Homework Answers
![HE =list ka = 1.1 x 104 _ _ HE cad) + H20C4) H30* (94) +F (aq) 0 0 1.5 - X 1.5 - + x + x ka = [H][F] CHF7 = [x][x] (1.5-x) ka](http://img.homeworklib.com/questions/9c1de9b0-77ec-11ea-8536-cbca7967c8e6.png?x-oss-process=image/resize,w_560)
![2:519 Acetic Acid ka = 118X10 quacoon + H₂O - H₂ + Charge 2 .5 . 5 +x x +x x 2.5 -x kas [ H₃ ot [Chacool - C CH₃coon] [x] [x](http://img.homeworklib.com/questions/9ca3f160-77ec-11ea-9889-63cdc17ae254.png?x-oss-process=image/resize,w_560)
Add Answer to:
Practice exercises: Find the pH of the following solutions. Refer to the table at the beginning...
Practice exercises Find the pH of the solutions (Write the chemical reaction first. Then solve for...
Practice exercises Find the pH of the solutions (Write the chemical reaction first. Then solve for [OH (aq)l, et to get pH). Refer to the table at the beginning of the section for Ki values 1. 2.4M methylamine. K 2.0M pyridine. Kb = 1.7 x 10" 2.
Need help with number three please salt Find the pH of a buffer solution containing of...
Need help with number three please
salt Find the pH of a buffer solution containing of 1.5M sodium acetate and 0.9M acetic acid. The K. of acetic acid is 1.8 x 105. acid pH=pka + log I salt) pH =-103(18410 9) +10g -(-4.74)+(. 2a) =14.96 2. Find the pH of 100.0 mL of the buffer from exercise 1 after the addition of 0.030 mol of gascous hydrochloric acid. Assume no volume change. Find the pH of 200.0 mL buffer from...
Module 10 Homework Refer to the table at the beginning of the section for K. and...
Module 10 Homework Refer to the table at the beginning of the section for K. and K. values. 77 x 10-M Ba(OH), solution? What is the 1. What is the H.O ion concentration pH? 2. Calculate the OH ion concentration of a 6.2 x 10' M HNO, solution. 3. Calculate the pH of an aqueous solution containing 6.02 x 10 H,O' ions per liter. 4. Calculate the pH of a 1.2 M HCN solution. K.-4.9 x 100 for HCN 5....
Module 11 Homework 1. Find the pH of a buffer solution containing of 1.5M sodium acetate...
Module 11 Homework 1. Find the pH of a buffer solution containing of 1.5M sodium acetate and 0.9M acetic acid. The K, of acetic acid is 1.8 x 105. 2. Find the pH of 100.0 mL of the buffer from exercise 1 after the addition of 0.030 mol of gaseous hydrochloric acid. Assume no volume change. 3. Find the pH of 200.0 mL buffer from exercise 1 after the addition of 150.0 mL of 0.020M NaOH. 4. What conjugate acid-base...
D. Buffers 1. A buffer solution was made by dissolving 10.0 grams of sodium acetate in...
D. Buffers 1. A buffer solution was made by dissolving 10.0 grams of sodium acetate in 200.0 mL of 1.50 M acetic acid. Assuming the change in volume when the sodium acetate is added is not significant, estimate the pH of the acetic acid/sodium acetate buffer solution. The K, for acetic acid is 1.8 x 105. 2. Calculate the pH of a buffer solution that initially consists of 0.0400 moles of ammonia and 0.0250 moles of ammonium ion, after 20.0...
Calculate the pH of each of the following buffered solutions. K. (HC2H2O2) = 1.8 x 10-5...
Calculate the pH of each of the following buffered solutions. K. (HC2H2O2) = 1.8 x 10-5 1.0.19 M acetic acid/0.23 M sodium acetate pH 2.0.23 M acetic acid/0.19 M sodium acetate PH 3. 0.070 M acetic acid/0.18 M sodium acetate PH 4.0.18 M acetic acid/0.070 M sodium acetate PH
Acid/Base Study Packet Some Simple Acid/Base problems for you ... Calculate the pH of the following solutions: (Sho...
Acid/Base Study Packet Some Simple Acid/Base problems for you ... Calculate the pH of the following solutions: (Show ALL of your work) a. 2.3 x 10-2 M HNO3 b. 0.065 M Ba(OH)2 c. 2.55 M NaOH d. 0.025 M Naci e. 0.00086 M Al(OH)3 (assume 100% dissociation) f. 3.4 x 102 M acetic acid K= 1.8 x 10-5 g. 5.3 x 10-3 M formic acid K = 1.8 x 104 h. 4.6 x 10-4 M pyridine Kb = 1.9 x...
ACIDS AND BASES Predicting the qualitative acid-base properties of salts Consider the following data on some...
ACIDS AND BASES Predicting the qualitative acid-base properties of salts Consider the following data on some weak acids and weak bases: base K acid K name formula acetic acid HCH,CO, 1.8 X 105 name formula aniline CH3NH2 4.3x10-10 pyridine CHN 1.7x10-9 hydrofluoric acid HF 6.8*10+ Use this data to rank the following solutions in order of increasing pH. In other words, select a 'l' next to the solution that will have the lowest pH, a 2 next to the solution...
Which one of the following solutions has the lowest pH? A. a 0.1 M solution of...
Which one of the following solutions has the lowest pH? A. a 0.1 M solution of formic acid, HCOOH (Ka = 1.8 x 10-4) B. a 0.1 M solution of ammonium chloride, NH4Cl(s) (Ka (NH4+) = 5.6 x 10-10) C. a 0.01 M solution of acetic acid, CH3COOH (Ka = 1.8 x 10-5) D. a 0.01 M solution of formic acid, HCOOH (Ka = 1.8 x 10-4) E. a 0.1 M solution of acetic acid, CH3COOH (Ka = 1.8 x...
1. Calculate the pH of the following solutions. Show all of your work. a. 0.0050 M...
1. Calculate the pH of the following solutions. Show all of your work. a. 0.0050 M nitric acid, HNO3 b. 0.50 M hydrocyanic acid, HCN Ka = 4.0 x 10-10 2. A student was given the following problem: Calculate the pH of a 0.50 Mama bromide (NHaBr) solution if the Kb of NH3 is 1.8 x 10. The student provided the fo work. Identify the error(s) and calculate the correct pH. NH; (aq) + H20 (1) = NH3 (aq) +...
Practice exercises Find the pH of the solutions (Write the chemical reaction first. Then solve for [OH (aq)l, et to get pH). Refer to the table at the beginning of the section for Ki values 1. 2.4M methylamine. K 2.0M pyridine. Kb = 1.7 x 10" 2.
Need help with number three please
salt Find the pH of a buffer solution containing of 1.5M sodium acetate and 0.9M acetic acid. The K. of acetic acid is 1.8 x 105. acid pH=pka + log I salt) pH =-103(18410 9) +10g -(-4.74)+(. 2a) =14.96 2. Find the pH of 100.0 mL of the buffer from exercise 1 after the addition of 0.030 mol of gascous hydrochloric acid. Assume no volume change. Find the pH of 200.0 mL buffer from...
Module 10 Homework Refer to the table at the beginning of the section for K. and K. values. 77 x 10-M Ba(OH), solution? What is the 1. What is the H.O ion concentration pH? 2. Calculate the OH ion concentration of a 6.2 x 10' M HNO, solution. 3. Calculate the pH of an aqueous solution containing 6.02 x 10 H,O' ions per liter. 4. Calculate the pH of a 1.2 M HCN solution. K.-4.9 x 100 for HCN 5....
Module 11 Homework 1. Find the pH of a buffer solution containing of 1.5M sodium acetate and 0.9M acetic acid. The K, of acetic acid is 1.8 x 105. 2. Find the pH of 100.0 mL of the buffer from exercise 1 after the addition of 0.030 mol of gaseous hydrochloric acid. Assume no volume change. 3. Find the pH of 200.0 mL buffer from exercise 1 after the addition of 150.0 mL of 0.020M NaOH. 4. What conjugate acid-base...
D. Buffers 1. A buffer solution was made by dissolving 10.0 grams of sodium acetate in 200.0 mL of 1.50 M acetic acid. Assuming the change in volume when the sodium acetate is added is not significant, estimate the pH of the acetic acid/sodium acetate buffer solution. The K, for acetic acid is 1.8 x 105. 2. Calculate the pH of a buffer solution that initially consists of 0.0400 moles of ammonia and 0.0250 moles of ammonium ion, after 20.0...
Calculate the pH of each of the following buffered solutions. K. (HC2H2O2) = 1.8 x 10-5 1.0.19 M acetic acid/0.23 M sodium acetate pH 2.0.23 M acetic acid/0.19 M sodium acetate PH 3. 0.070 M acetic acid/0.18 M sodium acetate PH 4.0.18 M acetic acid/0.070 M sodium acetate PH
Acid/Base Study Packet Some Simple Acid/Base problems for you ... Calculate the pH of the following solutions: (Show ALL of your work) a. 2.3 x 10-2 M HNO3 b. 0.065 M Ba(OH)2 c. 2.55 M NaOH d. 0.025 M Naci e. 0.00086 M Al(OH)3 (assume 100% dissociation) f. 3.4 x 102 M acetic acid K= 1.8 x 10-5 g. 5.3 x 10-3 M formic acid K = 1.8 x 104 h. 4.6 x 10-4 M pyridine Kb = 1.9 x...
ACIDS AND BASES Predicting the qualitative acid-base properties of salts Consider the following data on some weak acids and weak bases: base K acid K name formula acetic acid HCH,CO, 1.8 X 105 name formula aniline CH3NH2 4.3x10-10 pyridine CHN 1.7x10-9 hydrofluoric acid HF 6.8*10+ Use this data to rank the following solutions in order of increasing pH. In other words, select a 'l' next to the solution that will have the lowest pH, a 2 next to the solution...
1. Calculate the pH of the following solutions. Show all of your work. a. 0.0050 M nitric acid, HNO3 b. 0.50 M hydrocyanic acid, HCN Ka = 4.0 x 10-10 2. A student was given the following problem: Calculate the pH of a 0.50 Mama bromide (NHaBr) solution if the Kb of NH3 is 1.8 x 10. The student provided the fo work. Identify the error(s) and calculate the correct pH. NH; (aq) + H20 (1) = NH3 (aq) +...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 32 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago