Homework Answers
1st calculate the mol of CO2 reacted.
Given:
P = 258.0 mm Hg
= (258.0/760) atm
= 0.3395 atm
V = 625.0 L
T = 27.0 oC
= (27.0+273) K
= 300 K
find number of moles using:
P * V = n*R*T
0.3395 atm * 625 L = n * 0.08206 atm.L/mol.K * 300 K
n = 8.619 mol
From reaction,
Mol of LiOH required = 2*mol of CO2 required
= 2*8.619 mol
= 17.238 mol
Use:
Mass of LiOH = mol of LiOH * molar mass of LiOH
= 17.238 mol * 23.95 g/mol
= 413 g
Answer: 413 g
Add Answer to:
Gas Law Stoichiometry 8. Lithium hydroxide, LiOH, is used in spacecraft to recondition the air by...
One method of sequestering Co, in spacecraft is allowing the Co, to react with LiOH to...
One method of sequestering Co, in spacecraft is allowing the Co, to react with LiOH to produce Li,Co, and H.O. The balanced chemical equation is: CO2 (g) + 2 LiOH (s) - LigCO3 (8) + H2O (g) If 69.6 g of LiOH is allowed to react with excess Co, what is the theoretical yield in grams of Li,CO, that would be formed? Select one: The theoretical yield of Li2CO3 is 107 grams. O The theoretical yield of LI2CO3 is 429...
One method of sequestering CO2 in spacecraft is allowing the CO2 to react with LIOH to...
One method of sequestering CO2 in spacecraft is allowing the CO2 to react with LIOH to produce Li2CO3 and H2O. CO2(g) + 2 LiOH (s) — LizCO(s) + H20 (9) If 30.0 g of LiOH is allowed to react with excess CO2, what is the theoretical yield in grams of LiaCO3 that would be formed? Alter the above experiment with 30.0 g of LIOH has been performed, a technician determines the mass of the LICO, product to be 25.4 grams....
One of the air-purification methods for enclosed spaces involves the use of "scrubbers" containing aqueous lithium...
One of the air-purification methods for enclosed spaces involves the use of "scrubbers" containing aqueous lithium hydroxide, which reacts with carbon dioxide to produce lithium carbonate and water: 2 LiOH(aq) + 2 CO2(g) → Li2CO3(s) + H2O(l) Consider the air supply in a submarine with a total volume of 2.20 × 105 L. The pressure is 0.9970 atm, and the temperature is 25° C. If the pressure in the submarine drops by 0.0100 atm as the result of carbon dioxide...
Part B. Solid lithium hydroxide is used to "scrub" CO2 from the air in spacecraft and...
Part B. Solid lithium hydroxide is used to "scrub" CO2 from the air in spacecraft and submarines; it reacts with the CO2 to produce lithium carbonate and water. What volume in liters of CO2 at 21°C and 736 torr can be removed by reaction with 439 g of lithium hydroxide? Enter to 3 sig figs. Part C. The alkali metals react with the halogens to form ionic metal halides. What mass in g of sodium chloride forms when 5.98 L...
Question #7: After lithium hydroxide is produced aboard the space shuttle by reaction of Li2OLi2O with...
Question #7: After lithium hydroxide is produced aboard the space shuttle by reaction of Li2OLi2O with H2OH2O (Li2O(s)+H2O(g)→2LiOH(s))(Li2O(s)+H2O(g)→2LiOH(s)), it is used to remove exhaled carbon dioxide from the air supply according to the equation LiOH(s)+CO2(g)→LiHCO3(s) A) How many grams of CO2CO2 can 410.0 gg of LiOHLiOH absorb? Question #8: An unknown compound contains only carbon, hydrogen, and oxygen (CxHyOzCxHyOz). Combustion of 7.00 gg of this compound produced 10.3 gg of carbon dioxide and 4.20 gg of water. A) How many...
Chemistry Mass Rekationship, Limiting Reactant and Percent Yield
People in confined spaces like those of space vehicles are at risk of carbon dioxide intoxication due to build-up of the gas. In a space shuttle, the carbon dioxide expelled by the crew is removed from the air by a reaction within canisters of lithium hydroxide. The reaction is, LiOH + CO2 → Li2CO3 + H2Oa) How many moles of LiOH can be used to remove the CO2 gas expelled by each crew if on the average, each exhales about...
Consider the following unbalanced chemical equation LiOH(s)+CO2(aq)=LiCO3(s)+H2O(l) If 3.89 moles of lithium hydroxide reacts with excess...
Consider the following unbalanced chemical equation LiOH(s)+CO2(aq)=LiCO3(s)+H2O(l) If 3.89 moles of lithium hydroxide reacts with excess carbon dioxide how many moles of lithium carbonate will be produced
s/u-113891266fe161c2cccf940493cd3b01bd36952/MyFiles/Downloads/HW-200420-%20Spring 202020220(1).pdf 5.(3 points) Alkali metal hydroxides are sometimes used to "scrub" excess carbon dioxide from...
s/u-113891266fe161c2cccf940493cd3b01bd36952/MyFiles/Downloads/HW-200420-%20Spring 202020220(1).pdf 5.(3 points) Alkali metal hydroxides are sometimes used to "scrub" excess carbon dioxide from the air in closed spaces (such as submarines and spacecraft). For example, lithium hydroxide reacts with carbon dioxide according to the unbalanced chemical equation LIOH(s) + CO. (8) LICO, (s) + H2O (O) Suppose a lithium hydroxide canister contains 155 g of LIOH(s). What mass of Co, (8) will the canister be able to absorb? If it is found that after 24 hours of...
1) One hundred (100) ml of a 1.00 M solution of HCl is diluted with water...
1) One hundred (100) ml of a 1.00 M solution of HCl is diluted with water to prepare a 0.200 M solution. What is the volume of the resulting 0.200 M solution? Or asked another way, to what volume must the original solution be diluted? (3 points) 2) Lithium hydroxide, LiOH, is used in spacecraft to absorb the carbon dioxide exhaled by astronauts. Given 1.3 kg of LiOH, how many kg of CO2 can be absorbed? (10 Pts. The reaction...
Dalton's Law of Partial Pressures can be used to simplify gas stoichiometry problems. As a derivative of the ideal gas law, Dalton's Law assumes that gas particles are featureless little billi...
Dalton's Law of Partial Pressures can be used to simplify gas stoichiometry problems. As a derivative of the ideal gas law, Dalton's Law assumes that gas particles are featureless little billiard balls, bouncing off each other and the walls of their container. Because of the assumption of ideality, 20 moles of helium, a mixture of 16 moles of nitrogen and 4 moles of oxygen, or a mixture of 10 moles of water vapor, 8 moles of carbon dioxide, and 2...
One method of sequestering Co, in spacecraft is allowing the Co, to react with LiOH to produce Li,Co, and H.O. The balanced chemical equation is: CO2 (g) + 2 LiOH (s) - LigCO3 (8) + H2O (g) If 69.6 g of LiOH is allowed to react with excess Co, what is the theoretical yield in grams of Li,CO, that would be formed? Select one: The theoretical yield of Li2CO3 is 107 grams. O The theoretical yield of LI2CO3 is 429...
One method of sequestering CO2 in spacecraft is allowing the CO2 to react with LIOH to produce Li2CO3 and H2O. CO2(g) + 2 LiOH (s) — LizCO(s) + H20 (9) If 30.0 g of LiOH is allowed to react with excess CO2, what is the theoretical yield in grams of LiaCO3 that would be formed? Alter the above experiment with 30.0 g of LIOH has been performed, a technician determines the mass of the LICO, product to be 25.4 grams....
s/u-113891266fe161c2cccf940493cd3b01bd36952/MyFiles/Downloads/HW-200420-%20Spring 202020220(1).pdf 5.(3 points) Alkali metal hydroxides are sometimes used to "scrub" excess carbon dioxide from the air in closed spaces (such as submarines and spacecraft). For example, lithium hydroxide reacts with carbon dioxide according to the unbalanced chemical equation LIOH(s) + CO. (8) LICO, (s) + H2O (O) Suppose a lithium hydroxide canister contains 155 g of LIOH(s). What mass of Co, (8) will the canister be able to absorb? If it is found that after 24 hours of...
1) One hundred (100) ml of a 1.00 M solution of HCl is diluted with water to prepare a 0.200 M solution. What is the volume of the resulting 0.200 M solution? Or asked another way, to what volume must the original solution be diluted? (3 points) 2) Lithium hydroxide, LiOH, is used in spacecraft to absorb the carbon dioxide exhaled by astronauts. Given 1.3 kg of LiOH, how many kg of CO2 can be absorbed? (10 Pts. The reaction...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 38 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 6 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 6 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago