Homework Answers
OH но What is the relationship between each two? 0 он он о сн 20н н...
OH но What is the relationship between each two? 0 он он о сн 20н н — он НО — Н СН2ОН не он 4 NH
can you explain what is the reaction of this and why? thank you! НС—о—с—(CH),— CH—CH-CH— СH— CH-(CH)4 С3 +5 H2/catal...
can you explain what is the reaction of this and why? thank
you!
НС—о—с—(CH),— CH—CH-CH— СH— CH-(CH)4 С3 +5 H2/catalyst - Н-С-0—С— (CH2)7— СH—СH—(CH)7—СН3 о НаС—о—С—(CH),— СH3CH-CH,—CH—СН-(CH2)4-CH3 Trglayarde CH-OH
Question 5 (1 point) which molecule below contains t bond electrons that are not delocalized in a conjugated system ext...
Question 5 (1 point) which molecule below contains t bond electrons that are not delocalized in a conjugated system extending over multiple atoms? НС НС. FCH CH NH НС CH OH но HO CH Hас он СH Н CHз CH CH CH Cн. Нас -сH CH Он Сн Hас CH2 н н О Н Н н т. т
Which reaction is the saponification of a fat? о | ОН 0-C(CH 216CHз о Н,0* +3H-C(CH216CH3...
Which reaction is the saponification of a fat? о | ОН 0-C(CH 216CHз о Н,0* +3H-C(CH216CH3 -он (CH 226 -o-C(CH2H6CH? -о-еснәһесн, -он ІІ ОН Hot о +3 но-с(СН2)16CH3 0-C(СН2)16CH3 о -o-c(СН2)16CH3 0 -o-C(СН2)16CH3 -ОН | -ОН о П он 0 + 3 *NaO-C(CH2) ECH 1 NaOH -o-c(СН2)16CH3 о -o-c(СН2)46CH3 о -o-c(СН2)16CH3 ОН -с ОН
What is the major Organic product of the following reaction? o CH N OH O NH...
What is the major Organic product of the following reaction? o CH N OH O NH CH; woon OCH; (a) (b) (c) N NH, CH; (d) ce Considering both regiochemistry and stereochemistry, what is the major Organic product of the following reaction? о H,C, 1) -MgCI 2) Н,0* ОН ОН нс ОН не КА HC ІН (b) (c) CH ОН H О Н HC H нс, What is the major Organic product of the following sequence of reactions? 1) NaH,...
2. Predict the product. CH,CH2NH2 1. LIAIH NH 2. H20 Н,о" Br КОН NH 1. excess...
2. Predict the product. CH,CH2NH2 1. LIAIH NH 2. H20 Н,о" Br КОН NH 1. excess CH3I 2. Ag20, H20 heat
6. Predict the major products for the ozonolysis reactions shown below.. 1.O 2. Н,О, Н,О, 1....
6. Predict the major products for the ozonolysis reactions shown below.. 1.O 2. Н,О, Н,О, 1. O 2. DMS 7. Identify the reagent(s) that you would need to accomplish the following transformations. гон (ii)
ЕОC Problem 11.030 a. Draw the products formed when the triglyceride is saponified. Enter your answers from largest mas...
ЕОC Problem 11.030 a. Draw the products formed when the triglyceride is saponified. Enter your answers from largest mass to smallest mass. сH,(CH,),СH-CHCH), С -осн, CH2(CH)12 C OCH II CH,(CH), CH-CHCH,), С- -осн, Your answer is partially correct. Try again нс Na Edit Product 1 (largest molecular mass product) НаС Na Edit Product 2 O O O=O Edit Na Н,с. Product 3 -OH -Он Edit -OH Product 4 (smallest molecular mass product) Choose the drawings of a trans fat that...
please help. thanks in advance! 6 Which of the following arrows correctly points to the anomeric carbon? 7. Of the following, what is the most likely reason that cooking with Nutrasweet (Aspartam...
please help. thanks in advance!
6 Which of the following arrows correctly points to the anomeric carbon? 7. Of the following, what is the most likely reason that cooking with Nutrasweet (Aspartame) destroys the sweetness? HO-C-CH2-CH-C-N-CH-C-OCH NH2 CH2-CsHs Aspartame 8. A heptapeptide containing 2 alanine residues and one each of glutamine, phenylalanine, roline, tyrosine and valine was analyzed as follows: 1. Treatmen w 2,4-dinitrofluorobenzene followed by complete hydrolysis yielded 2,4-dinitrophenylalanine. 2. Partial hydrolysis with aqueous acid yielded the following fragments:...
Name the functional groups for Carbon 1 and Carbon 6 on both structures. С— н 1...
Name the functional groups for Carbon 1 and Carbon 6
on both structures.
С— н 1 6 CH2OH Н. -ОН н -о он Он но- H -н 1 ndieoue n он -ОН H H Он -ОН 6 CH-он I
OH но What is the relationship between each two? 0 он он о сн 20н н — он НО — Н СН2ОН не он 4 NH
can you explain what is the reaction of this and why? thank
you!
НС—о—с—(CH),— CH—CH-CH— СH— CH-(CH)4 С3 +5 H2/catalyst - Н-С-0—С— (CH2)7— СH—СH—(CH)7—СН3 о НаС—о—С—(CH),— СH3CH-CH,—CH—СН-(CH2)4-CH3 Trglayarde CH-OH
Question 5 (1 point) which molecule below contains t bond electrons that are not delocalized in a conjugated system extending over multiple atoms? НС НС. FCH CH NH НС CH OH но HO CH Hас он СH Н CHз CH CH CH Cн. Нас -сH CH Он Сн Hас CH2 н н О Н Н н т. т
Which reaction is the saponification of a fat? о | ОН 0-C(CH 216CHз о Н,0* +3H-C(CH216CH3 -он (CH 226 -o-C(CH2H6CH? -о-еснәһесн, -он ІІ ОН Hot о +3 но-с(СН2)16CH3 0-C(СН2)16CH3 о -o-c(СН2)16CH3 0 -o-C(СН2)16CH3 -ОН | -ОН о П он 0 + 3 *NaO-C(CH2) ECH 1 NaOH -o-c(СН2)16CH3 о -o-c(СН2)46CH3 о -o-c(СН2)16CH3 ОН -с ОН
What is the major Organic product of the following reaction? o CH N OH O NH CH; woon OCH; (a) (b) (c) N NH, CH; (d) ce Considering both regiochemistry and stereochemistry, what is the major Organic product of the following reaction? о H,C, 1) -MgCI 2) Н,0* ОН ОН нс ОН не КА HC ІН (b) (c) CH ОН H О Н HC H нс, What is the major Organic product of the following sequence of reactions? 1) NaH,...
2. Predict the product. CH,CH2NH2 1. LIAIH NH 2. H20 Н,о" Br КОН NH 1. excess CH3I 2. Ag20, H20 heat
6. Predict the major products for the ozonolysis reactions shown below.. 1.O 2. Н,О, Н,О, 1. O 2. DMS 7. Identify the reagent(s) that you would need to accomplish the following transformations. гон (ii)
ЕОC Problem 11.030 a. Draw the products formed when the triglyceride is saponified. Enter your answers from largest mass to smallest mass. сH,(CH,),СH-CHCH), С -осн, CH2(CH)12 C OCH II CH,(CH), CH-CHCH,), С- -осн, Your answer is partially correct. Try again нс Na Edit Product 1 (largest molecular mass product) НаС Na Edit Product 2 O O O=O Edit Na Н,с. Product 3 -OH -Он Edit -OH Product 4 (smallest molecular mass product) Choose the drawings of a trans fat that...
please help. thanks in advance!
6 Which of the following arrows correctly points to the anomeric carbon? 7. Of the following, what is the most likely reason that cooking with Nutrasweet (Aspartame) destroys the sweetness? HO-C-CH2-CH-C-N-CH-C-OCH NH2 CH2-CsHs Aspartame 8. A heptapeptide containing 2 alanine residues and one each of glutamine, phenylalanine, roline, tyrosine and valine was analyzed as follows: 1. Treatmen w 2,4-dinitrofluorobenzene followed by complete hydrolysis yielded 2,4-dinitrophenylalanine. 2. Partial hydrolysis with aqueous acid yielded the following fragments:...
Name the functional groups for Carbon 1 and Carbon 6
on both structures.
С— н 1 6 CH2OH Н. -ОН н -о он Он но- H -н 1 ndieoue n он -ОН H H Он -ОН 6 CH-он I
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago