In a paragraph, explain the "moral aspect" of the opioids prescription? In other words, try to...
In a paragraph, explain the "moral aspect" of the opioids prescription? In other words, try to focus on the value judgments rather than facts.
Homework Answers
more than 6 lakh people died because of a drug overdose in the US with more than 3 lakh deaths are due to opioids. when a person has changed in terms of their moral attributes, then their memory, personality, desires, preferences also gets changed. from a physician's point of view, prescribing opioids as pain killers is a sign of control and relief, but from a person's perspective, it is obviously a drug that creates its addiction. medical ethics say that opioids are indispensable, and therefore they are freely dispensed by pharmacists but now things have been changed and these types of medical decisions are into the hands of the patients. opioid prescription comes with a lot of risk including the risk of addiction and other side affects, as a result, many patients believe that opioids are saving their lives and its withdrawal will be terrified. keeping all these into consideration, it has been concluded that opioids are important only for acute, surgical, and post-traumatic pain.
Add Answer to:
In a paragraph, explain the "moral aspect" of the opioids
prescription? In other words, try to...
principles of microeconomics In a paragraph or two, explain in your own words what Amartya Sen...
principles of microeconomics
In a paragraph or two, explain in your own words what Amartya Sen meant by the process aspect and the opportunity aspect of freedom.
Hello, kindly help with these questions below in a 100-250 words well-developed paragraph. Define shock and...
Hello, kindly help with these questions below in a 100-250 words well-developed paragraph. Define shock and explain the implications. Include in your answer specific facts, data, examples, and other information drawn from your textbook and at least one other supplemental source. Case Scenario: Your patient has cardiovascular disease (CVD) and has been admitted with these vitals: BP 190/90, HR 100, RR 35. When asked about symptoms, the patient states, “I have a very bad headache and feel light-headed.” History reveals...
Explain the following in your own words please! Differentiate between RISC, CISC, and other traditional architectures....
Explain the following in your own words please! Differentiate between RISC, CISC, and other traditional architectures. Identify the components of the CPU and elaborate on each. Explain the use of buses in computers in a paragraph.
2-4 Explain in one short paragraph how less reliable climate change forecasts of what will happen...
2-4
Explain in one short paragraph how less reliable climate change forecasts of what will happen in the future cause less effort to reduce the impacts of climate change. 2. 3. Consider the impacts of using land for fruits and berries rather than a park. Turning the land into a park would lower benefits of these healthy foods for consumers by $10 million per year and that impact would last forever. (Assume farmers and other businesses would make equal profit...
***write a one-sentence summary for paragraph 1 and one for paragraph 2. And then, explain how...
***write a one-sentence summary for paragraph 1 and one for paragraph 2. And then, explain how these summaries are written.*** (1) The internet also makes it easier for people to organise face-to-face meetings rather than just maintain electronic contact with those living far away. It is worthwhile to note that face-to-face communication helps develop bonds of trust and reciprocity between individuals and such bonds help make societies healthier, more caring and more efficient. The internet can be used to make...
7. Why are the echinoderms exclusively marine? In other words, what anatomical feature precludes (prevents) them...
7. Why are the echinoderms exclusively marine? In other words, what anatomical feature precludes (prevents) them from adapting to freshwater or land? Explain. Phylum Chordata 8. What are the synapomorphies of chordates? What is the difference between a notochord and a nerve cord? 9. What were the advantages and challenges for vertebrates colonizing land? How did early amphibians partially solve them? Why might limbs rather than fins have been an advantage, even if the animal spent all or most of...
1 and 2 please 1. Explain why you would conduct a t test rather than a...
1 and 2 please
1. Explain why you would conduct a t test rather than a z test. In other words, what is the difference between a one sample t test and a one sample z test? 2. Because of what is discussed in question 1, some of the components of calculating at value are different from the components of a z value. Specifically, the t value utilizes degrees of freedom. Explain what degrees of freedom means (you can include...
You had an under-eating day. In other words, you ate fewer calories than you expended. Explain...
You had an under-eating day. In other words, you ate fewer calories than you expended. Explain how the body will deal with your caloric short fall. Include in your discussion: the hormones that will influence metabolism; what lipid enzyme is active; and what is happening in the different organs and tissues. Now you had an over eating day. Explain how the body will deal with your caloric excess. Include in your discussion: the hormones that will influence metabolism; what lipid...
Read just the long paragraph below and explain in your words the hypothesized evolutionary processes (note,...
Read just the long paragraph below and explain in your words the hypothesized evolutionary processes (note, more than one are in play) proposed to remove slightly deleterious alleles from the gene pool. Keep in mind the importance about balance between mutation rates and the consequences to individual fitness. "At first sight, it appears paradoxical that nearly neutral mutations in essential immune genes will be efficiently removed from the species’ gene pool despite having no easily discernible impact on the immune...
Theoretical Discussion - Asset Measurement There has been a general tred for accounting standard setters to...
Theoretical Discussion - Asset Measurement There has been a general tred for accounting standard setters to issue accounting standards that measure assest at 'fair value'. Other valuation approaches including cosy, net realizable value and present value are also required for particular classes of assests and liabilities as stipulated by particular accounting standards. Thus, we have a 'mixed approach' in measuring a company's financial performance and finanical position in Australia. In light of the above statement, you are required to: 1....
principles of microeconomics
In a paragraph or two, explain in your own words what Amartya Sen meant by the process aspect and the opportunity aspect of freedom.
2-4
Explain in one short paragraph how less reliable climate change forecasts of what will happen in the future cause less effort to reduce the impacts of climate change. 2. 3. Consider the impacts of using land for fruits and berries rather than a park. Turning the land into a park would lower benefits of these healthy foods for consumers by $10 million per year and that impact would last forever. (Assume farmers and other businesses would make equal profit...
7. Why are the echinoderms exclusively marine? In other words, what anatomical feature precludes (prevents) them from adapting to freshwater or land? Explain. Phylum Chordata 8. What are the synapomorphies of chordates? What is the difference between a notochord and a nerve cord? 9. What were the advantages and challenges for vertebrates colonizing land? How did early amphibians partially solve them? Why might limbs rather than fins have been an advantage, even if the animal spent all or most of...
1 and 2 please
1. Explain why you would conduct a t test rather than a z test. In other words, what is the difference between a one sample t test and a one sample z test? 2. Because of what is discussed in question 1, some of the components of calculating at value are different from the components of a z value. Specifically, the t value utilizes degrees of freedom. Explain what degrees of freedom means (you can include...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 37 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago