What salt is formed in the reaction of aluminum with hydrochloric acid? Write the formula of...
What salt is formed in the reaction of aluminum with hydrochloric acid? Write the formula of the salt.
Homework Answers
When aluminium reacts with hydrochloric acid , aluminium chloride and hydrogen gas is formed . Balanced equation can be written as :
2Al(s) + 6HCl(aq) = 2AlCl3(aq) + 3H2(g).
So salt formed is aluminium chloride.
Add Answer to:
What salt is formed in the reaction of aluminum with
hydrochloric acid? Write the formula of...
What salt is formed in the reaction of aluminum with hydrochloric acid? Write the formula of...
What salt is formed in the reaction of aluminum with hydrochloric acid? Write the formula of the salt. Formaula:
Write the formula of the salt formed by the neutralization of magnesium hydroxide and phosphoric acid....
Write the formula of the salt formed by the neutralization of magnesium hydroxide and phosphoric acid. Write the formula of the salt formed by the neutralization of iron(Il) hydroxide and hydrofluoric acid.
What is the formula for the salt formed? Previous Answers Correct Part B When the reaction...
What is the formula for the salt formed?
Previous Answers Correct Part B When the reaction H3P04 (aq) + Ca(OH), (aq)- occurs, what is the formula for the salt formed? r as a chemical formula. View Available Hint(s) Submit Part C Consider the diagram. (Figure 1) The red spheres represent the anin
questions 4 through 8 use the following reaction between Aluminum and hydrochloric acid 2 Al(s) +...
questions 4 through 8 use the following reaction between Aluminum and hydrochloric acid 2 Al(s) + 6 HCI (aq) → 2 AICI: (aq) + 3 H2(g) When 3.95 moles aluminum reacts with excess hydrochloric acid how many moles of hydrogen gas form? When 10.6 moles hydrochloric acid reacts with excess aluminum how many moles of hydrogen gas form? When 3.95 moles aluminum reacts with 10.6 moles hydrochloric acid how many moles of hydrogen gas form? What is the theoretical yield...
The reaction between hydrochloric acid and aluminum produces hydrogen gas and aluminum chloride. The balanced reaction...
The reaction between hydrochloric acid and aluminum produces hydrogen gas and aluminum chloride. The balanced reaction equation is given below. How many motes of H_2 can be obtained when 7.80 mol HCl reacts with an excess of Al? 6HCl + 2Al rightarrow 3H_2 + 2AlCl_3
Copper + Hydrochloric acid g) h) Zinc + Hydrochloric acid Aluminum + Hydrochloric acid i) Hydrogen...
Copper + Hydrochloric acid g) h) Zinc + Hydrochloric acid Aluminum + Hydrochloric acid i) Hydrogen Peroxide (catalyzed by light)- i) k) Acetic acid + Copper Platinum + Hydrochloric acid I)
Copper + Hydrochloric acid g) h) Zinc + Hydrochloric acid Aluminum + Hydrochloric acid i) Hydrogen Peroxide (catalyzed by light)- i) k) Acetic acid + Copper Platinum + Hydrochloric acid I)
Calculate the mass of water formed when 0.706 g of aluminum hydroxide reacts with excess hydrochloric...
Calculate the mass of water formed when 0.706 g of aluminum hydroxide reacts with excess hydrochloric acid according to the following reaction. Al(OH)3(s) + 3HCl(aq) - AlCl3(aq) + 3H2O(1) Your Answer: Answer Hinits
For the following reaction, 22.9 grams of hydrochloric acid are allowed to react with 57.2 grams...
For the following reaction, 22.9 grams of hydrochloric acid are allowed to react with 57.2 grams of barium hydroxide. hydrochloric acid (aq) + barium hydroxide (aq) —barium chloride (aq) + water (1) What is the maximum amount of barium chloride that can be formed? grams What is the FORMULA for the limiting reagent? What amount of the excess reagent remains after the reaction is complete? grams
For the following reaction, 29.4 grams of hydrochloric acid are allowed to react with 59.3 grams...
For the following reaction, 29.4 grams of hydrochloric acid are allowed to react with 59.3 grams of barium hydroxide. hydrochloric acid (aq) + barium hydroxide (aq) — barium chloride (aq) + water (1) What is the maximum amount of barium chloride that can be formed? grams What is the FORMULA for the limiting reagent? What amount of the excess reagent remains after the reaction is complete? grams For the following reaction, 30.4 grams of zinc oxide are allowed to react...
Write the formula for the complex ion formed by the metal ion Cr3+ and six NO2- ions as ligands. Decide whether the complex could be isolated as a chloride salt or a potassium salt, and write the form...
Write the formula for the complex ion formed by the metal ion Cr3+ and six NO2- ions as ligands. Decide whether the complex could be isolated as a chloride salt or a potassium salt, and write the formula for the appropriate salt
Write the formula of the salt formed by the neutralization of magnesium hydroxide and phosphoric acid. Write the formula of the salt formed by the neutralization of iron(Il) hydroxide and hydrofluoric acid.
What is the formula for the salt formed?
Previous Answers Correct Part B When the reaction H3P04 (aq) + Ca(OH), (aq)- occurs, what is the formula for the salt formed? r as a chemical formula. View Available Hint(s) Submit Part C Consider the diagram. (Figure 1) The red spheres represent the anin
questions 4 through 8 use the following reaction between Aluminum and hydrochloric acid 2 Al(s) + 6 HCI (aq) → 2 AICI: (aq) + 3 H2(g) When 3.95 moles aluminum reacts with excess hydrochloric acid how many moles of hydrogen gas form? When 10.6 moles hydrochloric acid reacts with excess aluminum how many moles of hydrogen gas form? When 3.95 moles aluminum reacts with 10.6 moles hydrochloric acid how many moles of hydrogen gas form? What is the theoretical yield...
The reaction between hydrochloric acid and aluminum produces hydrogen gas and aluminum chloride. The balanced reaction equation is given below. How many motes of H_2 can be obtained when 7.80 mol HCl reacts with an excess of Al? 6HCl + 2Al rightarrow 3H_2 + 2AlCl_3
Copper + Hydrochloric acid g) h) Zinc + Hydrochloric acid Aluminum + Hydrochloric acid i) Hydrogen Peroxide (catalyzed by light)- i) k) Acetic acid + Copper Platinum + Hydrochloric acid I)
Copper + Hydrochloric acid g) h) Zinc + Hydrochloric acid Aluminum + Hydrochloric acid i) Hydrogen Peroxide (catalyzed by light)- i) k) Acetic acid + Copper Platinum + Hydrochloric acid I)
Calculate the mass of water formed when 0.706 g of aluminum hydroxide reacts with excess hydrochloric acid according to the following reaction. Al(OH)3(s) + 3HCl(aq) - AlCl3(aq) + 3H2O(1) Your Answer: Answer Hinits
For the following reaction, 22.9 grams of hydrochloric acid are allowed to react with 57.2 grams of barium hydroxide. hydrochloric acid (aq) + barium hydroxide (aq) —barium chloride (aq) + water (1) What is the maximum amount of barium chloride that can be formed? grams What is the FORMULA for the limiting reagent? What amount of the excess reagent remains after the reaction is complete? grams
For the following reaction, 29.4 grams of hydrochloric acid are allowed to react with 59.3 grams of barium hydroxide. hydrochloric acid (aq) + barium hydroxide (aq) — barium chloride (aq) + water (1) What is the maximum amount of barium chloride that can be formed? grams What is the FORMULA for the limiting reagent? What amount of the excess reagent remains after the reaction is complete? grams For the following reaction, 30.4 grams of zinc oxide are allowed to react...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 51 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago