous acid 24. - Acetic acid 25. Sulfuric acid
Answer
all plz!!!
4. Name the following compounds by first deciding whether they are ionic or covalent, then use the appropriate nomenclature. Where applicable, you may use common names SAN4 K2O2 Pb(OH)2: Na2S Fe2O3 PF 3 ZnCr2O7 Mg3P2 BeF2 CIF 3 Ca(CIO)2: CH4 Bi(OH)3 SnCl4 3 6. Write the formulas for the following compounds. If a compound is ionic, be sure to balance charge. In case of a binary aqueous acid, include the symbol "(aq)" in the formula. Lithium cyanide...
Chemical Nomenclature: Worksheet Name B. Write the formulas for the following compounds: manganese(ll) chlorite chlorine monoxide potassium nitride mercury(II) sulfate cobalt(III) sulfite calcium chlorite nickel() carbonate silicon monoxide diphosphorus pentoxide carbonic acid cobalt(W) permanganate lead(IV) nitrate barium sulfite hypochlorous acid lead(ul) sulfide iron(III) chloride zinc permanganate manganese(II) bromide nitrous acid xenon pentoxide silver nitrate phosphorous pentchloride potassium cyanide
Nomenclature WS #2 Write the fomulas and names of the following: Use both names where it is appropriate. Sn,(PO) sodium sulfite CuHSO potassium cyanide HC H,O2 hydroiodic acid HBr Iron(II) permanganate magnesium hypochlorite SnS2 phosphorus pentachloride Zn(CIO) ammonia Cu SO hydrogen peroxide SO chlorine monofluoride Ca(OH) phosphoric acid Al:(COs) silver oxide Li-O plumbic sulfate Fe(CN) tetraphosphorus hexoxide NOs. calcium chlorite Cl-O magnesium nitrite XeF stannous chloride Cu(NO,)2. sodium sulfate Sn(C2H,O2) zinc hydroxide HCIO() hydrosulfuric acid РЬб. dichlorine heptoxide (NH),SOs 31
STUDENT NAME CHEM 121 POST LAB WORKSHEET NOMENCLATURE and FORMULAS of BINARY INORGANIC COMPOUNDS Do not attempt to write your answers on this sheet. There is not enough room and your writing will be too small to read. Attach separate sheets with your answers. 1-43) WRITE THE IUPAC NAME FOR THE FOLLOWING COMPOUNDS ANSWERS ON A SEPARATE SHEET PLEASE 1) H20 2) Mgo 3) AIS 4) KN 5) CaCl2 6) AuCl3 7) CO 8) Cu20 9) FeCl2 10) P.0 11)...
Write the molar equation and net ionic equation for each
reaction.
Reaction 1. silver nitrate + sodium chloride AgNO3 Nach 2. silver nitrate + sodium bromide AS Noz doim Narse 3. silver nitrate + potassium iodide A No3 KI 4. silver nitrate + sodium phosphate AS NO3 Naz PO 4 5. barium nitrate + potassium sulfate BaCNO3)2 Krsou 6. lead(II) nitrate + potassium sulfate Tome Pb(NO372 ksoy 7. barium chloride + sodium phosphate Dim Back Na₃PO4 8. calcium nitrate +...
Solid Nal is slowly added to a solution that is 0.0099 M Cut and 0.0089 M Ag*. Which compound will begin to precipitate first? O Nal O Cul o Agi Calculate [Agt ] when Cul just begins to precipitate. 8.21 x 1007 Enter your answer in scientific notation. What percent of Agt remains in solution at this point? 0.01095 10- Solubility Products of Some Slightly Soluble lonic Compounds at 25°C Compound 3p Compound Aluminum hydroxide (Al(OH)3) 10- Lead(II) chromate (PCO)...
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 8 seconds from now -
How would you train your employees to avoid risks of using
mobile devices?
asked 22 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago