True or false: The net ionic equation for the reaction of an acid and a base...
True or false:
The net ionic equation for the reaction of an acid and a base is H+ (aq) + OH- (aq) ---> H2O (l)
Homework Answers
The net ionic equation for the reaction of an acid and a base is H+ (aq) + OH- (aq) ---> H2O (l)
Answer : False
Explanation :
this statement is not always true. because in case of strong acid and strong base this is true.
but in case of weak acid and weak base , this is not ture.
Add Answer to:
True or false:
The net ionic equation for the reaction of an acid and a base...
Part A Which is a net ionic equation for the neutralization reaction of a strong acid...
Part A Which is a net ionic equation for the neutralization reaction of a strong acid with a weak base? Which is a net ionic equation for the neutralization reaction of a strong acid with a weak base? HCl(aq) + NH3(aq) ↔ NH4Cl(aq) H3O+(aq) + NH3(aq) ↔ NH4+(aq) + H2O(l) HCl(aq) + NaOH(aq) ↔ H2O(l) + NaCl(aq) H3O+(aq) + OH-(aq) ↔ 2 H2O(l)
for each precipitation reaction , write the net Ionic equation for each acid - base ,...
for each precipitation reaction , write the net Ionic equation for each acid - base , identify the acid in the reactants for each redox , identidy the lements that are being oxidized and reduced. 2 c8h 18 (g) +25 o2(g) ----16 CO2(g) + 18 h2o k2SO4 (aq) + 2 AgNO3 ( aq ) ----- Ag2SO4(s)+ 2 KNO3 (aq) 4 Na(s) +O2(g) ------ 2 Na2O(s) CH3COOH(aq) +KOH (aq) -------- H2O(l)+ CH3COOK (aq) Ni(NO3) 2(aq) + Mg(OH)2(aq) ------Ni(OH)2(s) +Mg(NO3)2(aq)
1)Write the balanced NET IONIC equation for the reaction that occurs when hydrocyanic acid and potassium...
1)Write the balanced NET IONIC equation for the reaction that
occurs when hydrocyanic acid and potassium
hydroxide are combined.
(aq)(s)(l)(g)
+
(aq)(s)(l)(g)
(aq)(s)(l)(g)
+
(aq)(s)(l)(g)
+
(aq)(s)(l)(g)
This reaction is classified as .
A. Strong Acid + Strong Base
B. Weak Acid + Strong Base
C. Strong Acid + Weak Base
D. Weak Acid + Weak Base
2)Write the balanced NET IONIC equation for the reaction that
occurs when nitric acid and
ammonia are combined.
Use H3O+ instead of
H+....
please write Net Ionic equation Write the balanced NET IONIC equation for the reaction that occurs...
please write Net Ionic equation Write the balanced NET IONIC equation for the reaction that occurs when ammonium chloride and calcium hydroxide are combined. (aq)(s)(l)(g) + (aq)(s)(l)(g) (aq)(s)(l)(g) + (aq)(s)(l)(g) + (aq)(s)(l)(g) This reaction is classified as . A. Strong Acid + Strong Base B. Weak Acid + Strong Base C. Strong Acid + Weak Base D. Weak Acid + Weak Base The extent of this reaction is: . A. ... Below 50% B. ... 50% C. ... Above 50%...
What is the net ionic equation for the neutralization reaction between a HI with NH3? HI...
What is the net ionic equation for the neutralization reaction between a HI with NH3? HI (aq) + NH3 (aq) ⇌ NH4I (aq), HI (aq) + OH- (aq) ⇌ H2O (l) + I- (aq), H3O+ (aq) + OH- (aq) ⇌ 2 H2O (l) H3O+ (aq) = NH3 (aq) = NH4+ (aq) + H2O (l) Which statement about buffers is NOT true? A buffer can be made by neutralizing some of the weak base in solution by adding a strong acid,...
Write the net ionic equation for the chemical reaction shown. Include physical states. HCIO,(aq) + NaOH(aq)...
Write the net ionic equation for the chemical reaction shown. Include physical states. HCIO,(aq) + NaOH(aq) — H2O(l) + NaClO2 (aq) net ionic equation: H+ (aq) + OH(aq) — H,O(1) + C10, (aq)
the net ionic equation for each of the equations please!!! TIA net ionic equation of each formula Hidily, Tou...
the net ionic equation for each of the equations please!!!
TIA
net
ionic equation of each formula
Hidily, Tou your Unbalanced Chemical Reaction Al(s) + KOH(aq) + H2O(l) → KAl(OH),(aq) + H2(g) Balanced Chemical Reaction We were unable to transcribe this imageTotal Ionic Equation 2 Al(OH),(s) + [6 H+ + 3 90,2-H(aq) → [2 A13+ +3 30,2-)(aq) + 6 H,0(1) Net Ionic Equation Unbalanced Chemical Reaction Al2(SO2)3(aq) + K,SO,(aq) + 24 H,O(1) ► 2 KAl(SO2: 12 H,0(s) 5. Combining eutn...
1) The net ionic equation for the reaction between aqueous nitric acid and aqueous sodium hydroxide...
1) The net ionic equation for the reaction between aqueous nitric acid and aqueous sodium hydroxide is A) H+ (aq) + HNO3 (aq) + 2OH- (aq) → 2H20 (1) + NO3- (aq) B) HNO3 (aq) + NaOH(aq) → NaNO3(aq) + H20 (1) C) H+ (aq) + OH- (aq) + H2O (1) D) HNO3 (aq) + OH- (aq) + NO3- (aq) + H2O (1) E) H+ (aq) + Na+ (aq) + OH- (aq) → H20 (1) + Na+ (aq) 2) Which...
Write the net ionic equation for the acid-base reaction. Include physical states. HBr(aq) + LIOH(aq)H,O()+ LiBr(aq)...
Write the net ionic equation for the acid-base reaction. Include physical states. HBr(aq) + LIOH(aq)H,O()+ LiBr(aq) net ionic equation: help contact us terms of use privacy policy about us careers
Award: 0 out of 10.00 points Identify the correct net ionic equation for the reaction that...
Award: 0 out of 10.00 points Identify the correct net ionic equation for the reaction that occurs when solutions of HF and KOH are mixed. O HF(aq) + KOH(s) → H2O(1) + KF(aq) H(aq) + OH"(aq) → H20(1) O HF(aq) + KOH(aq) → H2O(1) + KF(s) O H+(aq) + KOH(aq) → H2O(1) + K+(aq) O HF(aq) + OH"(aq) → H2O(l) + F"(aq)
Write the net ionic equation for the chemical reaction shown. Include physical states. HCIO,(aq) + NaOH(aq) — H2O(l) + NaClO2 (aq) net ionic equation: H+ (aq) + OH(aq) — H,O(1) + C10, (aq)
the net ionic equation for each of the equations please!!!
TIA
net
ionic equation of each formula
Hidily, Tou your Unbalanced Chemical Reaction Al(s) + KOH(aq) + H2O(l) → KAl(OH),(aq) + H2(g) Balanced Chemical Reaction We were unable to transcribe this imageTotal Ionic Equation 2 Al(OH),(s) + [6 H+ + 3 90,2-H(aq) → [2 A13+ +3 30,2-)(aq) + 6 H,0(1) Net Ionic Equation Unbalanced Chemical Reaction Al2(SO2)3(aq) + K,SO,(aq) + 24 H,O(1) ► 2 KAl(SO2: 12 H,0(s) 5. Combining eutn...
1) The net ionic equation for the reaction between aqueous nitric acid and aqueous sodium hydroxide is A) H+ (aq) + HNO3 (aq) + 2OH- (aq) → 2H20 (1) + NO3- (aq) B) HNO3 (aq) + NaOH(aq) → NaNO3(aq) + H20 (1) C) H+ (aq) + OH- (aq) + H2O (1) D) HNO3 (aq) + OH- (aq) + NO3- (aq) + H2O (1) E) H+ (aq) + Na+ (aq) + OH- (aq) → H20 (1) + Na+ (aq) 2) Which...
Write the net ionic equation for the acid-base reaction. Include physical states. HBr(aq) + LIOH(aq)H,O()+ LiBr(aq) net ionic equation: help contact us terms of use privacy policy about us careers
Award: 0 out of 10.00 points Identify the correct net ionic equation for the reaction that occurs when solutions of HF and KOH are mixed. O HF(aq) + KOH(s) → H2O(1) + KF(aq) H(aq) + OH"(aq) → H20(1) O HF(aq) + KOH(aq) → H2O(1) + KF(s) O H+(aq) + KOH(aq) → H2O(1) + K+(aq) O HF(aq) + OH"(aq) → H2O(l) + F"(aq)
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago