Homework Answers
The aspect of immune response that vaccines are based on;
E) Production of memory cells and high antibody titers from pathogen exposure (As it is to elicit an immune response against an antigen to prepare it for an exposure again by the antigen)
Add Answer to:
24) The aspect of the immune response that vaccines are based on is A) stimulation of...
1. Following a viral infection, what biological response(s) can occur? A. Inflammation B. Recruitment of immune...
1. Following a viral infection, what biological response(s) can occur? A. Inflammation B. Recruitment of immune cells to site of infection C. Fever D. All of the above 2. Preventine vaccines are intended to protect _______. A. Organisms already afflicted with the targeted viral infection B. Organisms free of the targeted viral infection C. Organisms that are immunocompromised D. Organisms that are defective in pathways regulating humoral immunity 3. Which of the following is not a type of passive immune...
Match the vocabulary word with the proper definition. Definitions _____ 1. involves mainly T cells and...
Match the vocabulary word with the proper definition. Definitions _____ 1. involves mainly T cells and leads to the destruction of cells that are infected with viruses _____ 2. involves mainly B cells and takes place in blood and lymph _____ 3. being able to resist a pathogen that infected the body in the past _____ 4. the deliberate exposure of a person to a pathogen in order to provoke an immune response _ ____ 5. part of the immune...
Question 1 (2 points) Saved Which of the following is a charcteristic of the innate immune...
Question 1 (2 points) Saved Which of the following is a charcteristic of the innate immune system but not the specific/adaptive immune system? - B cells produce antibody CD4 T cells organize the response can activate quickly has memory of a pathogen/antigen after the response Question 2 (2 points) In an immune response to a specific bacteria, which of the following happens after all of the others? production of IgA that can bind to the pathogen phagocytosis of the bacteria...
B - Immunology Saved Complete the sentences to review the types of vaccines available for immunization...
B - Immunology Saved Complete the sentences to review the types of vaccines available for immunization today. killed Vaccination is a type of immunity and serves to stimulate a primary and a memory response that primes the immune system for future exposure to a pathogen. artificial, active Categories of vaccines include vaccines, which are very effective as they employ large and complex immunogens. mutate One type, called vaccines, are prepared by cultivating the desired pathogen and then treating with chemicals...
Multiple Choice Questions 1. The natural, nonspecific resistance of the body to foreign invaders. First line...
Multiple Choice Questions 1. The natural, nonspecific resistance of the body to foreign invaders. First line of defense a. Innate immunity b. Adaptive immunity c. Component immunity d. High immunity 2. How do T cell help the body's immune system? a. Kill by contact b. Synthesize antibodies c. Immobilize antigens via contacting their immunoglobins d. None of the above 3. Adaptive immunity is also called_____________. a. Acquired immunity b. Advanced immunity c. Learned immunity d. Subjective immunity 4. Match the...
Multiple Choice Questions 1. The natural, nonspecific resistance of the body to foreign invaders. First line...
Multiple Choice Questions 1. The natural, nonspecific resistance of the body to foreign invaders. First line of defense a. Innate immunity b. Adaptive immunity c. Component immunity d. High immunity 2. How do T cell help the body's immune system? a. Kill by contact b. Synthesize antibodies c. Immobilize antigens via contacting their immunoglobins d. None of the above 3. Adaptive immunity is also called_____________. a. Acquired immunity b. Advanced immunity c. Learned immunity d. Subjective immunity 4. Match the...
Vaccinations require that humans have which type of immune system? innate immune system adaptive immune system...
Vaccinations require that humans have which type of immune system? innate immune system adaptive immune system all of the above 10 points QUESTION 2 Which of the following are examples of antigens? one of a group of proteins found in the blood that leads to the clumping of foreign blood cells proteins embedded in the membranes of T cells foreign molecules that trigger antibody production proteins that trigger the end of the inflammatory response 10 points QUESTION 3...
By which means of acquiring immunity is likely to produce the longest lasting protection? artificial active...
By which means of acquiring immunity is likely to produce the longest lasting protection? artificial active passive natural Active, artificial, natural, and passive all provide equally long-lasting protection. Each antibody molecule consists of a "light" protein chain. two light and two heavy protein chains. a "heavy" protein chain. one light and one heavy protein chain. various combinations of light and heavy protein chains. QUESTION 11 How is the immune system able to recognize a limitless number of different antigens and...
70) Why is the immune response to pneumococcal pneumonia the most damaging aspect of the disease?...
70) Why is the immune response to pneumococcal pneumonia the most damaging aspect of the disease? A) An exotoxin stimulates severe inflammation and provokes host tissue damage B) The capsule is the primary problem as humans are highly sensitive to it and easily aggravated by it C) A potent endotoxin stimulates a rapid high fever D) Blood clots are formed in the circulatory system in an effort to isolate the bacteria; however, these clots are often the cause of heart...
A host organism needs time, often days, to mount an immune response against a new antigen,...
A host organism needs time, often days, to mount an immune response against a new antigen, but memory cells permit a rapid response to pathogens previously encountered. A vaccine to protect against a particular viral infection often consists of weakened or killed virus or isolated proteins from a viral protein coat. When injected into a person, the vaccine generally does not cause an infection and illness, but it effectively teaches the immune system what the viral particles look like, stimulating...
Question 1 (2 points) Saved Which of the following is a charcteristic of the innate immune system but not the specific/adaptive immune system? - B cells produce antibody CD4 T cells organize the response can activate quickly has memory of a pathogen/antigen after the response Question 2 (2 points) In an immune response to a specific bacteria, which of the following happens after all of the others? production of IgA that can bind to the pathogen phagocytosis of the bacteria...
B - Immunology Saved Complete the sentences to review the types of vaccines available for immunization today. killed Vaccination is a type of immunity and serves to stimulate a primary and a memory response that primes the immune system for future exposure to a pathogen. artificial, active Categories of vaccines include vaccines, which are very effective as they employ large and complex immunogens. mutate One type, called vaccines, are prepared by cultivating the desired pathogen and then treating with chemicals...
By which means of acquiring immunity is likely to produce the longest lasting protection? artificial active passive natural Active, artificial, natural, and passive all provide equally long-lasting protection. Each antibody molecule consists of a "light" protein chain. two light and two heavy protein chains. a "heavy" protein chain. one light and one heavy protein chain. various combinations of light and heavy protein chains. QUESTION 11 How is the immune system able to recognize a limitless number of different antigens and...
70) Why is the immune response to pneumococcal pneumonia the most damaging aspect of the disease? A) An exotoxin stimulates severe inflammation and provokes host tissue damage B) The capsule is the primary problem as humans are highly sensitive to it and easily aggravated by it C) A potent endotoxin stimulates a rapid high fever D) Blood clots are formed in the circulatory system in an effort to isolate the bacteria; however, these clots are often the cause of heart...
A host organism needs time, often days, to mount an immune response against a new antigen, but memory cells permit a rapid response to pathogens previously encountered. A vaccine to protect against a particular viral infection often consists of weakened or killed virus or isolated proteins from a viral protein coat. When injected into a person, the vaccine generally does not cause an infection and illness, but it effectively teaches the immune system what the viral particles look like, stimulating...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 41 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 6 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago