7. Which reaction intermediate is formed when 4-methylcyclohexene reacts with Bez dissolved in CCL? [ Br...
8. Which reaction is not stereospecific? Br2/CCI trans-2-Butene Br2/H2O cis-2-Pentene п trans-2-Hexene HBr III D2/Pd 1-Methylcyclohexene IV
9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF CN II II IV 10. Which of the following methods would be expected to efficiently produce cis-2-butene as the major organic product? a. CH3C CCH3 + H2, Pt b. CH3CHBrCH2CH3+(CHs)3COK/(CH3); COH c. CH3C CCH +H2, Ni2B (P-2) d. CH3C CCH +Na, NH3() 11. Which of the following is the structure for (2E,4E)-octa-2,4-dien-6-yne? IV ш п