Homework Answers
i
hope my answer will satisfied you
Add Answer to:
Please, answer both questions.
33. Write the mass balance equations for a solution of 0.4 M...
questions 32-36 please 32. Write the charge balance equation for a 0.3 M Li2HPO4 salt solution....
questions 32-36 please
32. Write the charge balance equation for a 0.3 M Li2HPO4 salt solution. 33. Write the mass balance equations for a solution of 0.4 M KHCO3 and 0.5 M Na2CO3. 34. What volume of 0.369 M sodium hydroxide is required to titrate 50.00 mL of 0.654 M HBr(ag), hydrobromic acid, to the equivalence point? 35. A 25.00 mL sample of 0.100 M acetic acid is titrated with 0.050 M NaOH. Consider the titration curve, and predict the...
Write the charge balance equation for 0.3 M Li2HPO4 Write the mass balance equation for a...
Write the charge balance equation for 0.3 M
Li2HPO4
Write the mass balance equation for a solution of 0.4 M KHCO3 and
0.5 M Na2CO3
Write the charge balance equation for a 0.3 M LiHPO, salt solution. Write the mass balance equations for a solution of 0.4 M KHCO3 and 0.5 M Na,C03. VLL....menfo 200 M codium hydroxide is required to titrate 50.00 mL of 0.654 M HBr(ag),
answer all 4 please!!! What volume of a 0.263 M perchloric acid solution is required to...
answer all 4 please!!!
What volume of a 0.263 M perchloric acid solution is required to neutralize 22.5 mL of a 0.150 M calcium hydroxide solution? mL perchloric acid What volume of a 0.122 M potassium hydroxide solution is required to neutralize 16.2 mL of a 0.288 M hydrochloric acid solution? mL potassium hydroxide An aqueous solution of calcium hydroxide is standaridized by titration with a 0.199 M solution of hydroxide acid. If 12.6 mL of base are required to...
What volume of a 0.333 M hydrobromic acid solution is required to neutralize 24.7 mL of...
What volume of a 0.333 M hydrobromic acid solution is required to neutralize 24.7 mL of a 0.152 M barium hydroxide solution? mL hydrobromic acid Submit Answer Retry Entire Group 6 more group attempts remaining What volume of a 0.207 M hydroiodic acid solution is required to neutralize 24.3 mL of a 0.183 M potassium hydroxide solution? mL hydroiodic acid Submit Answer Retry Entire Group 6 more group attempts remaining What volume of a 0.161 M sodium hydroxide solution is...
Part A When titrated with a 0.1198 M solution of sodium hydroxide, a 58.00 mL solution...
Part A When titrated with a 0.1198 M solution of sodium hydroxide, a 58.00 mL solution of an unknown polyprotic acid required 20.15 mL to reach the first equivalence point. Calculate the molar concentration of the unknown acid. O A¢ * R O ? Submit Request Answer Part B The titration curve was found to have three equivalence points. What volume of the sodium hydroxide solution was necessary to fully titrate the unknown acid solution? IVO ADD A O O...
2. Calculate the mass of KHP needed to react completely with 15 mL of a 0.10 M NaOH solution. Consider the reaction...
2. Calculate the mass of KHP needed to react completely with 15 mL of a 0.10 M NaOH solution. Consider the reaction equation to be as shown below, molar mass of KHP is 204.3g/mol 3. Calculate the molarity of a solution of sodium hydroxide if 23.64 mL of this solution is needed to neutralize 0.5632 g of KHP. 4. It is found that 24.68 mL of 0.1165 M NaOH is needed to titrate 0.2931 g of unknown monoprotic acid to...
You need to prepare 200 mL of a 0.4 M solution of ammonium hydroxide (NH4OH) You...
You need to prepare 200 mL of a 0.4 M solution of ammonium hydroxide (NH4OH) You have 80 mL of a 0.5 M NHOH solution and 40 mL of a 7.5% (w/v) NH4OH solution. What volume of 7.5% NHOH and water needs to be added to the 80 mL of 0.5 M NH4OH solution to make up 200 mL of 0.4 M NH4OH? Molar mass of NH4OH 35.04 g/mol % (weight / volume) means mass (in g) in volume (100...
2. Calculate the mass of solid sodium hydroxide needed to prepare 300 mL of 0.1 M...
2. Calculate the mass of solid sodium hydroxide needed to prepare 300 mL of 0.1 M sodium hydroxide. Note: Be sure to include this mass in the procedure for Part C. 3. A 0.6250 g sample of KHP (204.2 g/mol), dissolved in 50 mL water, required 28.50 mL of sodium hydroxide to reach the end point. What is the concentration of the sodium hydroxide solution? 4. A 25.00 mL sample of hydrochloric acid was titrated using the same sodium hydroxide...
Answer both questions please Suppose a sodium hydroxide solution is to be standardized against pure, solid, primary-...
Answer both questions please
Suppose a sodium hydroxide solution is to be standardized against pure, solid, primary-standard grade KHP. If 0.4538 g of KHP requires 44.12 mL of the sodium hydroxide solution to reach a phenolphthalein endpoint, what is the molarity of the NaOH solution? Show your calculations. 5. If 36.32 mL of the NaOH solution described in question 4 was required to titrate a 5.00 mL sample of vinegar, calculate the molarity of acetic acid in the vinegar. Show...
please help with this question. Extra credit Homework on Acid-Base Titration You can use the technique...
please help with this question.
Extra credit Homework on Acid-Base Titration You can use the technique of titration to determine the concentration of a mixture of sodium carbonate and sodium bicarbonate. Titration is performed using a solution with a known concentration of hydrochloric acid (HCI). During the titration, HCl reduces gradually the alkalinity of the solution until the pH is acid. The reaction occurs in two stages in the first part you titrate the total amount of carbonates present in...
questions 32-36 please
32. Write the charge balance equation for a 0.3 M Li2HPO4 salt solution. 33. Write the mass balance equations for a solution of 0.4 M KHCO3 and 0.5 M Na2CO3. 34. What volume of 0.369 M sodium hydroxide is required to titrate 50.00 mL of 0.654 M HBr(ag), hydrobromic acid, to the equivalence point? 35. A 25.00 mL sample of 0.100 M acetic acid is titrated with 0.050 M NaOH. Consider the titration curve, and predict the...
Write the charge balance equation for 0.3 M
Li2HPO4
Write the mass balance equation for a solution of 0.4 M KHCO3 and
0.5 M Na2CO3
Write the charge balance equation for a 0.3 M LiHPO, salt solution. Write the mass balance equations for a solution of 0.4 M KHCO3 and 0.5 M Na,C03. VLL....menfo 200 M codium hydroxide is required to titrate 50.00 mL of 0.654 M HBr(ag),
answer all 4 please!!!
What volume of a 0.263 M perchloric acid solution is required to neutralize 22.5 mL of a 0.150 M calcium hydroxide solution? mL perchloric acid What volume of a 0.122 M potassium hydroxide solution is required to neutralize 16.2 mL of a 0.288 M hydrochloric acid solution? mL potassium hydroxide An aqueous solution of calcium hydroxide is standaridized by titration with a 0.199 M solution of hydroxide acid. If 12.6 mL of base are required to...
What volume of a 0.333 M hydrobromic acid solution is required to neutralize 24.7 mL of a 0.152 M barium hydroxide solution? mL hydrobromic acid Submit Answer Retry Entire Group 6 more group attempts remaining What volume of a 0.207 M hydroiodic acid solution is required to neutralize 24.3 mL of a 0.183 M potassium hydroxide solution? mL hydroiodic acid Submit Answer Retry Entire Group 6 more group attempts remaining What volume of a 0.161 M sodium hydroxide solution is...
Part A When titrated with a 0.1198 M solution of sodium hydroxide, a 58.00 mL solution of an unknown polyprotic acid required 20.15 mL to reach the first equivalence point. Calculate the molar concentration of the unknown acid. O A¢ * R O ? Submit Request Answer Part B The titration curve was found to have three equivalence points. What volume of the sodium hydroxide solution was necessary to fully titrate the unknown acid solution? IVO ADD A O O...
2. Calculate the mass of KHP needed to react completely with 15 mL of a 0.10 M NaOH solution. Consider the reaction equation to be as shown below, molar mass of KHP is 204.3g/mol 3. Calculate the molarity of a solution of sodium hydroxide if 23.64 mL of this solution is needed to neutralize 0.5632 g of KHP. 4. It is found that 24.68 mL of 0.1165 M NaOH is needed to titrate 0.2931 g of unknown monoprotic acid to...
You need to prepare 200 mL of a 0.4 M solution of ammonium hydroxide (NH4OH) You have 80 mL of a 0.5 M NHOH solution and 40 mL of a 7.5% (w/v) NH4OH solution. What volume of 7.5% NHOH and water needs to be added to the 80 mL of 0.5 M NH4OH solution to make up 200 mL of 0.4 M NH4OH? Molar mass of NH4OH 35.04 g/mol % (weight / volume) means mass (in g) in volume (100...
2. Calculate the mass of solid sodium hydroxide needed to prepare 300 mL of 0.1 M sodium hydroxide. Note: Be sure to include this mass in the procedure for Part C. 3. A 0.6250 g sample of KHP (204.2 g/mol), dissolved in 50 mL water, required 28.50 mL of sodium hydroxide to reach the end point. What is the concentration of the sodium hydroxide solution? 4. A 25.00 mL sample of hydrochloric acid was titrated using the same sodium hydroxide...
Answer both questions please
Suppose a sodium hydroxide solution is to be standardized against pure, solid, primary-standard grade KHP. If 0.4538 g of KHP requires 44.12 mL of the sodium hydroxide solution to reach a phenolphthalein endpoint, what is the molarity of the NaOH solution? Show your calculations. 5. If 36.32 mL of the NaOH solution described in question 4 was required to titrate a 5.00 mL sample of vinegar, calculate the molarity of acetic acid in the vinegar. Show...
please help with this question.
Extra credit Homework on Acid-Base Titration You can use the technique of titration to determine the concentration of a mixture of sodium carbonate and sodium bicarbonate. Titration is performed using a solution with a known concentration of hydrochloric acid (HCI). During the titration, HCl reduces gradually the alkalinity of the solution until the pH is acid. The reaction occurs in two stages in the first part you titrate the total amount of carbonates present in...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 44 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago