Homework Answers
Add Answer to:
8. Which of the following molecules has an R configuration? Both (a) and (b). CH2NH2 с....
Which of the following molecules has an S configuration? 8. SH a. CH BrH2C "CH-он CH2SH...
Which of the following molecules has an S configuration? 8. SH a. CH BrH2C "CH-он CH2SH CH Вr b. "CHон c. both (a) and (b). d. neither (a) nor (b). Jesl ecorrect order of priorities in the R,S system?
having trouble with R and S configuration, can someone help out with this sheet? 17 Br>Cl'7...
having trouble with R and S configuration, can someone help out
with this sheet?
17 Br>Cl'7 S"7 F>ONTO77i77 H 1. Determine the configuration (R or S) of each of the following molecules: (Ph phenyl, a benzene ring as a group) CH-CH3 b. CHs с. но NH2 d. он COOH Ph H Hас CH2CH3 H2N CH&CH NH2 NH2 f. Ph CH3 Ph CHs h. H i. OH c lCOOH н.сн,с F Н.с NH2 h. COOH CHs CH2CH H2N 2. Label the...
3. Assign R or S configuration to the chirality centers of the following molecules. ҫн, сн,...
3. Assign R or S configuration to the chirality centers of the following molecules. ҫн, сн, b) но н H Br COOH c) H CH COOH CH,CH н. сн,Cн он HO d) H Br H Br h) CH CH,о, g) HO Н СООН CH hway.com
4. Assign R or S configuration to each chiral center in each of the following molecules...
4. Assign R or S configuration to each chiral center in each of the following molecules (A-D). Which are enantiomers and which are diastereoisomer? Hint: redraw the molecules if it makes it easier to visualize or use a modeling kit. H H A В CH Br Hас, Br 'CHs Нo Hас H он Br Br D CHз Hас Н. "CHз но Он CH3
Question 5 1 pts Which one of the following molecules is chiral and has R configuration?
Question 5 1 pts Which one of the following molecules is chiral and has R configuration?
9. Determine the R/S configuration for Structure A and B. What is the relationship between the...
9. Determine the R/S configuration for Structure A and B. What is the relationship between the structures? A: н =0 B: Н-с-он Он он Но 6 но-с-н Н-С-ОН ОН ОНн H-C-OH CH2OH Which of the following Lewis structures of protonated methanamide is incomplete? H .н H H C NH2 н NH2 H-C NH2 н н" NH2 Which of the following compounds has an ionic bond? a) H.O b) NH.C c) CH.CI d) CH.Li 2. Draw all resonance structures of each...
5. Assign R or S configuration to each indicated chirality center (carbon A and B) in...
5. Assign R or S configuration to each indicated chirality center (carbon A and B) in the following molecule (vitamin C). Which of the following assignments is correct B но но OH но H se A a. carbon A (S); carbon B (R) b. carbon A (R); carbon B (R) c. carbon A (R); carbon B (S) d. carbon A (S); carbon B (S) 6. Which of the following statement is NOT correct? a Constitutional isomers are compounds whose atoms...
Consider the following molecules: b. а. CHS CH3 O NH— CH—CH2—ОН NH2-CH-C-OH CHз d. C. CHз...
Consider the following molecules: b. а. CHS CH3 O NH— CH—CH2—ОН NH2-CH-C-OH CHз d. C. CHз о Но-СН—С—ОН НО—С—С—С—ОН CH3 [Select ] i. Which of the molecules above is a secondary amine? ii. Which of the molecules above will be a zwitterion under physiological conditions (pH 7)? (Select) [Select ] ii. Which of the molecules above has two acidic protons?
star each asymmetric carbon atom in the following examples & determine whether it has the R...
star each asymmetric carbon atom in the following examples
& determine whether it has the R or S configuration
PROBLEM 5-6 Star () each asymmetric carbon atom in the following examples, and determine whether it has the (R) or (S) configuration. сн, Н Н H CH, (c) H. (a) (b) Br но с, CH сH CH, CH,CH НС н н CH, Н (d) (e) (D Н Н Cl H Cl Cl СНO (g) (h) ("i) CH CH, (CH,O),CH CH(CH), D...
Determine the enantiomeric excess (1) and indicate which configuration (2), S or R, is in excess....
Determine the enantiomeric excess (1) and indicate which configuration (2), S or R, is in excess. If R-3-bromo-2- methylhexane is -80 degrees, would a polarimetry reading of the mixture in this problem rotate light (3) clockwise (CW) or counterclockwise (CC) (8) Br Br 15% 85% (this question is worth 9 points, not 8 as stated in the picture) 1. determine enantiomeric excess (your answer should be a number) 2. determine whether excess is S or R. 3. Does the mixture...
Which of the following molecules has an S configuration? 8. SH a. CH BrH2C "CH-он CH2SH CH Вr b. "CHон c. both (a) and (b). d. neither (a) nor (b). Jesl ecorrect order of priorities in the R,S system?
having trouble with R and S configuration, can someone help out
with this sheet?
17 Br>Cl'7 S"7 F>ONTO77i77 H 1. Determine the configuration (R or S) of each of the following molecules: (Ph phenyl, a benzene ring as a group) CH-CH3 b. CHs с. но NH2 d. он COOH Ph H Hас CH2CH3 H2N CH&CH NH2 NH2 f. Ph CH3 Ph CHs h. H i. OH c lCOOH н.сн,с F Н.с NH2 h. COOH CHs CH2CH H2N 2. Label the...
3. Assign R or S configuration to the chirality centers of the following molecules. ҫн, сн, b) но н H Br COOH c) H CH COOH CH,CH н. сн,Cн он HO d) H Br H Br h) CH CH,о, g) HO Н СООН CH hway.com
4. Assign R or S configuration to each chiral center in each of the following molecules (A-D). Which are enantiomers and which are diastereoisomer? Hint: redraw the molecules if it makes it easier to visualize or use a modeling kit. H H A В CH Br Hас, Br 'CHs Нo Hас H он Br Br D CHз Hас Н. "CHз но Он CH3
Question 5 1 pts Which one of the following molecules is chiral and has R configuration?
9. Determine the R/S configuration for Structure A and B. What is the relationship between the structures? A: н =0 B: Н-с-он Он он Но 6 но-с-н Н-С-ОН ОН ОНн H-C-OH CH2OH Which of the following Lewis structures of protonated methanamide is incomplete? H .н H H C NH2 н NH2 H-C NH2 н н" NH2 Which of the following compounds has an ionic bond? a) H.O b) NH.C c) CH.CI d) CH.Li 2. Draw all resonance structures of each...
5. Assign R or S configuration to each indicated chirality center (carbon A and B) in the following molecule (vitamin C). Which of the following assignments is correct B но но OH но H se A a. carbon A (S); carbon B (R) b. carbon A (R); carbon B (R) c. carbon A (R); carbon B (S) d. carbon A (S); carbon B (S) 6. Which of the following statement is NOT correct? a Constitutional isomers are compounds whose atoms...
Consider the following molecules: b. а. CHS CH3 O NH— CH—CH2—ОН NH2-CH-C-OH CHз d. C. CHз о Но-СН—С—ОН НО—С—С—С—ОН CH3 [Select ] i. Which of the molecules above is a secondary amine? ii. Which of the molecules above will be a zwitterion under physiological conditions (pH 7)? (Select) [Select ] ii. Which of the molecules above has two acidic protons?
star each asymmetric carbon atom in the following examples
& determine whether it has the R or S configuration
PROBLEM 5-6 Star () each asymmetric carbon atom in the following examples, and determine whether it has the (R) or (S) configuration. сн, Н Н H CH, (c) H. (a) (b) Br но с, CH сH CH, CH,CH НС н н CH, Н (d) (e) (D Н Н Cl H Cl Cl СНO (g) (h) ("i) CH CH, (CH,O),CH CH(CH), D...
Determine the enantiomeric excess (1) and indicate which configuration (2), S or R, is in excess. If R-3-bromo-2- methylhexane is -80 degrees, would a polarimetry reading of the mixture in this problem rotate light (3) clockwise (CW) or counterclockwise (CC) (8) Br Br 15% 85% (this question is worth 9 points, not 8 as stated in the picture) 1. determine enantiomeric excess (your answer should be a number) 2. determine whether excess is S or R. 3. Does the mixture...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 8 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 39 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago