Calculate delta H rxn for each of the following:
(a) SiO2(s) + 4HF(g) > SiF4(g) + 2H2O(l)
(b) C2H6(g) + O2(g) > CO2(g) + H2O(g) [unbalanced]
Homework Answers
Add Answer to:
Calculate delta H rxn for each of the following:
(a) SiO2(s) + 4HF(g) > SiF4(g) +...
Hess's Law Practice Find AH° for the following equation: SiO2(s) + 4HF(g) → SiF4(g) + 2H2O(g)...
Hess's Law Practice Find AH° for the following equation: SiO2(s) + 4HF(g) → SiF4(g) + 2H2O(g) Using the following equations: Si(s) + O2(g) → SiO2(s) Si(s) + 2F2(g) → SiF4(g) H2(g) + F2(g) → 2HF(g) H2(g) + 4202(g) → H2O(g) AH = -910.9 kJ/mol rxn AH = -1651 kJ/mol rxn AH = -542 kJ/mol rxn AH = -241.8 kJ/mol rxn
654 Calculate ΔΗ'm for each of the following: (a) SiO2(s)+4HF(g) -SiF4(g) + 2H:O() (b) CHo(8)+0(g) CO2(g)+H20(g)...
654 Calculate ΔΗ'm for each of the following: (a) SiO2(s)+4HF(g) -SiF4(g) + 2H:O() (b) CHo(8)+0(g) CO2(g)+H20(g) (unbalanced]
Consider the following: SiF4 (g) + 2H2O (g) < ---> SiO2 (s) + 4HF (g) ...
Consider the following: SiF4 (g) + 2H2O (g) < ---> SiO2 (s) + 4HF (g) Kp=7.44 x 10-3 at 2000 K a) Write the equilibrium expression b) Calculate Kc for the above reaction. Will the reaction go to the right, the left, or is it at equilibrium under the following initial conditions? [HF] = 0.100M Given the above information, calculate the value of Kp for the following reaction at 2000 K: 1/2 SiO2 (s) + 2HF (g) <- ->...
Determine which of the following chemical equations are correctly balanced. Fe2O3(s)+CO(g)→2Fe(s)+CO2(g) Al2S3(s)+H2O(l)→2Al(OH)3(s)+3H2S(g) 2Cr(s)+3O2(g)→Cr2O3(s) SiO2(s)+4HF(aq)→SiF4(g)+2H2O(l)
Determine which of the following chemical equations are correctly balanced. Fe2O3(s)+CO(g)→2Fe(s)+CO2(g) Al2S3(s)+H2O(l)→2Al(OH)3(s)+3H2S(g) 2Cr(s)+3O2(g)→Cr2O3(s) SiO2(s)+4HF(aq)→SiF4(g)+2H2O(l)
Use the example shown to calculate the reaction enthalpy, delta H, for the following reaction: CH4(g)+2O2(g)->CO2(g)2H2O(l)....
Use the example shown to calculate the reaction enthalpy, delta H, for the following reaction: CH4(g)+2O2(g)->CO2(g)2H2O(l). Use the series of reaction that follows: 1. C(s)+2H2(g)-> CH4(g), delta H= -74.8 kJ 2. C(s)+O2(g)->CO2(g), delta H= -393.5 kJ 3. 2H2(g)+O2(g)-> 2H2O(g), delta H= -484.0 kJ 4. H2O(l)->H2O(g), delta H= 44.0 kJ
Use data from Appendix IIB in the textbook to calculate ΔS∘rxn for each of the following reactions. C2H4(g)+H2(g)→C2H6...
Use data from Appendix IIB in the textbook to calculate ΔS∘rxn for each of the following reactions. C2H4(g)+H2(g)→C2H6(g) MgCO3(s)→MgO(s)+CO2(g) CO(g)+H2O(g)→H2(g)+CO2(g) 2H2S(g)+3O2(g)→2H2O(l)+2SO2(g)
Use standard enthalpies of formation (in Appendix G in text) to calculate ∆H°rxn for each reaction. ...
Use standard enthalpies of formation (in Appendix G in text) to calculate ∆H°rxn for each reaction. ∑ m∆H°f (products) - ∑n∆H°f (reactants), where m and n are coefficients. C2H4(g) + H2(g) ----- > C2H6(g) CO (g) + H2O (g) ----- > H2(g) + CO2(g) 3NO2(g) + H2O (l) ----- > 2HNO3(aq) + NO (g) 2SO2(g) + O2(g) -----------> 2SO3(g) 2C4H10 (g) + 13O2 (g) -----------> 8CO2 (g) + 10H2O (g) Substance --- ΔH° (kJ mol–) --- ΔG° (kJ mol–1) --- S°298 (J K–1 mol–1) C2H4 52.4 86.4 219.3 H2 0 0 130.7 C2H6 -84.0 -32.0 229.2 CO -110.52 -137.15 197.7 H2O -285.83 -237.1 70.0 CO2 -393.51 -394.36 213.8 NO2 33.2 51.30 240.1 NO 90.25 87.6 210.8 SO2 -296.83 -300.1 248.2 O2 0 0 205.2 SO3 -395.72 -371.06 256.76
) Predict the effect of increasing pressure for each of the following equilibriums: (a) 2H2O (g)...
) Predict the effect of increasing pressure for each of the following equilibriums: (a) 2H2O (g) + N2 (g) ↔ 2H2 (g) + 2NO (g) ________________________ (b) SiO2 (s) + 4HF (g) ↔ SiF4 (g) + 2H2O (g) ________________________ (c) CO (g) + H2 (g) ↔ C(s) + H2O (g) __
8.) From the values of delta H and delta S, calculate delta G then predict whether...
8.) From the values of delta H and delta S, calculate delta G then predict whether the following reactions would be spontaneous or not at 25 C. a) Reaction A: delta H= 10.5 kJ/mol, and delta S = 30 J/K mol b) Reaction B: delta H=1.8 kJ/mol, and delta S = -113 J/K mol 9.) Calculate the delta G and K, for the following equilibrium reaction at 25 C: 2H2O(Ⓡ) <-> 2H2(g) + O2(8) delta Gran H2O(x) = -228.6 kJ/mol
52. Is each chemical equation correctly balanced? If not, correct it. (a) SiO2(s) + 4 HF(aq)...
52. Is each chemical equation correctly balanced? If not, correct it. (a) SiO2(s) + 4 HF(aq) — SiF4(g) + 2H2O(1) (b) 2 Cr(s) + 3 02(8) —Cr2O3(s) (c) Al,Sz(s) + H2O(l) —> 2 Al(OH)3(s) + 3H2S(8) (d) Fe2O3(s) + CO(g) — 2 Fe(s) + CO2(g)
Hess's Law Practice Find AH° for the following equation: SiO2(s) + 4HF(g) → SiF4(g) + 2H2O(g) Using the following equations: Si(s) + O2(g) → SiO2(s) Si(s) + 2F2(g) → SiF4(g) H2(g) + F2(g) → 2HF(g) H2(g) + 4202(g) → H2O(g) AH = -910.9 kJ/mol rxn AH = -1651 kJ/mol rxn AH = -542 kJ/mol rxn AH = -241.8 kJ/mol rxn
654 Calculate ΔΗ'm for each of the following: (a) SiO2(s)+4HF(g) -SiF4(g) + 2H:O() (b) CHo(8)+0(g) CO2(g)+H20(g) (unbalanced]
8.) From the values of delta H and delta S, calculate delta G then predict whether the following reactions would be spontaneous or not at 25 C. a) Reaction A: delta H= 10.5 kJ/mol, and delta S = 30 J/K mol b) Reaction B: delta H=1.8 kJ/mol, and delta S = -113 J/K mol 9.) Calculate the delta G and K, for the following equilibrium reaction at 25 C: 2H2O(Ⓡ) <-> 2H2(g) + O2(8) delta Gran H2O(x) = -228.6 kJ/mol
52. Is each chemical equation correctly balanced? If not, correct it. (a) SiO2(s) + 4 HF(aq) — SiF4(g) + 2H2O(1) (b) 2 Cr(s) + 3 02(8) —Cr2O3(s) (c) Al,Sz(s) + H2O(l) —> 2 Al(OH)3(s) + 3H2S(8) (d) Fe2O3(s) + CO(g) — 2 Fe(s) + CO2(g)
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 34 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 3 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 6 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 6 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 7 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago