True or false, deterimine the errors, and then write the correct answer in a complete sentence....
Homework Answers
Answer: False.
For using length measurement, the metric units that are being used are centimeters, milimeter as well as micrometer.
Add Answer to:
True or false, deterimine the errors, and then write the correct
answer in a complete sentence....
Determine the errors, then write the correct answer in a complete sentence. 1. Blood would most...
Determine the errors, then write the correct answer in a complete sentence. 1. Blood would most likely be measured in metric meters. 2. The metric unit that is less than one unit yet not used in medicine to measure length is the micrometer. 3. The "cubic centimeter" may be phased out of medical documentation and replaced with the cubic millimeter.
All of the following statements are false. Determine the errors, then write the correct answer in...
All of the following statements are false. Determine the errors, then write the correct answer in a complete sentence, 51. A kilogram is a household measure for solid weight. 52. Drops are usually compared with ounces 53. Drugs measured in units must be manufactured in a laboratory. - 54. Drops are easy to measure because the size of the aperture of the dropper prevents overdosing. 55. Volume refers to the amount or strength of a medication. - 56. When writing...
Determine the errors, then write the correct answer in a complete sentence. 1. When writing a...
Determine the errors, then write the correct answer in a complete sentence. 1. When writing a metric measurement the abbreviation for units is written before the Arabic number.
TRUE or FALSE, determine the errors and write the correct answer. 1. Blood would most likely...
TRUE or FALSE, determine the errors and write the correct answer. 1. Blood would most likely be measured in metric meters.
Practical Applications 41. An infant's head measured 560mm. Document this in centimeters. 42. A patient drank...
Practical Applications 41. An infant's head measured 560mm. Document this in centimeters. 42. A patient drank 1250 mL of coffee. Document this in liters. 43. The medication comes in 75 mcg and 2.5 mg strengths. Explain which medication is stronger (a large 44. The length of the wound is 2.75 cm. Document this in millimeters. 45. The directions on the cough syrup said "take two tablespoons." How many teaspoons would be equivalent to tablespoons? 46. Explain which weight is larger,...
True or false, determine the errors and write a correct answer. 1. Drops are usually compared...
True or false, determine the errors and write a correct answer. 1. Drops are usually compared with ounces.
True or False, determine the errors and write a correct answer. 1. The cubic centimer may...
True or False, determine the errors and write a correct answer. 1. The cubic centimer may be phased out of medical documentation and replaced with the cubic milliemeter.
say if its true ir false Indicate the True (1) or False statement in the following...
say if its true ir false
Indicate the True (1) or False statement in the following 1. ( The vernier scale (on the smaller moving portion of the caliper) gives the most significant digits in the reading 2. ) Abbe's principle states that the minimum accuracy may obtain when the standard scale and the work piece being measured are aligned on the same line measurement 3. (' ) Thermocouples can be made smaller in size than most RTD's so they...
Which one from the following statements is true (T), and which is false (F)? [I mark each (5 Marks) Q1. random errors due to environmental factors a) Determinate errors are random errors due to e...
Which one from the following statements is true (T), and which is false (F)? [I mark each (5 Marks) Q1. random errors due to environmental factors a) Determinate errors are random errors due to environmental factors b) Qualititative analysis refers to what is in the sample c) A primary standard is a high molecular weight chemical d) For the Mohr method, the titration is used to measure halides e) Classical methods are slower than instrumental methods-L-
Which one from the...
Complete the sentence by choosing the correct answer from the drop down list: During the titration...
Complete the sentence by choosing the correct answer from the drop down list: During the titration of a strong acid with a strong base, the pH at equivalence point is Greater than Less than Equal to
All of the following statements are false. Determine the errors, then write the correct answer in a complete sentence, 51. A kilogram is a household measure for solid weight. 52. Drops are usually compared with ounces 53. Drugs measured in units must be manufactured in a laboratory. - 54. Drops are easy to measure because the size of the aperture of the dropper prevents overdosing. 55. Volume refers to the amount or strength of a medication. - 56. When writing...
Practical Applications 41. An infant's head measured 560mm. Document this in centimeters. 42. A patient drank 1250 mL of coffee. Document this in liters. 43. The medication comes in 75 mcg and 2.5 mg strengths. Explain which medication is stronger (a large 44. The length of the wound is 2.75 cm. Document this in millimeters. 45. The directions on the cough syrup said "take two tablespoons." How many teaspoons would be equivalent to tablespoons? 46. Explain which weight is larger,...
say if its true ir false
Indicate the True (1) or False statement in the following 1. ( The vernier scale (on the smaller moving portion of the caliper) gives the most significant digits in the reading 2. ) Abbe's principle states that the minimum accuracy may obtain when the standard scale and the work piece being measured are aligned on the same line measurement 3. (' ) Thermocouples can be made smaller in size than most RTD's so they...
Which one from the following statements is true (T), and which is false (F)? [I mark each (5 Marks) Q1. random errors due to environmental factors a) Determinate errors are random errors due to environmental factors b) Qualititative analysis refers to what is in the sample c) A primary standard is a high molecular weight chemical d) For the Mohr method, the titration is used to measure halides e) Classical methods are slower than instrumental methods-L-
Which one from the...
Complete the sentence by choosing the correct answer from the drop down list: During the titration of a strong acid with a strong base, the pH at equivalence point is Greater than Less than Equal to
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 35 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago