Homework Answers
16. (a)The bigger the size of atom, the longer will the distance of bonds be. Among Ga and B, Ga is bigger in size so B-Cl has shorter distance.
(b) P-O has shorter bond because size of O is smaller than size of S.
17. The electronegative values of atoms are:
B= 2.04
O=3.44
P=2.19
S=2.58
N=3.04
H=2.2
F=3.98
Cl=3.16
Larger the difference between the electronegativity, more polar will the bond be.
Add Answer to:
h) F3 16. For each pair of bonds, predict which is the shorter. Simply explain your...
1. A. Put the following atoms in order of increasing electronegativity Br N Н B. Using the atoms above, which pair of a...
1. A. Put the following atoms in order of increasing electronegativity Br N Н B. Using the atoms above, which pair of atoms will create the most polar bond? C. Put the bonds below in order from least to greatest bond polarity С-Н N-H Н-Br D. Explain how you arrived at your answers to B and C 2. A. For the following Lewis structures, determine the formal charge on all of the atoms in the structure H H O :...
Based on electronegativity values, would you expect the individual bonds in BF_3 and NH_3 polar? (A...
Based on electronegativity values, would you expect the individual bonds in BF_3 and NH_3 polar? (A table of electronegativity values can be found on p. 191 of the textbook.) B-F (yes/no) N-H (yes/no) Which bond should be more polar, B-F or N-H? In the boxes below, sketch each molecule and label all the atoms with delta+ or delta- to indicate the sign of the partial charge on every atom. Use the molecular geometries from part A, along with the concept...
Classify the bonds formed between each pair of elements based on electronegativity values in the following...
Classify the bonds formed between each pair of elements based on electronegativity values in the following table: Element Sc Be H P S I Br Cl O F Electronegativity 1.3 1.5 2.1 2.1 2.5 2.5 2.8 3.0 3.5 4.0 S-I,,,,,H-Br,,,,H-P,,,,S-O,,,,Be-F,,,,Be-Cl,,,,Sc-O Ionic: polar covalent: nonpolar covalent:
50. Predict which element in each of the following pairs is more electronegative according to the...
50. Predict which element in each of the following pairs is more electronegative according to the general trends in the peri- odic table. (a) Se or Br (b) Cor B (o Te or s (d) Ba or Be 72. Predict the electron pair geometry, the molecular shape, and the bond angle for a carbon tetrabromide molecule, CBra using VSEPR theory. VSEPR theory. 74. Predict the electron pair geometry, the molecular shape, and the bond angle for a phosphine molecule, PH),...
16/20 2 H+ + Ý: The Lewis representation above depicts a reaction between hydrogen (blue) and...
16/20
2 H+ + Ý: The Lewis representation above depicts a reaction between hydrogen (blue) and a main. group element from group (red) In this representation, each Y atom needs electron(s) to complete its octet, and gains these electrons by forming bond(s) with atoms of H. unshared electron pair(s) and bonding electron pair(s) in the product There are molecule. The bonds in the product are For each bond, show the direction of polarity by selecting the correct partial charges. Si-S...
72. Predict the electron pair geometry, the molecular shape, and the bond angle for a carbon...
72. Predict the electron pair geometry, the molecular shape, and the bond angle for a carbon tetrabromide molecule, CBra, using VSEPR theory. my VSEPR theory 74. Predict the electron pair geometry, the molecular shape, and the bond angle for a phosphine molecule, PH, using VSEPR theory. ecule even though it has four polar bonds. 78. Apply VSEPR theory to explain why SiF, is a nonpolar molecule even though it has four polar bonds. morin (D) O atom or Oion 26....
Question 4 3. (20 marks) Arrange the following elements in the order of: a) Increasing radius:...
Question 4
3. (20 marks) Arrange the following elements in the order of: a) Increasing radius: Cl', K*, Ar, Ca2*; b) Increasing radius: As, Br, P, Al; c) Increasing radius: N, S, F, Br; d) Increasing electron affinity: Si, P, Cl, C; e) Increasing ionization energy: Al, Rb, Mg, Ca, Mg 4. (20 marks) The following three Lewis structures can be drawn for N2O: N N-O :N-N=O:-:N=N=ö: a) Show the correct formal charges on each atom. Considering these values, which...
Chemistry problem help as soon as possible. 21. Which of the following has the bonds ranked...
Chemistry problem help as soon as possible.
21. Which of the following has the bonds ranked in correct order in tems of polarity, from the mo polar to the least polar? (bonds: O-S, N-H, F-S. O-H, and N-Br Electronegativity values F-40 o-3.5. N a. F-S, O-H, O-S, N-H, N-Br 30. Br#28,s-25,Hs21 b. O-H, F-S, O-S, N-Br, N-H e. None of the above is correct 22. Which of the following statements regarding covalent bonds is faise? a. Double bonds are formed...
Questions 3 and 4 3. (20 marks) Arrange the following elements in the order of: a) Increasing radius: Cl', K*, Ar, Ca2*...
Questions 3 and 4
3. (20 marks) Arrange the following elements in the order of: a) Increasing radius: Cl', K*, Ar, Ca2*; b) Increasing radius: As, Br, P, Al; c) Increasing radius: N, S, F, Br; d) Increasing electron affinity: Si, P, Cl, C; e) Increasing ionization energy: Al, Rb, Mg, Ca, Mg 4. (20 marks) The following three Lewis structures can be drawn for N2O: N N-O :N-N=O:-:N=N=ö: a) Show the correct formal charges on each atom. Considering these...
Please add explanation if you can Q1) What is the formal charge on each atom in...
Please add explanation if you can Q1) What is the formal charge on each atom in dichloromethane, CH2Cl2? a. C atom = 0, each H atom = 0, and each Cl atom = 0 b. C atom = –2, each H atom = +1, and two Cl atoms = 0 c. C atom = +4, each H = –1, and each Cl atom = –1 d. C atom = +4, each H = +1, and each Cl atom = –1...
1. A. Put the following atoms in order of increasing electronegativity Br N Н B. Using the atoms above, which pair of atoms will create the most polar bond? C. Put the bonds below in order from least to greatest bond polarity С-Н N-H Н-Br D. Explain how you arrived at your answers to B and C 2. A. For the following Lewis structures, determine the formal charge on all of the atoms in the structure H H O :...
Based on electronegativity values, would you expect the individual bonds in BF_3 and NH_3 polar? (A table of electronegativity values can be found on p. 191 of the textbook.) B-F (yes/no) N-H (yes/no) Which bond should be more polar, B-F or N-H? In the boxes below, sketch each molecule and label all the atoms with delta+ or delta- to indicate the sign of the partial charge on every atom. Use the molecular geometries from part A, along with the concept...
50. Predict which element in each of the following pairs is more electronegative according to the general trends in the peri- odic table. (a) Se or Br (b) Cor B (o Te or s (d) Ba or Be 72. Predict the electron pair geometry, the molecular shape, and the bond angle for a carbon tetrabromide molecule, CBra using VSEPR theory. VSEPR theory. 74. Predict the electron pair geometry, the molecular shape, and the bond angle for a phosphine molecule, PH),...
16/20
2 H+ + Ý: The Lewis representation above depicts a reaction between hydrogen (blue) and a main. group element from group (red) In this representation, each Y atom needs electron(s) to complete its octet, and gains these electrons by forming bond(s) with atoms of H. unshared electron pair(s) and bonding electron pair(s) in the product There are molecule. The bonds in the product are For each bond, show the direction of polarity by selecting the correct partial charges. Si-S...
72. Predict the electron pair geometry, the molecular shape, and the bond angle for a carbon tetrabromide molecule, CBra, using VSEPR theory. my VSEPR theory 74. Predict the electron pair geometry, the molecular shape, and the bond angle for a phosphine molecule, PH, using VSEPR theory. ecule even though it has four polar bonds. 78. Apply VSEPR theory to explain why SiF, is a nonpolar molecule even though it has four polar bonds. morin (D) O atom or Oion 26....
Question 4
3. (20 marks) Arrange the following elements in the order of: a) Increasing radius: Cl', K*, Ar, Ca2*; b) Increasing radius: As, Br, P, Al; c) Increasing radius: N, S, F, Br; d) Increasing electron affinity: Si, P, Cl, C; e) Increasing ionization energy: Al, Rb, Mg, Ca, Mg 4. (20 marks) The following three Lewis structures can be drawn for N2O: N N-O :N-N=O:-:N=N=ö: a) Show the correct formal charges on each atom. Considering these values, which...
Chemistry problem help as soon as possible.
21. Which of the following has the bonds ranked in correct order in tems of polarity, from the mo polar to the least polar? (bonds: O-S, N-H, F-S. O-H, and N-Br Electronegativity values F-40 o-3.5. N a. F-S, O-H, O-S, N-H, N-Br 30. Br#28,s-25,Hs21 b. O-H, F-S, O-S, N-Br, N-H e. None of the above is correct 22. Which of the following statements regarding covalent bonds is faise? a. Double bonds are formed...
Questions 3 and 4
3. (20 marks) Arrange the following elements in the order of: a) Increasing radius: Cl', K*, Ar, Ca2*; b) Increasing radius: As, Br, P, Al; c) Increasing radius: N, S, F, Br; d) Increasing electron affinity: Si, P, Cl, C; e) Increasing ionization energy: Al, Rb, Mg, Ca, Mg 4. (20 marks) The following three Lewis structures can be drawn for N2O: N N-O :N-N=O:-:N=N=ö: a) Show the correct formal charges on each atom. Considering these...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago