1. Predict the product(s) (or no reaction) and reagent(s). (31 pts; no partial point)
Homework Answers
Answer:-
j) PCC selectively oxidise alcohols to aldehydes/ketones, but doesn't oxidise aldehydes/ketones.
k) reaction of aldeyde + H2SO4/H2O is just a acid-base reaction.
m) Treatment of alcohol with MsCl/pyridine results the formation of mesylate(methane sulphonate), which in presence of LDA (base) undergoes elimination to form alkene.
-----------------
Add Answer to:
1. Predict the product(s) (or no reaction) and reagent(s). (31
pts; no partial point)
j. РСС...
1. Predict the product(s) (or no reaction) and reagent(s). (31 pts; no partial point) t ОН...
1. Predict the product(s) (or no reaction) and reagent(s). (31
pts; no partial point)
t ОН КаСr2О7 (ехсess) Н2SO4, H2O ОН НО Д 1. PhLi, Et2O 2. HСI, H2О 3. SOCI2, EtgN 4. NaOAc u. H 1. Mg (1 eq), Et20 V. Br 2. (1 еq) СНО 3. НС, Н2О W. 1. NaBH4, MeOН, 0° С 2. PBrз, THF 3. LIAID4, THF 4. HС, H20 ОН Х. 1. SOCI2, NEt3, THF 2. 2 eq Li, hexane 3. HСІ, Н2О СНО
1. Predict the product(s) (or no reaction) and reagent(s). (31 pts; no partial point) 1. Predict...
1. Predict the product(s) (or no reaction) and reagent(s). (31
pts; no partial point)
1. Predict the product(s) (or no reaction) and reagent(s). (31 pts; no partial point) LOH I 1. TsCI, pyridine 2. SNa SNa OH Nah or HBr 2 eq, 0 °C OH сон H2SO4 сHз heat Хон HBr heat
1. Predict the product (s) (or no reaction) and reagent(s). (31 pts; no partial point) 1....
1. Predict the product (s) (or no reaction) and reagent(s). (31 pts; no partial point) 1. TsCI, pyridine OH 2. SNa b. OH NaH C. HBr 2 eq, 0 °C d. ОН H2SO4 heat CH3 HBr Он heat f. но 1. PBr3, EtzO 2. NaCN OH NaH OTs h. Он HBr 0°C CH3 H2SO4 heat Он
1. Predict the product(s) (or no reaction) and reagent(s). j. ETOH Br heat k. Br NaOH DMSO NaCN Br DMF m. РСС Н n. О H2...
1. Predict the product(s) (or no reaction) and reagent(s).
j. ETOH Br heat k. Br NaOH DMSO NaCN Br DMF m. РСС Н n. О H2SO4, H20 Н
Predict the product(s) and reagent(s) or if there is no reaction write NR. OH K2Cr207 (excess)...
Predict the product(s) and reagent(s) or if there is no reaction
write NR.
OH K2Cr207 (excess) H2SO4, H20 "ОН 1. PhLi, Et20 2. HCI, HO 3. SOCl2, Et3N 4. NaOAC 1. Mg (1 eq), Et20 < Br 2. (1 eq) CHO 3. HCI, H2O MsCI LDA ОН pyridine 1. Nah 2. Br
1. Predict the product(s) (or no reaction) and reagent(s). (31 pts, no partial point) 1. TsCl, pyridine -OH SNa NaH...
1. Predict the product(s) (or no reaction) and reagent(s). (31 pts, no partial point) 1. TsCl, pyridine -OH SNa NaH HBO 2 eq, 0°C a Kon come de H2SO4 heat les сн.
1. Predict the product(s) (or no reaction) and reagent(s). (31 pts; no partial point) О. OMe...
1. Predict the product(s) (or no reaction) and reagent(s). (31
pts; no partial point)
О. OMe reagent(s) CI р. ОН reagent(s): ОН q. Br reagent(s): ОН r. ОН reagent(s): "OEt Br S. reagent(s): Br
1. Predict the product(s) (or no reaction) and reagent(s). (31 pts; no partial point) OMe O....
1. Predict the product(s) (or no reaction) and reagent(s). (31
pts; no partial point)
OMe O. reagent(s): CI р. ОН reagent(s): ОН q. Br reagent(s) Но reagent(s) r. ОН Br OEt S. reagent(s): Br
1. Predict the product(s) (or no reaction) and reagent(s). (31 pts; no partial point) ནོ། reagent(s):...
1. Predict the product(s) (or no reaction) and reagent(s). (31
pts; no partial point)
ནོ། reagent(s): oH reagent(s): oH reagent(s): oH OH reagent(s): Br OFT reagent(s);
1. Predict the product(s) (or no reaction) and reagent(s). (31 pts; no partial point) OTE hint:...
1. Predict the product(s) (or no reaction) and reagent(s). (31
pts; no partial point)
OTE hint: multiple steps 1. LiAlH4, THE 2. HCI, H2O 3. PBr3, THE CN a1. LOH 1. PCC, DCM 2. Mg, Et20 3. HCI, H20 1. MSCI, pyr 2. KO'Bu, BuOH
1. Predict the product(s) (or no reaction) and reagent(s). (31
pts; no partial point)
t ОН КаСr2О7 (ехсess) Н2SO4, H2O ОН НО Д 1. PhLi, Et2O 2. HСI, H2О 3. SOCI2, EtgN 4. NaOAc u. H 1. Mg (1 eq), Et20 V. Br 2. (1 еq) СНО 3. НС, Н2О W. 1. NaBH4, MeOН, 0° С 2. PBrз, THF 3. LIAID4, THF 4. HС, H20 ОН Х. 1. SOCI2, NEt3, THF 2. 2 eq Li, hexane 3. HСІ, Н2О СНО
1. Predict the product(s) (or no reaction) and reagent(s). (31
pts; no partial point)
1. Predict the product(s) (or no reaction) and reagent(s). (31 pts; no partial point) LOH I 1. TsCI, pyridine 2. SNa SNa OH Nah or HBr 2 eq, 0 °C OH сон H2SO4 сHз heat Хон HBr heat
1. Predict the product (s) (or no reaction) and reagent(s). (31 pts; no partial point) 1. TsCI, pyridine OH 2. SNa b. OH NaH C. HBr 2 eq, 0 °C d. ОН H2SO4 heat CH3 HBr Он heat f. но 1. PBr3, EtzO 2. NaCN OH NaH OTs h. Он HBr 0°C CH3 H2SO4 heat Он
1. Predict the product(s) (or no reaction) and reagent(s).
j. ETOH Br heat k. Br NaOH DMSO NaCN Br DMF m. РСС Н n. О H2SO4, H20 Н
Predict the product(s) and reagent(s) or if there is no reaction
write NR.
OH K2Cr207 (excess) H2SO4, H20 "ОН 1. PhLi, Et20 2. HCI, HO 3. SOCl2, Et3N 4. NaOAC 1. Mg (1 eq), Et20 < Br 2. (1 eq) CHO 3. HCI, H2O MsCI LDA ОН pyridine 1. Nah 2. Br
1. Predict the product(s) (or no reaction) and reagent(s). (31 pts, no partial point) 1. TsCl, pyridine -OH SNa NaH HBO 2 eq, 0°C a Kon come de H2SO4 heat les сн.
1. Predict the product(s) (or no reaction) and reagent(s). (31
pts; no partial point)
О. OMe reagent(s) CI р. ОН reagent(s): ОН q. Br reagent(s): ОН r. ОН reagent(s): "OEt Br S. reagent(s): Br
1. Predict the product(s) (or no reaction) and reagent(s). (31
pts; no partial point)
OMe O. reagent(s): CI р. ОН reagent(s): ОН q. Br reagent(s) Но reagent(s) r. ОН Br OEt S. reagent(s): Br
1. Predict the product(s) (or no reaction) and reagent(s). (31
pts; no partial point)
ནོ། reagent(s): oH reagent(s): oH reagent(s): oH OH reagent(s): Br OFT reagent(s);
1. Predict the product(s) (or no reaction) and reagent(s). (31
pts; no partial point)
OTE hint: multiple steps 1. LiAlH4, THE 2. HCI, H2O 3. PBr3, THE CN a1. LOH 1. PCC, DCM 2. Mg, Et20 3. HCI, H20 1. MSCI, pyr 2. KO'Bu, BuOH
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 42 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago